Embramine: Difference between revisions

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 444563658

| IUPAC_name = 2-[1-(4-Bromophenyl)-1-phenylethoxy]-''N'',''N''-dimethylethanamine

| image = Embramine.svg

<!--Clinical data-->

| tradename =

| Drugs.com = {{drugs.com|international|embramine}}

| pregnancy_category =

| legal_status =

| routes_of_administration =

<!--Pharmacokinetic data-->

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

<!--Identifiers-->

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 3565-72-8

| ATC_prefix = None

| ATC_suffix =

| PubChem = 19105

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 18032

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 2110819

<!--Chemical data-->

| C=18 | H=22 | Br=1 | N=1 | O=1

| smiles = CC(C1=CC=CC=C1)(C2=CC=C(C=C2)Br)OCCN(C)C

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C18H22BrNO/c1-18(21-14-13-20(2)3,15-7-5-4-6-8-15)16-9-11-17(19)12-10-16/h4-12H,13-14H2,1-3H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = URSRSKSNFPUKGH-UHFFFAOYSA-N

'''Embramine''' (a.k.a. '''Mebryl''', '''Bromadryl''') is an [[antihistamine]] and [[anticholinergic]].<ref>{{cite journal | vauthors = Novak L, Protiva M | title = Antihistamine substances. XLVII. Mephenhydramine derivatives substituted in the p- and m-position | journal = Collection of Czechoslovak Chemical Communications | volume = 24 | pages = 3966–77 | date = 1959 | doi = 10.1135/cccc19593966 }}</ref>

[[Category:Diphenhydramines]]

[[Category:H1 receptor antagonists]]

[[Category:Organobromides]]

{{respiratory-system-drug-stub}}