Diproteverine: Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
+{{short description|Chemical compound}}
-{{drugbox
+{{Drugbox
-| UNII_Ref = {{fdacite|correct|FDA}}
+| Watchedfields = changed
-| UNII = 8A5OIA91GT
-| verifiedrevid = 437166122
+| verifiedrevid = 444829154
-| IUPAC_name        = 1-[(3,4-diethoxyphenyl)methyl]-6,7-dipropan-2-<br>yloxy-3,4-dihydroisoquinoline
+| IUPAC_name = 1-[(3,4-diethoxyphenyl)methyl]-6,7-dipropan-2-<br>yloxy-3,4-dihydroisoquinoline
-| image             = Diproteverine.svg
+| image = Diproteverine.svg
+<!--Clinical data-->
+| tradename =
+| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
+| pregnancy_US = <!-- A / B            / C / D / X -->
+| pregnancy_category =
+| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
+| legal_CA = <!--             / Schedule I, II, III, IV, V, VI, VII, VIII -->
+| legal_UK = <!-- GSL         / P       / POM / CD / Class A, B, C -->
+| legal_US = <!-- OTC                   / Rx-only  / Schedule I, II, III, IV, V -->
+| legal_status =
+| routes_of_administration =
+<!--Pharmacokinetic data-->
+| bioavailability =
+| protein_bound =
+| metabolism =
+| elimination_half-life =
+| excretion =
+<!--Identifiers-->
+| CAS_number = 69373-95-1
+| CAS_supplemental = <br />{{CAS|69373-88-2}} (hydrochloride)
+| ATC_prefix = none
+| ATC_suffix =
+| PubChem = 50463
+| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
+| DrugBank =
 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
 | ChemSpiderID = 45755
+| UNII_Ref = {{fdacite|correct|FDA}}
-| InChI = 1/C26H35NO4/c1-7-28-23-10-9-19(14-24(23)29-8-2)13-22-21-16-26(31-18(5)6)25(30-17(3)4)15-20(21)11-12-27-22/h9-10,14-18H,7-8,11-13H2,1-6H3
+| UNII = 8A5OIA91GT
-| InChIKey = APMMVXSVJLZZRR-UHFFFAOYAF
+<!--Chemical data-->
+| C=26 | H=35 | N=1 | O=4
 | smiles = O(c1ccc(cc1OCC)CC/2=N/CCc3cc(OC(C)C)c(OC(C)C)cc\23)CC
 | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
@@ Line 14: / Line 45: @@
 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
 | StdInChIKey = APMMVXSVJLZZRR-UHFFFAOYSA-N
-| CAS_number        = 69373-95-1
-| CAS_supplemental  = <br />{{CAS|69373-88-2}} (hydrochloride)
-| ATC_prefix        = none
-| ATC_suffix        =
-| PubChem           = 50463
-| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
-| DrugBank          =
-| C=26|H=35|N=1|O=4
-| molecular_weight  = 425.56 g/mol
-| bioavailability   =
-| protein_bound     =
-| metabolism        =
-| elimination_half-life =
-| excretion         =
-| pregnancy_AU      =  <!-- A / B1 / B2 / B3 / C / D / X -->
-| pregnancy_US      =  <!-- A / B            / C / D / X -->
-| pregnancy_category=
-| legal_AU          =  <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
-| legal_CA          =  <!--             / Schedule I, II, III, IV, V, VI, VII, VIII -->
-| legal_UK          =  <!-- GSL         / P       / POM / CD / Class A, B, C -->
-| legal_US          =  <!-- OTC                   / Rx-only  / Schedule I, II, III, IV, V -->
-| legal_status      =
-| routes_of_administration =
 }}
-'''Diproteverine''' (usually as diproteverine [[hydrochloride]]) is a [[calcium channel blocker]].
+'''Diproteverine''' (usually as diproteverine [[hydrochloride]]) is a [[calcium channel blocker]].<ref name="pmid2055233">{{cite journal | vauthors = Lacroix P, Linee P, Forest MC | title = Diproteverine (BRL 40015): a new type of calcium antagonist with potential antianginal properties | journal = European Journal of Pharmacology | volume = 192 | issue = 3 | pages = 317–27 | date = January 1991 | pmid = 2055233 | doi = 10.1016/0014-2999(91)90220-k }}</ref>
+== References ==
+{{Reflist}}
 {{antihypertensive-stub}}
 [[Category:Calcium channel blockers]]
 [[Category:Phenol ethers]]
+[[Category:Isopropyl compounds]]