Annulatin: Difference between revisions
Content deleted Content added
Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Wikipedia:WikiProject Chemicals/Chem |
Citation bot (talk | contribs) Add: issue, volume, journal, date, title, authors 1-7. | Use this bot. Report bugs. | Suggested by Marbletan | #UCB_webform |
||
| (17 intermediate revisions by 14 users not shown) | |||
| Line 1: | Line 1: | ||
{{one source|date=August 2014}} |
|||
{{chembox |
{{chembox |
||
| Watchedfields = changed |
|||
| verifiedrevid = |
| verifiedrevid = 445859665 |
||
| Name = Annulatin |
| Name = Annulatin |
||
| ImageFile = Annulatin.svg |
| ImageFile = Annulatin.svg |
||
| Line 6: | Line 8: | ||
| ImageName = Chemical structure of annulatin |
| ImageName = Chemical structure of annulatin |
||
| ImageAlt = Chemical structure of annulatin |
| ImageAlt = Chemical structure of annulatin |
||
| IUPACName = |
| IUPACName = 3′,4′,5,5′,7-Pentahydroxy-3-methoxyflavone |
||
| SystematicName = 5,7-Dihydroxy-3-methoxy-2-(3,4,5-trihydroxyphenyl)-4''H''-1-benzopyran-4-one |
|||
| OtherNames = Myricetin 3-Methylether |
| OtherNames = Myricetin 3-Methylether |
||
|Section1= |
|Section1={{Chembox Identifiers |
||
| CASNo_Ref = {{cascite|correct|??}} |
|||
| CASNo = 1486-67-5 |
| CASNo = 1486-67-5 |
||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| CASNo_Ref = |
|||
| |
| UNII = E49FR3626E |
||
| PubChem = |
| PubChem = 44259709 |
||
| |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 24227213 |
| ChemSpiderID = 24227213 |
||
| |
| SMILES = COc1c(=O)c2c(cc(cc2oc1c3cc(c(c(c3)O)O)O)O)O |
||
| |
| InChI = 1/C16H12O8/c1-23-16-14(22)12-8(18)4-7(17)5-11(12)24-15(16)6-2-9(19)13(21)10(20)3-6/h2-5,17-21H,1H3 |
||
| |
| InChIKey = XWTLYULBWZQAAZ-UHFFFAOYAS |
||
| |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C16H12O8/c1-23-16-14(22)12-8(18)4-7(17)5-11(12)24-15(16)6-2-9(19)13(21)10(20)3-6/h2-5,17-21H,1H3 |
| StdInChI = 1S/C16H12O8/c1-23-16-14(22)12-8(18)4-7(17)5-11(12)24-15(16)6-2-9(19)13(21)10(20)3-6/h2-5,17-21H,1H3 |
||
| |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChIKey = XWTLYULBWZQAAZ-UHFFFAOYSA-N |
| StdInChIKey = XWTLYULBWZQAAZ-UHFFFAOYSA-N |
||
| MeSHName = |
| MeSHName = |
||
}} |
}} |
||
|Section2= |
|Section2={{Chembox Properties |
||
| C=16 | H=12 | O=8 |
|||
| Formula = C<sub>16</sub>H<sub>12</sub>O<sub>8</sub> |
|||
| MolarMass = 332.25 g/mol |
|||
| ExactMass = 332.053216 u |
|||
| Appearance = |
| Appearance = |
||
| Density = |
| Density = 1.807 g/mL |
||
| MeltingPt = |
| MeltingPt = |
||
| BoilingPt = |
| BoilingPt = |
||
| Solubility = |
| Solubility = |
||
}} |
}} |
||
| |
|Section3={{Chembox Hazards |
||
| MainHazards = |
| MainHazards = |
||
| FlashPt = |
| FlashPt = |
||
| |
| AutoignitionPt = |
||
| RPhrases = <!-- {{R10}}, {{R23}}, {{R34}}, {{R50}} etc. --> |
|||
| SPhrases = <!-- {{S1/2}}, {{S9}}, {{S16}}, {{S26}}, {{S36/37/39}}, {{S45}}, {{S61}} etc. --> |
|||
}} |
}} |
||
}} |
}} |
||
| ⚫ | '''Annulatin''' is an [[O-methylated flavonol]] found in the roots of ''[[Pteroxygonum giraldii]]''.<ref>Antioxidant Flavone Glycosides from the Root of Pteroxygonum giraldii |
||
| ⚫ | '''Annulatin''' is an [[O-methylated flavonol]] found in the roots of ''[[Pteroxygonum giraldii]]''.<ref>{{cite journal | doi = 10.1002/chin.200949203| title = ChemInform Abstract: Antioxidant Flavone Glycosides from the Root of Pteroxygonum giraldii| date = 2009| last1 = Li| first1 = Bao-Lin| last2 = Yang| first2 = Zhan-Jun| last3 = Jiang| first3 = Lin-Ling| last4 = Zhang| first4 = Xi-Quan| last5 = Gu| first5 = Hong-Mei| last6 = Wang| first6 = Hui-Chun| last7 = Tian| first7 = Xian-Hua| journal = Cheminform| volume = 40| issue = 49}}</ref> |
||
| ⚫ | |||
| ⚫ | |||
{{reflist}} |
{{reflist}} |
||
{{Flavonol}} |
{{Flavonol}} |
||
[[Category: |
[[Category:O-methylated flavonols]] |
||
{{ |
{{aromatic-stub}} |
||