Iron(II) acetate: Difference between revisions

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 446429319

| Name = Iron(II) acetate

| ImageFile = Iron(II) acetate.png

| ImageSize = 150px

| ImageName = Skeletal formula of iron(II) acetate

| IUPACName = Iron(II) acetate

| OtherNames = Ferrous acetate

|Section1={{Chembox Identifiers

| SMILES = CC(O1)O[Fe]12OC(O2)C

| SMILES_Comment = coordination form

| SMILES1 = CC(=O)[O-].[Fe+2].CC(=O)[O-]

| SMILES1_Comment = ionic form

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| CASNo = 3094-87-9

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = L80I7M6D3Q

| RTECS = AI3850000

}}

|Section2={{Chembox Properties

| C=4 | H=6 | Fe=1 | O=4

| Appearance = White crystals (anhydrous)<br> Light green crystals (tetrahydrate)

| Odor = Odorless

| Density = 1.734 g/cm³ (−73&nbsp;°C)<ref name=rg />

| Solubility = Soluble<ref name=crc>{{CRC90}}</ref>

| SolubleOther =

| MeltingPtC = 190-200

| MeltingPt_notes = <br> [[Thermal decomposition|decomposes]]<ref name=crc /><ref name="sigma" />

| MagSus =

}}

|Section3={{Chembox Structure

| CrystalStruct = [[Orthorhombic]], [[pearson symbol|oP75]] (200&nbsp;K)

| SpaceGroup = Pbcn, No. 60 (200&nbsp;K)<ref name=rg />

| PointGroup = 2/m 2/m 2/m (200&nbsp;K)

| LattConst_a = 18.1715(4)&nbsp;Å

| LattConst_b = 22.1453(5)&nbsp;Å

| LattConst_c = 8.2781(2)&nbsp;Å (200&nbsp;K)

| LattConst_alpha = 90

}}

|Section7={{Chembox Hazards

| GHSPictograms = {{GHS07}}<ref name="sigma">{{Sigma-Aldrich|id=517933|name=Iron(II) acetate|accessdate=2014-05-03}}</ref>

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|315|319|335}}<ref name="sigma" />

| PPhrases = {{P-phrases|261|305+351+338}}<ref name="sigma" />

| NFPA-H = 2

| NFPA-F = 0

| NFPA-R = 0

| NFPA_ref = <ref name=fca>{{cite web|title = MSDS of Ferrous acetate |url = https://www.fishersci.ca/viewmsds.do?catNo=AC305370500 |website=fishersci.ca |publisher = [[Fisher Scientific]] |place = [[Fair Lawn, New Jersey|Fair Lawn]]|access-date = 2014-08-02}}</ref>

}}

'''Iron(II) acetate''' is a [[coordination complex]] with formula Fe(CH₃COO)₂. It is a white solid, although impure samples can be slightly colored.<ref name=rg>{{cite journal |doi=10.1002/zaac.201000274|title=Crystal Structure of Iron(II) Acetate|year=2011|last1= Weber|first1=Birgit|last2=Betz|first2=Richard|last3=Bauer|first3 =Wolfgang|last4=Schlamp|first4=Stephan|journal=Zeitschrift für anorganische und allgemeine Chemie|volume=637|pages=102–107}}</ref> A light green [[hydrate|tetrahydrate]] is also known, which is highly soluble in water.

==Preparation and structure==

{{also|Electrometallurgy}}

[[File:Structure of anhydrous ferrous acetate (QQQFUY01).png|thumb|left|Although ferrous acetate can be viewed as a simple salt, [[X-ray crystallography]] reveals a complicated polymeric structure.<ref name=rg />]]

Iron powder reacts with [[acetic acid]] in [[electrolysis]] to give the ferrous acetate, with evolution of hydrogen gas:<ref name=rg />

:Fe + 2 CH₃CO₂H → Fe(CH₃CO₂)₂ + H₂

It can also be made from the insoluble, olive green, [[Iron(II) carbonate]].{{Citation needed|date=July 2020}}

It adopts a polymeric structure with [[octahedral molecular geometry|octahedral]] Fe(II) centers [[bridging ligand|interconnected]] by acetate ligands. It is a [[coordination polymer]].<ref name=rg />

A hydrated form be made by the reaction of [[iron(II) oxide|ferrous oxide]] or [[iron(II) hydroxide|ferrous hydroxide]] with [[acetic acid]].<ref>{{Cite web |url=http://www.ims.demokritos.gr/people/tbou/iron_acetate.html |title=Synthesis of Iron(II) acetate hydrate (ferrous acetate) |access-date=2009-01-07 |archive-url=https://web.archive.org/web/20130825122529/http://www.ims.demokritos.gr/people/tbou/iron_acetate.html |archive-date=2013-08-25 |url-status=dead }}</ref>

Reaction of scrap iron with acetic acid affords a brown mixture of various iron(II) and iron(III) acetates that are used in dyeing.<ref name = Ullmann>{{Ullmann | doi = 10.1002/14356007.a14_591 | title = Iron Compounds | year = 2000 | last1 = Wildermuth | first1 = Egon | last2 = Stark | first2 = Hans | last3 = Friedrich | first3 = Gabriele | last4 = Ebenhöch | first4 = Franz Ludwig | last5 = Kühborth | first5 = Brigitte | last6 = Silver | first6 = Jack | last7 = Rituper | first7 = Rafael }}</ref>

==Uses==

Ferrous acetate is used as a [[mordant]] by the [[dye]] industry. [[Ebonizing]] wood is one such process.<ref>[http://www.wwgoa.com/ebonizing-wood/ Ebonizing Wood with Ferric Acetate]</ref>

{{Iron compounds}}

{{Acetates}}

[[Category:Iron(II) compounds]]