Premazepam: Difference between revisions

Page 1
Page 2
Content deleted Content added
BogBot (talk | contribs)
populated new fields in {{drugbox}} and reordered per bot approval. Report errors and suggestions to User_talk:BogBot
Citation bot (talk | contribs)
Removed proxy/dead URL that duplicated identifier. | Use this bot. Report bugs. | #UCB_CommandLine
 
(31 intermediate revisions by 24 users not shown)
Line 1: Line 1:
{{short description|Chemical compound}}
{{Drugbox
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 441886443
| Watchedfields = changed
| IUPAC_name = 6,7-dimethyl- 5-phenyl- 3,7-dihydropyrrolo[3,4-''e''] [1,4]diazepin- 2(1''H'')-one
| verifiedrevid = 448103131
| image = Premazepam.png
| IUPAC_name = 6,7-Dimethyl-5-phenyl-1,3-dihydropyrrolo[3,4-''e''][1,4]diazepin-2-one
| width = 150
| image = Premazepam.svg
| image2 =


<!--Clinical data-->
<!--Clinical data-->
Line 11: Line 12:
| pregnancy_US =
| pregnancy_US =
| legal_status =
| legal_status =
| routes_of_administration =
| routes_of_administration =


<!--Pharmacokinetic data-->
<!--Pharmacokinetic data-->
| bioavailability =
| bioavailability =
| metabolism = [[Liver|Hepatic]]
| metabolism = [[Liver|Hepatic]]
| elimination_half-life = 10 - 13 hours
| elimination_half-life = 10–13 hours
| excretion = [[Kidney|Renal]]
| excretion = [[Kidney|Renal]]


<!--Identifiers-->
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 57435-86-6
| CAS_number = 57435-86-6
| ATC_prefix = none
| ATC_prefix =
| ATC_suffix =
| ATC_suffix =
| ATC_supplemental =
| ATC_supplemental =
| PubChem = 72104
| PubChem = 72104
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 2104741
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| DrugBank =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = OI7443PDLB
| UNII = OI7443PDLB
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 65088


<!--Chemical data-->
<!--Chemical data-->
| C=15 | H=11 | N=3 | O=3
| C=15 | H=15 | N=3 | O=1
| smiles = Cc1c2c(cn1C)NC(=O)CN=C2c3ccccc3
| molecular_weight = 253.30 g/mol
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C15H15N3O/c1-10-14-12(9-18(10)2)17-13(19)8-16-15(14)11-6-4-3-5-7-11/h3-7,9H,8H2,1-2H3,(H,17,19)
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = CNWSHOJSFGGNLC-UHFFFAOYSA-N

}}
}}


'''Premazepam''' is a benzodiazepine derivative.<ref>{{cite journal | journal = Drug Metab Dispos | year = 1984| month = Mar-Apr | volume = 12 | issue = 2 | pages = 257–63 | title = Metabolic fate of premazepam, a new anti-anxiety drug, in the rat and the dog | author = Assandri A | coauthors = Barone D, Ferrari P, Perazzi A, Ripamonti A, Tuan G, Zerilli LF | pmid = 6144494}}</ref> It is a [[partial agonist]] of [[benzodiazepine]] receptors and has been shown to possess both [[anxiolytic]] and [[sedative]] properties in human subjects.
'''Premazepam''' is a Pyrrolodiazepine class of drug. <ref>{{cite journal | vauthors = Assandri A, Barone D, Ferrari P, Perazzi A, Ripamonti A, Tuan G, Zerilli LF | title = Metabolic fate of premazepam, a new anti-anxiety drug, in the rat and the dog | journal = Drug Metabolism and Disposition | volume = 12 | issue = 2 | pages = 257–63 | date = Mar–Apr 1984 | pmid = 6144494}}</ref> It is a [[partial agonist]] of [[benzodiazepine]] receptors and was shown in 1984 to possess both [[anxiolytic]] and [[sedative]] properties in humans but was never marketed.


==Properties==
==Properties==
The initial doses of premazepam given to human test subjects demonstrated similar psychological test results to those produced by diazepam. It was also demonstrated that initial dosing with premazepam produces similar sedative effects as compared with diazepam, although psychomotor impairments are greater with premazepam than with diazepam after initial dosing. However, with repeated dosing for more than one day premazepam causes less sedation and less psychomotor impairment than [[diazepam]]. Premazepam possesses [[sedative]] and [[anxiolytic]] properties. Premazepam produces more slow wave and less fast wave [[EEG]] changes than diazepam. Tests have shown that 7.5&nbsp;mg of premazepam is approximately equivalent to 5&nbsp;mg of [[diazepam]].<ref>{{cite journal | journal = Br J Clin Pharmacol | year = 1984 | month = August | volume = 18 | issue = 2 | pages = 127–33 | title = The psychopharmacological effects of premazepam, diazepam and placebo in healthy human subjects | author = Golombok S | coauthors = Lader M | pmid = 6148956 | pmc = 1463527 }}</ref>
The initial doses of premazepam given to human test subjects demonstrated similar psychological test results to those produced by diazepam. It was also demonstrated that initial dosing with premazepam produces similar sedative effects as compared with diazepam, although psychomotor impairments are greater with premazepam than with diazepam after initial dosing. However, with repeated dosing for more than one day premazepam causes less sedation and less psychomotor impairment than [[diazepam]]. Premazepam possesses [[sedative]] and [[anxiolytic]] properties. Premazepam produces more slow wave and less fast wave [[EEG]] changes than [[diazepam]]. Tests have shown that 7.5&nbsp;mg of premazepam is approximately equivalent to 5&nbsp;mg of [[diazepam]].<ref>{{cite journal | vauthors = Golombok S, Lader M | title = The psychopharmacological effects of premazepam, diazepam and placebo in healthy human subjects | journal = British Journal of Clinical Pharmacology | volume = 18 | issue = 2 | pages = 127–33 | date = August 1984 | pmid = 6148956 | pmc = 1463527 | doi = 10.1111/j.1365-2125.1984.tb02444.x}}</ref>


==Pharmacology==
==Pharmacology==
Premazepam is a pyrrolodiazepine benzodiazepine and acts as a partial agonist at benzodiazepine receptors. The mean time taken to reach peak plasma levels is 2 hours and the mean half life of pramazepam in humans is 11.5 hours. About 90% of the drug is excreted in unchanged form. Of the remaining 10% of the drug none of the metabolites showed any pharmacological activity. Thus premazepam produces no [[active metabolites]] in humans.<ref>{{cite journal | journal = Int J Clin Pharmacol Ther Toxicol | year = 1984| month = May | volume = 22 | issue = 5 | pages = 273–7 | title = Pharmacokinetics and metabolism of premazepam, a new potential anxiolytic, in humans | author = Vitiello B | coauthors = Buniva G, Bernareggi A, Assandri A, Perazzi A, Fuccella LM, Palumbo R | pmid = 6146571}}</ref><ref>{{cite journal | journal = Psychopharmacology (Berl) | year = 1985 | volume = 86 | issue = 4 | pages = 464–7 | title = In vivo interaction of premazepam with benzodiazepine receptors: relation to its pharmacological effects | author = Mennini T | coauthors = Barone D, Gobbi M | pmid = 2863844 | doi = 10.1007/BF00427909}}</ref>
Premazepam is a [[pyrrolodiazepine]] and acts as a partial [[agonist]] at benzodiazepine receptors. The mean time taken to reach peak plasma levels is 2 hours and the mean half life of premazepam in humans is 11.5 hours. About 90% of the drug is excreted in unchanged form. Of the remaining 10% of the drug none of the metabolites showed any pharmacological activity. Thus premazepam produces no [[active metabolites]] in humans.<ref>{{cite journal | vauthors = Vitiello B, Buniva G, Bernareggi A, Assandri A, Perazzi A, Fuccella LM, Palumbo R | title = Pharmacokinetics and metabolism of premazepam, a new potential anxiolytic, in humans | journal = International Journal of Clinical Pharmacology, Therapy, and Toxicology | volume = 22 | issue = 5 | pages = 273–7 | date = May 1984 | pmid = 6146571}}</ref><ref>{{cite journal | vauthors = Mennini T, Barone D, Gobbi M | title = In vivo interaction of premazepam with benzodiazepine receptors: relation to its pharmacological effects | journal = Psychopharmacology | volume = 86 | issue = 4 | pages = 464–7 | year = 1985 | pmid = 2863844 | doi = 10.1007/BF00427909 | s2cid = 9882896 }}</ref>


==See also==
== See also ==
*[[Benzodiazepine]]
* [[Benzodiazepine]]
*[[Benzodiazepine dependence]]
* [[Benzodiazepine dependence]]
*[[Benzodiazepine withdrawal syndrome]]
* [[Benzodiazepine withdrawal syndrome]]
*[[Long term effects of benzodiazepines]]
* [[Long-term effects of benzodiazepines]]


==References==
== References ==
{{reflist}}
{{Reflist}}


{{Benzodiazepines}}
{{Benzodiazepines}}
{{Anticonvulsants}}
{{GABAAR PAMs}}
{{Hypnotics and sedatives}}


[[Category:Anticonvulsants]]
[[Category:Abandoned drugs]]
[[Category:Anxiolytics]]
[[Category:Designer drugs]]
[[Category:Benzodiazepines]]
[[Category:GABAA receptor positive allosteric modulators]]
[[Category:Hypnotics]]
[[Category:Muscle relaxants]]
[[Category:Sedatives]]
[[Category:Lactams]]
[[Category:Lactams]]
[[Category:Pyrrolodiazepines]]