Viscumitol: Difference between revisions
Content deleted Content added
m →References: WP:CHECKWIKI error 18 fixes + general fixes (BRFA 15) using AWB (7832) |
Added bibcode. | Use this tool. Report bugs. | #UCB_Gadget |
||
| (10 intermediate revisions by 8 users not shown) | |||
| Line 1: | Line 1: | ||
{{Chembox |
{{Chembox |
||
| verifiedrevid = |
| verifiedrevid = 449650367 |
||
| ImageFile = Viscumitol.svg |
| ImageFile = Viscumitol.svg |
||
| |
| ImageSize = 150px |
||
| |
| ImageAlt = |
||
| IUPACName = |
| IUPACName = 1,2-Di-''O''-methyl-''muco''-inositol |
||
| SystematicName = (1''R'',2''S'',3''R'',4''S'',5''R'',6''S'')-5,6-Dimethoxycyclohexane-1,2,3,4-tetrol |
|||
| OtherNames = 1,2-Di-''O''-methyl-''muco''-inositol |
|||
| |
|Section1={{Chembox Identifiers |
||
| |
| CASNo = 145680-48-4 |
||
| |
| CASNo_Ref = {{cascite|correct|CAS}} |
||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| ⚫ | |||
| UNII = PU5UQL3NFY |
|||
| ⚫ | |||
| ⚫ | |||
| ⚫ | |||
| ChemSpiderID = 24764943 |
| ChemSpiderID = 24764943 |
||
| |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C8H16O6/c1-13-7-5(11)3(9)4(10)6(12)8(7)14-2/h3-12H,1-2H3/t3-,4+,5+,6-,7-,8+ |
| StdInChI = 1S/C8H16O6/c1-13-7-5(11)3(9)4(10)6(12)8(7)14-2/h3-12H,1-2H3/t3-,4+,5+,6-,7-,8+ |
||
| SMILES = CO[C@@H]1[C@H]([C@@H]([C@@H]([C@H]([C@@H]1OC)O)O)O)O |
| SMILES = CO[C@@H]1[C@H]([C@@H]([C@@H]([C@H]([C@@H]1OC)O)O)O)O |
||
| |
| InChI = 1S/C8H16O6/c1-13-7-5(11)3(9)4(10)6(12)8(7)14-2/h3-12H,1-2H3/t3-,4+,5+,6-,7-,8+ |
||
| |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChIKey = HREVPIABJKTEDU-CNVXYERZSA-N |
| StdInChIKey = HREVPIABJKTEDU-CNVXYERZSA-N |
||
}} |
}} |
||
| |
|Section2={{Chembox Properties |
||
| |
| C=8 | H=16 | O=6 |
||
| |
| Appearance = |
||
| |
| Density = |
||
| |
| MeltingPt = |
||
| |
| BoilingPt = |
||
| |
| Solubility = }} |
||
| |
|Section3={{Chembox Hazards |
||
| |
| MainHazards = |
||
| |
| FlashPt = |
||
| |
| AutoignitionPt = }} |
||
}} |
}} |
||
'''Viscumitol''' is a [[cyclitol]]. It is a dimethyl-ether of [[muco-inositol]] that can be isolated from ''[[Viscum album]]''.<ref>{{cite journal | last1 = Richter | first1 = Andreas | title = Viscumitol, a dimethyl-ether of muco-inositol from Viscum album | journal = Phytochemistry | volume = 31 | pages = |
'''Viscumitol''' is a [[cyclitol]]. It is a dimethyl-ether of [[muco-Inositol|''muco''-inositol]] that can be isolated from ''[[Viscum album]]''.<ref>{{cite journal | last1 = Richter | first1 = Andreas | title = Viscumitol, a dimethyl-ether of ''muco''-inositol from ''Viscum album'' | journal = Phytochemistry | volume = 31 | pages = 3925–3927 | year = 1992 | issue = 11 | doi = 10.1016/S0031-9422(00)97555-1| bibcode = 1992PChem..31.3925R }}</ref> |
||
==References== |
==References== |
||
| Line 38: | Line 40: | ||
[[Category:Cyclitols]] |
[[Category:Cyclitols]] |
||
[[Category:Methoxy compounds]] |
|||