Clopidol: Difference between revisions
Content deleted Content added
m Stub sorting and placement of stub template(s): antiinfective-drug-stub. See approval. Report errors and suggestions at User talk:PotatoBot. |
→top: update atc |
||
| (18 intermediate revisions by 16 users not shown) | |||
| Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{Distinguish|Clopidogrel}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
|||
| verifiedrevid = |
| verifiedrevid = 450844569 |
||
| IUPAC_name = 3,5-Dichloro-2,6-dimethyl-pyridin-4-ol |
| IUPAC_name = 3,5-Dichloro-2,6-dimethyl-pyridin-4-ol |
||
| image = clopidol.png |
| image = clopidol.png |
||
| width = 140 |
|||
| image2 = Clopidol molecule ball.png |
|||
| width2 = 180 |
|||
| alt2 = Ball-and-stick model of the clopidol molecule |
|||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = |
| tradename = Coyden, Clobek(Animate Animal Health) |
||
| Drugs.com = {{drugs.com|international|clopidol}} |
| Drugs.com = {{drugs.com|international|clopidol}} |
||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
||
| pregnancy_US = <!-- A / B / C / D / X --> |
| pregnancy_US = <!-- A / B / C / D / X --> |
||
| pregnancy_category = |
| pregnancy_category = |
||
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
||
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
||
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
||
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
||
| legal_status = |
| legal_status = |
||
| routes_of_administration = |
| routes_of_administration = |
||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
| bioavailability = |
| bioavailability = |
||
| protein_bound = |
| protein_bound = |
||
| metabolism = |
| metabolism = |
||
| elimination_half-life = |
| elimination_half-life = |
||
| excretion = |
| excretion = |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CAS_number_Ref = {{cascite|correct|??}} |
|||
| CAS_number = 2971-90-6 |
| CAS_number = 2971-90-6 |
||
| |
| ATCvet = yes |
||
| |
| ATC_prefix = P51 |
||
| ATC_suffix = BX05 |
|||
| PubChem = 18087 |
| PubChem = 18087 |
||
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|||
| ChEMBL = 446918 |
|||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| DrugBank = |
| DrugBank = |
||
| UNII_Ref = {{fdacite|correct|FDA}} |
| UNII_Ref = {{fdacite|correct|FDA}} |
||
| UNII = 8J763HFF5N |
| UNII = 8J763HFF5N |
||
| KEGG_Ref = {{keggcite|correct|kegg}} |
| KEGG_Ref = {{keggcite|correct|kegg}} |
||
| KEGG = D03559 |
| KEGG = D03559 |
||
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|||
| ChemSpiderID = 17084 |
|||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChI = 1S/C7H7Cl2NO/c1-3-5(8)7(11)6(9)4(2)10-3/h1-2H3,(H,10,11) |
|||
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChIKey = ZDPIZLCVJAAHHR-UHFFFAOYSA-N |
|||
<!--Chemical data--> |
<!--Chemical data--> |
||
| chemical_formula = |
| chemical_formula = |
||
| C=7 | H=7 | Cl=2 | N=1 | O=1 |
| C=7 | H=7 | Cl=2 | N=1 | O=1 |
||
| molecular_weight = 192.04 g/mol |
|||
| smiles = CC1=C(Cl)C(O)=C(Cl)C(C)=N1 |
| smiles = CC1=C(Cl)C(O)=C(Cl)C(C)=N1 |
||
}} |
}} |
||
'''Clopidol''' is an [[organic compound]] that is used as in [[veterinary medicine]] as a [[coccidiostat]]. It is prepared industrially by a multistep process from [[dehydroacetic acid]].<ref>{{cite book | vauthors = Miller R, Abaecherli C, Said A, Jackson B | chapter = Ketenes | title = Ullmann's Encyclopedia of Industrial Chemistry | date = June 2000 | publisher = Wiley-VCH | location = Weinheim | doi = 10.1002/14356007.a15_063 | isbn = 3527306730 }}</ref> |
|||
'''Clopidol''' is a [[coccidiostat]] with the [[chemical formula]] C<sub>7</sub>H<sub>7</sub>Cl<sub>2</sub>NO. |
|||
The US [[National Institute for Occupational Safety and Health]] has set a [[recommended exposure limit]] (REL) for clopidol at 10 mg/m<sup>3</sup> TWA (time-weighted average) for total exposure, 5 mg/m<sup>3</sup> TWA for respiratory exposure, and 20 mg/m<sup>3</sup> for short-term exposure. The [[Occupational Safety and Health Administration]] has set a [[permissible exposure limit]] (PEL); the respiratory PEL is the same as the REL, but the total exposure limit is 15 mg/m<sup>3</sup>.<ref>{{Cite web|url = https://www.cdc.gov/niosh/npg/npgd0143.html|title = Clopidol|date = |accessdate = |website = Pocket Guide to Chemical Hazards|publisher = NIOSH|last = |first = }}</ref> |
|||
==References== |
|||
{{Reflist}} |
|||
[[Category:Antiparasitic agents]] |
[[Category:Antiparasitic agents]] |
||
[[Category:Pyridines]] |
[[Category:Pyridines]] |
||
[[Category: |
[[Category:Chloroarenes]] |
||
[[Category:Phenols]] |
[[Category:Phenols]] |
||