Triflunordazepam: Difference between revisions
Content deleted Content added
Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Wik |
m Moving Category:Hoffmann-La Roche brands to Category:Drugs developed by Hoffmann-La Roche per Wikipedia:Categories for discussion/Log/2023 December 9#Category:AstraZeneca brands |
||
| (24 intermediate revisions by 19 users not shown) | |||
| Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{Drugbox |
{{Drugbox |
||
| verifiedrevid = |
| verifiedrevid = 451563038 |
||
| IUPAC_name = 5-phenyl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepin-2-one |
| IUPAC_name = 5-phenyl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepin-2-one |
||
| image = |
| image = Triflunordazepam.svg |
||
| width = |
| width = 222 |
||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = |
| tradename = |
||
| |
| legal_CA = Schedule IV |
||
| legal_UK = PSA |
|||
| legal_DE = NpSG |
|||
| legal_status = |
|||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
| Line 13: | Line 17: | ||
| metabolism = |
| metabolism = |
||
| elimination_half-life = |
| elimination_half-life = |
||
| excretion = |
| excretion = |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CAS_number_Ref = {{cascite|correct|??}} |
|||
| CAS_number = 2285-16-7 |
| CAS_number = 2285-16-7 |
||
| ATC_prefix = none |
| ATC_prefix = none |
||
| PubChem = 16795 |
| PubChem = 16795 |
||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| UNII = 8CS486VL3D |
|||
| ChemSpiderID = 15920 |
|||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
<!--Chemical data--> |
<!--Chemical data--> |
||
| C=16 | H=11 | F=3 | N=2 | O=1 |
| C=16 | H=11 | F=3 | N=2 | O=1 |
||
| molecular_weight = 304.267 |
|||
| smiles = C1C(=O)NC2=C(C=C(C=C2)C(F)(F)F)C(=N1)C3=CC=CC=C3 |
| smiles = C1C(=O)NC2=C(C=C(C=C2)C(F)(F)F)C(=N1)C3=CC=CC=C3 |
||
| StdInChI = 1S/C16H11F3N2O/c17-16(18,19)11-6-7-13-12(8-11)15(20-9-14(22)21-13)10-4-2-1-3-5-10/h1-8H,9H2,(H,21,22) |
|||
| StdInChIKey = UUBMOUNXQFMBQF-UHFFFAOYSA-N |
|||
}} |
}} |
||
''' |
'''Triflunordazepam''' (also known as '''Ro5-2904''')<ref>{{cite patent | country = DE | number = 1136709 }}</ref> is a drug which is a [[benzodiazepine]] derivative with high [[GABAA receptor|GABA<sub>A</sub> receptor]] affinity, and has [[anticonvulsant]] effects.<ref>{{cite journal | title = Ro5-2904 | journal = Archives Internationales de Pharmacodynamie et de Thérapie | date = 1965 | volume = 154 | pages = 131 }}</ref><ref name="pmid8978853">{{cite journal | vauthors = So SS, Karplus M | title = Genetic neural networks for quantitative structure-activity relationships: improvements and application of benzodiazepine affinity for benzodiazepine/GABAA receptors | journal = Journal of Medicinal Chemistry | volume = 39 | issue = 26 | pages = 5246–56 | date = December 1996 | pmid = 8978853 | doi = 10.1021/jm960536o }}</ref> |
||
==See also== |
== See also == |
||
*[[Nitrazepam]] |
|||
*[[Nordazepam]] |
*[[Nordazepam]] |
||
*[[Triflubazam]] |
|||
==References== |
== References == |
||
{{reflist}} |
|||
<references/> |
|||
{{Benzodiazepines}} |
{{Benzodiazepines}} |
||
{{GABAAR PAMs}} |
|||
[[Category:Benzodiazepines]] |
[[Category:Benzodiazepines]] |
||
[[Category: |
[[Category:Drugs developed by Hoffmann-La Roche]] |
||
[[Category:Hoffmann-La Roche]] |
|||
[[Category:Lactams]] |
[[Category:Lactams]] |
||
[[Category:Trifluoromethyl compounds]] |
|||
{{sedative-stub}} |
{{sedative-stub}} |
||