Cloxazolam: Difference between revisions
Content deleted Content added
m [Pu408]Tweak: issue, title. Formatted dashes. You can use this bot yourself. Report bugs here. |
Add: s2cid. Added the cs1 style template to denote Vancouver ("vanc") citation style, because references contain "vauthors" attribute to specify the list of authors. |
||
(53 intermediate revisions by 28 users not shown) | |||
Line 1: | Line 1: | ||
{{Short description|Benzodiazepine medication}} |
|||
{{cs1 config|name-list-style=vanc}} |
|||
{{distinguish|text=[[Sepazon]] or [[Sibazon]], a brand name for [[diazepam]] in Russia}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
|||
⚫ | |||
| Watchedfields = changed |
|||
| IUPAC_name = 13-chloro-2-(2-chlorophenyl)-3-oxa-6,9-diazatricyclo[8.4.0.0<sup>2,6</sup>]tetradeca-1(10),11,13-trien-8-one |
|||
⚫ | |||
⚫ | |||
| IUPAC_name = 10-chloro-11''b''-(2-chlorophenyl)-2,3,5,7-tetrahydro-[1,3]oxazolo[3,2-''d''][1,4]benzodiazepin-6-one |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = Akton, Cloxam, Clozal, Elum, Olcadil, and Sepazon<ref name=brands/> |
|||
| tradename = |
|||
| Drugs.com = {{drugs.com|international|cloxazolam}} |
| Drugs.com = {{drugs.com|international|cloxazolam}} |
||
| pregnancy_category = |
| pregnancy_category = |
||
| legal_BR = B1 |
|||
| legal_status = [[Schedule IV controlled substance|Schedule IV]](US) |
|||
| legal_BR_comment = <ref>{{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=[[Diário Oficial da União]] |language=pt-BR |publication-date=2023-04-04}}</ref> |
|||
| legal_CA = Schedule IV |
|||
| legal_DE = Anlage III |
|||
| legal_UK = Class C |
|||
| legal_US = Schedule IV |
|||
| routes_of_administration = Oral |
| routes_of_administration = Oral |
||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
| bioavailability = |
| bioavailability = |
||
| metabolism = [[Liver|Hepatic]] |
| metabolism = [[Liver|Hepatic]] |
||
| elimination_half-life = 65 |
| elimination_half-life = 65 hours |
||
| excretion = [[Kidney|Renal]] |
| excretion = [[Kidney|Renal]] |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CAS_number_Ref = {{cascite|correct|??}} |
|||
| CAS_number = 24166-13-0 |
| CAS_number = 24166-13-0 |
||
| ATC_prefix = N05 |
| ATC_prefix = N05 |
||
| ATC_suffix = BA22 |
| ATC_suffix = BA22 |
||
| PubChem = 2816 |
| PubChem = 2816 |
||
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|||
| ChEMBL = 2107254 |
|||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| DrugBank = DB01553 |
| DrugBank = DB01553 |
||
Line 35: | Line 49: | ||
<!--Chemical data--> |
<!--Chemical data--> |
||
| C=17 | H=14 | Cl=2 | N=2 | O=2 |
| C=17 | H=14 | Cl=2 | N=2 | O=2 |
||
| molecular_weight = 349.2 |
|||
| smiles = Clc1ccccc1C42OCCN2CC(=O)Nc3c4cc(Cl)cc3 |
| smiles = Clc1ccccc1C42OCCN2CC(=O)Nc3c4cc(Cl)cc3 |
||
| InChI = 1/C17H14Cl2N2O2/c18-11-5-6-15-13(9-11)17(12-3-1-2-4-14(12)19)21(7-8-23-17)10-16(22)20-15/h1-6,9H,7-8,10H2,(H,20,22) |
|||
| InChIKey = ZIXNZOBDFKSQTC-UHFFFAOYAN |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C17H14Cl2N2O2/c18-11-5-6-15-13(9-11)17(12-3-1-2-4-14(12)19)21(7-8-23-17)10-16(22)20-15/h1-6,9H,7-8,10H2,(H,20,22) |
| StdInChI = 1S/C17H14Cl2N2O2/c18-11-5-6-15-13(9-11)17(12-3-1-2-4-14(12)19)21(7-8-23-17)10-16(22)20-15/h1-6,9H,7-8,10H2,(H,20,22) |
||
Line 44: | Line 55: | ||
| StdInChIKey = ZIXNZOBDFKSQTC-UHFFFAOYSA-N |
| StdInChIKey = ZIXNZOBDFKSQTC-UHFFFAOYSA-N |
||
}} |
}} |
||
'''Cloxazolam''' (marketed under brand name '''Sepazon''', '''Olcadil''' (Brazil, Portugal and Spain), '''Akton''' (Belgium), '''Lubalix''' (Switzerland) is a drug which is a [[benzodiazepine]] derivative.<ref>{{cite web| url= http://www.non-benzodiazepines.org.uk/benzodiazepine-names.html| title=Benzodiazepine Names| accessdate=2008-12-29| publisher=non-benzodiazepines.org.uk}}</ref> Cloxazolam is metabolised into the [[active metabolite]] [[chlordesmethyldiazepam]] (delorazepam).<ref>{{Cite journal | last1 = Oliveira-Silva | first1 = D. | last2 = Oliveira | first2 = CH. | last3 = Mendes | first3 = GD. | last4 = Galvinas | first4 = PA. | last5 = Barrientos-Astigarraga | first5 = RE. | last6 = De Nucci | first6 = G. | title = Quantification of chlordesmethyldiazepam by liquid chromatography-tandem mass spectrometry: application to a cloxazolam bioequivalence study. | journal = Biomed Chromatogr | volume = 23 | issue = 12 | pages = 1266–75 | month = Dec | year = 2009 | doi = 10.1002/bmc.1249 | pmid = 19488979 }}</ref> It possesses [[anxiolytic]],<ref>{{Cite journal | last1 = Kamioka | first1 = T. | last2 = Nakayama | first2 = I. | last3 = Akiyama | first3 = S. | last4 = Takagi | first4 = H. | title = Effects of oxazolam, cloxazolam, and CS-386, new anti-anxiety drugs, on socially induced suppression and aggression in pairs of monkeys. | journal = Psychopharmacology (Berl) | volume = 52 | issue = 1 | pages = 17–23 | month = Mar | year = 1977 | doi = 10.1007/BF00426594| pmid = 15296 }}</ref> [[anticonvulsant]],<ref>{{Cite journal | last1 = Ito | first1 = M. | last2 = Miyajima | first2 = T. | last3 = Fujii | first3 = T. | last4 = Okuno | first4 = T. | title = Cloxazolam treatment for patients with intractable epilepsy. | journal = Pediatr Neurol | volume = 30 | issue = 2 | pages = 111–4 | month = Feb | year = 2004 | doi = 10.1016/j.pediatrneurol.2003.07.004 | pmid = 14984903 }}</ref> [[hypnotic]],<ref>{{Cite journal | last1 = Inoue | first1 = H. | last2 = Maeno | first2 = Y. | last3 = Iwasa | first3 = M. | last4 = Matoba | first4 = R. | last5 = Nagao | first5 = M. | title = Screening and determination of benzodiazepines in whole blood using solid-phase extraction and gas chromatography/mass spectrometry. | journal = Forensic Sci Int | volume = 113 | issue = 1–3 | pages = 367–73 | month = Sep | year = 2000 | doi = 10.1016/S0379-0738(00)00226-7| pmid = 10978650 }}</ref> [[sedative]]<ref>{{Cite journal | last1 = Brisse | first1 = B. | last2 = Tetsch | first2 = P. | last3 = Toye | first3 = A. | title = [Clinical study on stress protective action of cloxazolam in jaw surgery in double blind comparison to placebo (author's transl)] | journal = Arzneimittelforschung | volume = 30 | issue = 4 | pages = 679–82 | month = | year = 1980 | doi = | pmid = 6104969 }}</ref> and [[skeletal muscle relaxant]] properties.<ref>{{Cite journal | last1 = Ansseau | first1 = M. | last2 = von Frenckell | first2 = R. | title = Controlled comparison of two anxiolytic benzodiazepines, cloxazolam and bromazepam | journal = Neuropsychobiology | volume = 24 | issue = 1 | pages = 25–9 | month = | year = 1990| doi = 10.1159/000119038| pmid = 1983433 }}</ref> |
|||
'''Cloxazolam''' is a [[benzodiazepine]] derivative that has [[anxiolytic]], [[sedative]], and [[anticonvulsant]] properties.<ref name=Stolerman>{{cite book | veditors = Stolerman IP |title=Encyclopedia of Psychopharmacology |date=2010 |publisher=Springer-Verlag |location=Berlin |isbn=978-3-540-68706-1 |chapter=C: Cloxazolam}}</ref><ref name="Richards_2012">{{cite journal | vauthors = Richards BL, Whittle SL, Buchbinder R | title = Muscle relaxants for pain management in rheumatoid arthritis | journal = The Cochrane Database of Systematic Reviews | volume = 1 | issue = | pages = CD008922 | date = January 2012 | pmid = 22258993 | doi = 10.1002/14651858.CD008922.pub2 | s2cid = 73769165 }}</ref> It is not widely used; <ref name=Stolerman/> as of August 2018 it was marketed in Belgium, Luxembourg, Portugal, Brazil, and Japan.<ref name=brands>{{cite web |title=Cloxazolam International Brands |url=https://www.drugs.com/international/cloxazolam.html |publisher=Drugs.com |access-date=13 August 2018}}</ref> In 2019, it has been retired from the Belgian market. <ref name=retrait>{{cite web |title=Bon à savoir |url=https://www.cbip.be/fr/gows/3098?matches=cloxazolam#clo |publisher=cbip.be |access-date=13 August 2018}}</ref> |
|||
==Indications== |
|||
Cloxazolam's main use is as an anti-anxiety drug.<ref>{{Cite journal | last1 = Fischer-Cornelssen | first1 = KA. | title = Multicenter trials and complementary studies of cloxazolam, a new anxiolytic drug | journal = Arzneimittelforschung | volume = 31 | issue = 10 | pages = 1757–65 | month = | year = 1981 | pmid = 6119092 }}</ref> |
|||
==Side effects== |
|||
An increased heart rate may occur as an adverse effect of cloxazolam.<ref>{{Cite journal | last1 = Boucsein | first1 = W. | last2 = Wendt-Suhl | first2 = G. | title = [Psychological and physiological effects of cloxazolam and diazepam under anxiety-evoking and control conditions on healthy subjects (author's transl)] | journal = Pharmacopsychiatria | volume = 15 | issue = 2 | pages = 48–56 | month = Mar | year = 1982 | doi = 10.1055/s-2007-1019508| pmid = 6123123 }}</ref> |
|||
==Pharmacology== |
|||
The pharmacological effects of cloxazolam are a result of mainly its [[active metabolites]], thus cloxazolam is a [[prodrug]]. The main site of action of cloxazolam and its active metabolites are the [[benzodiazepine receptor]].<ref>{{Cite journal | last1 = Nakatsuka | first1 = I. | last2 = Shimizu | first2 = H. | last3 = Asami | first3 = Y. | last4 = Katoh | first4 = T. | last5 = Hirose | first5 = A. | last6 = Yoshitake | first6 = A. | title = Benzodiazepines and their metabolites: relationship between binding affinity to the benzodiazepine receptor and pharmacological activity | journal = Life Sci | volume = 36 | issue = 2 | pages = 113–9 | month = Jan | year = 1985 | pmid = 2857046 | doi = 10.1016/0024-3205(85)90089-X }}</ref> |
|||
The [[pharmacological]] actions of benzodiazepines at the [[GABAa receptor]] are similar to those of [[neurosteroids]]. [[Neuroactive]] steroids are positive [[allosteric]] modulators of the GABAa receptor, enhancing [[GABA]] function and in turn have effects on mood and other functions. Many benzodiazepines ([[diazepam]], [[medazepam]], [[estazolam]], [[temazepam]], [[flunitrazepam]] and nitrazepam) potently inhibit the [[enzymes]] involved in the [[metabolism]] of neurosteroids. The tetrahydroxazole ring that cloxazolam and [[oxazolam]] have decreases the [[inhibitory]] potency of benzodiazepines on neurosteroids. Thus there could be subtle differences between cloxazolam and other benzodiazepines.<ref>{{cite journal | author = Usami N | coauthors = Yamamoto T, Shintani S, Ishikura S, Higaki Y, Katagiri Y, Hara A. | year = 2002 | month = Apr | title = Substrate specificity of human 3(20)alpha-hydroxysteroid dehydrogenase for neurosteroids and its inhibition by benzodiazepines | journal = Biol Pharm Bull. | volume = 25 | issue = 4 | pages = 441–5 | pmid = 11995921 | url = http://www.jstage.jst.go.jp/article/bpb/25/4/441/_pdf | format = pdf | doi = 10.1248/bpb.25.441 }}</ref> However, because the parent prodrugs of cloxazolam and oxazolam were tested rather than the active metabolites, this is purely speculative. |
|||
==See also== |
==See also== |
||
*[[ |
* [[Cinazepam]] |
||
* [[Gidazepam]] |
|||
==References== |
==References== |
||
{{Reflist}} |
{{Reflist|2}} |
||
==External links== |
==External links== |
||
* [http://www.inchem.org/documents/pims/pharm/pim923.htm Inchem.org - Cloxazolam] |
* [http://www.inchem.org/documents/pims/pharm/pim923.htm Inchem.org - Cloxazolam] |
||
{{Anxiolytics}} |
|||
{{Benzodiazepines}} |
{{Benzodiazepines}} |
||
{{ |
{{GABAAR PAMs}} |
||
⚫ | |||
⚫ | |||
[[Category:Lactams]] |
|||
[[Category:Oxazolobenzodiazepines]] |
[[Category:Oxazolobenzodiazepines]] |
||
[[Category: |
[[Category:Prodrugs]] |
||
⚫ | |||
⚫ | |||
[[ja:クロキサゾラム]] |
|||
[[pt:Cloxazolam]] |
|||
[[sv:Kloxazolam]] |