Arnolol: Difference between revisions

(15 intermediate revisions by 13 users not shown)

Line 1:

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 457813551

| IUPAC_name = 3-amino-1-[4-(2-methoxyethyl)phenoxy]-3-methyl-butan-2-ol

| image = arnolol.png

Line 7:

Line 11:

| pregnancy_category =

| legal_status =

| routes_of_administration =

Line 13:

Line 17:

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = ~~~~

| CAS_number = 87129-71-3

| ATC_prefix =

| ~~ATC_suffix~~ =

| ATC_prefix = none

| ATC_suffix =

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C14H23NO3/c1-14(2,15)13(16)10-18-12-6-4-11(5-7-12)8-9-17-3/h4-7,13,16H,8-10,15H2,1-3H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = LAWLHMWODZUZJH-UHFFFAOYSA-N

| PubChem = 65653

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1742421

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 59090

| UNII_Ref = {{fdacite|correct|FDA}}

Line 29:

Line 40:

| C=14 | H=23 | N=1 | O=3

| molecular_weight = 253.34 g/mol

| smiles = O(c1ccc(cc1)CCOC)CC(O)C(N)(C)C

| InChI = 1/C14H23NO3/c1-14(2,15)13(16)10-18-12-6-4-11(5-7-12)8-9-17-3/h4-7,13,16H,8-10,15H2,1-3H3

| InChIKey = LAWLHMWODZUZJH-UHFFFAOYAV

}}

'''Arnolol''' is a [[beta blocker]].<ref name="urlThe Use of Common Stems in the Selection of International Nonproprietary Names (INN) for Pharmaceutical Substances: Alphabetical list of stems together with corresponding INNs">{{cite web | url = http://apps.who.int/medicinedocs/en/d/Js4895e/6.html | title = The Use of Common Stems in the Selection of International Nonproprietary Names (INN) for Pharmaceutical Substances: Alphabetical list of stems together with corresponding INNs}}</ref>

'''Arnolol''' is a [[beta blocker]].<ref name="urlThe Use of Common Stems in the Selection of International Nonproprietary Names (INN) for Pharmaceutical Substances: Alphabetical list of stems together with corresponding INNs">{{cite web | url = http://apps.who.int/medicinedocs/en/d/Js4895e/6.html | archive-url = https://web.archive.org/web/20120307220148/http://apps.who.int/medicinedocs/en/d/Js4895e/6.html | url-status = dead | archive-date = March 7, 2012 | title = The Use of Common Stems in the Selection of International Nonproprietary Names (INN) for Pharmaceutical Substances: Alphabetical list of stems together with corresponding INNs}}</ref>

== See also ==

* [[Beta blocker]]

== References ==

Line 49:

Line 53:

[[Category:Beta blockers]]

[[Category:Antihypertensive agents]]

[[Category:~~Ethers~~]]

[[Category:Phenoxypropanolamines]]

[[Category:Phenol ethers]]

[[Category:Alcohols]]

[[ar:أرنولول]]