Aranidipine: Difference between revisions

Page 1
Page 2
Content deleted Content added
added CSID, (Std)InChI & (Std)InChIKey
recategorized from Nitrobenzenes to Nitrobenzene derivatives
 
(18 intermediate revisions by 17 users not shown)
Line 1: Line 1:
{{Short description|Antihypertensive drug of the calcium channel blocker class}}
{{Drugbox
{{Drugbox
| verifiedrevid = 443289552
| verifiedrevid = 458034815
| IUPAC_name = ''O''5-methyl ''O''3-(2-oxopropyl)
| IUPAC_name = ''O''5-methyl ''O''3-(2-oxopropyl)
| image = Aranidipine.svg
| image = Aranidipine.svg
| alt = Skeletal formula of aranidipine
| image2 = Aranidipine-3D-balls.png
| alt2 = Ball-and-stick model of the aranidipine molecule


<!--Clinical data-->
<!--Clinical data-->
Line 22: Line 26:
| metabolism =
| metabolism =
| elimination_half-life =
| elimination_half-life =
| excretion =
| excretion =


<!--Identifiers-->
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 86780-90-7
| CAS_number = 86780-90-7
| ATC_prefix = none
| ATC_prefix = none
Line 30: Line 35:
| ATC_supplemental =
| ATC_supplemental =
| PubChem = 2225
| PubChem = 2225
| ChEMBL = 2104030
| ChemSpiderID = 2139
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2139
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| DrugBank =
Line 40: Line 47:
<!--Chemical data-->
<!--Chemical data-->
| C=19 | H=20 | N=2 | O=7
| C=19 | H=20 | N=2 | O=7
| molecular_weight = 388.37 g/mol
| smiles = CC1=C(C(C(=C(N1)C)C(=O)OCC(=O)C)C2=CC=CC=C2[N+](=O)[O-])C(=O)OC
| smiles = CC1=C(C(C(=C(N1)C)C(=O)OCC(=O)C)C2=CC=CC=C2[N+](=O)[O-])C(=O)OC
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| InChI = 1/C19H20N2O7/c1-10(22)9-28-19(24)16-12(3)20-11(2)15(18(23)27-4)17(16)13-7-5-6-8-14(13)21(25)26/h5-8,17,20H,9H2,1-4H3
| StdInChI = 1S/C19H20N2O7/c1-10(22)9-28-19(24)16-12(3)20-11(2)15(18(23)27-4)17(16)13-7-5-6-8-14(13)21(25)26/h5-8,17,20H,9H2,1-4H3
| InChIKey = NCUCGYYHUFIYNU-UHFFFAOYAZ
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C19H20N2O7/c1-10(22)9-28-19(24)16-12(3)20-11(2)15(18(23)27-4)17(16)13-7-5-6-8-14(13)21(25)26/h5-8,17,20H,9H2,1-4H3
| StdInChIKey = NCUCGYYHUFIYNU-UHFFFAOYSA-N
| StdInChIKey = NCUCGYYHUFIYNU-UHFFFAOYSA-N
}}
}}
'''Aranidipine''' ([[International Nonproprietary Name|INN]], trade name '''Sapresta''') is a [[calcium channel blocker]]. It is a dihydropyridine derivative with two active metabolites (M-1α and M-1β). It was developed by Maruko Seiyaku and has the formula methyl 2-oxopropyl 1,4-dihydro-2,6-dimethyl-4-(2-nitrophenyl)-3,5-pyridinedicarboxylate. Its main use is as a hypotensive, reducing blood pressure.<ref>{{cite web |title=Aranidipine |url=https://pubchem.ncbi.nlm.nih.gov/compound/aranidipine#section=Top |website=PubMed |access-date=23 December 2018}}</ref><ref>{{cite book | vauthors = Gelatsis P | chapter = To Market, to Market – 1996| veditors = Bristol JA, Robertson DW, Doherty AM, Hagmann WK, Plattner JJ, Wong WW, Trainor GL |title=Annual Reports in Medicinal Chemistry |date=1997 |publisher=Academic Press |location=San Diego |isbn=978-0-08-058376-1 |page=306 | chapter-url=https://books.google.com/books?id=oJY8LrP_JysC&dq=Aranidipine&pg=PA306}}</ref>
'''Aranidipine''' ([[International Nonproprietary Name|INN]], trade name '''Sapresta''') is a [[calcium channel blocker]].

==References==
{{Reflist}}


{{Calcium channel blockers}}
{{Calcium channel blockers}}
Line 55: Line 64:
[[Category:Carboxylate esters]]
[[Category:Carboxylate esters]]
[[Category:Ketones]]
[[Category:Ketones]]
[[Category:Nitrobenzenes]]
[[Category:Nitrobenzene derivatives]]
[[Category:Methyl esters]]
[[Category:Methyl esters]]