Atiprosin: Difference between revisions

| IUPAC_name = (4aR,12bS)-1-ethyl-12-methyl-4-(propan-2-yl)-1,2,3,4,4a,5,6,12b-octahydropyrazino[2',3':3,4]pyrido[1,2-a]indole

| image = Atiprosin_structure.png

| tradename =

| legal_status = Uncontrolled

| routes_of_administration = Oral

| CAS_number = <!-- blanked - oldvalue: 89303-63-9 -->

| molecular_weight = 311.46 g/mol

| smiles = n23c1ccccc1c(c2[C@H]4N(CCN([C@@H]4CC3)C(C)C)CC)C

'''Atiprosin''' ('''AY-28,228''') is an [[antihypertensive]] [[drug|agent]] which acts as a [[binding selectivity|selective]] [[alpha-1 adrenergic receptor|α₁-adrenergic receptor]] [[receptor antagonist|antagonist]].<ref name="isbn0-412-46630-9">{{cite book | author = David J. Triggle | title = Dictionary of Pharmacological Agents | publisher = Chapman & Hall/CRC | location = Boca Raton | year = 1996 | pages = | isbn = 0-412-46630-9 | oclc = | doi = | url = http://books.google.com/?id=DeX7jgInYFMC&lpg=PA189&dq=atiprosin&pg=PA189#v=onepage&q}}</ref><ref name="pmid3806618">{{cite journal | author = Jirkovsky I, Santroch G, Baudy R, Oshiro G | title = Octahydropyrazino[2',3':3,4]pyrido[1,2-a]indoles. A new class of potent antihypertensive agents | journal = Journal of Medicinal Chemistry | volume = 30 | issue = 2 | pages = 388–94 | year = 1987 | month = February | pmid = 3806618 | doi = 10.1021/jm00385a022| url = }}</ref><ref name="pmid2444771">{{cite journal | author = Grimes D, Rimele TJ, Henry DE, ''et al.'' | title = In vitro isolated tissue studies with atiprosin (AY-28,228): a new antihypertensive compound | journal = Journal of Cardiovascular Pharmacology | volume = 10 | issue = 3 | pages = 249–58 | year = 1987 | month = September | pmid = 2444771 | doi = 10.1097/00005344-198709000-00001| url = }}</ref><ref name="pmid2444784">{{cite journal | author = Oshiro G, Wojdan A, Klein M, Metcalf G | title = Antihypertensive and hypotensive actions of atiprosin (AY-28,228) in rats, dogs, and monkeys | journal = Journal of Cardiovascular Pharmacology | volume = 10 | issue = 3 | pages = 341–9 | year = 1987 | month = September | pmid = 2444784 | doi = 10.1097/00005344-198709000-00014| url = }}</ref> It also possesses some [[antihistamine]] activity, though it is some 15-fold weaker in this regard than as an [[alpha blocker]].<ref name="pmid2444771"/> It was never marketed.<ref name="isbn0-412-46630-9"/>

== Synthesis ==

[[File:Atiprosin.png|450px]]<ref>{{Cite journal|journal=Journal of Medical Chemistry|year=1987|volume=30|issue=2|pages=388–394|last=Jirkovsky|first=Ivo|coauthors=George Santroch, Reinhardt Baudy, George Oshiro|title=Octahydropyrazino[2',3':3,4]pyrido[1,2-a]indoles. A new class of potent antihypertensive agents|doi=10.1021/jm00385a022|pmid=3806618}}</ref>

== See also ==

== References ==

{{Adrenergics}}

{{Histaminergics}}

[[Category:Alpha blockers]]