Bopindolol: Difference between revisions

(23 intermediate revisions by 21 users not shown)

Line 1:

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = ~~444808722~~

| verifiedrevid = 459981210

| IUPAC_name = (''RS'')-1-(''tert''-butylamino)-3-[(2-methyl-1''H''-indol-4-yl)oxy]propan-2-yl benzoate

| image = Bopindolol.~~png~~

| image = Bopindolol.svg

Line 26:

Line 27:

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 

| CAS_number = 62658-63-3

| ATC_prefix = C07

| ATC_suffix = AA17

| ATC_supplemental =

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 357995

| PubChem = 44112

Line 37:

Line 39:

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 40146

| ChEBI = 76749

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = KT304VZO57

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG = ~~~~

| KEGG = D07537

| chemical_formula =

| C=23 | H=28 | N=2 | O=3

| molecular_weight = 380.48 g/mol

| smiles = CC1=CC2=C(N1)C=CC=C2OCC(CNC(C)(C)C)OC(=O)C3=CC=CC=C3

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

Line 51:

Line 55:

}}

'''Bopindolol''' ([[International Nonproprietary Name|INN]]) is a [[beta blocker]]. It is an [[ester]] which acts as a [[prodrug]] for [[~~pindolol~~]].

'''Bopindolol''' ([[International Nonproprietary Name|INN]]) is a [[beta blocker]]. It is an [[ester]] which acts as a [[prodrug]] for its [[active metabolite]] 4-(3-''t''-butylamino-2-hydroxypropoxy)-2-methylindole.<ref>{{cite journal | title=Bopindolol: pharmacological basis and clinical implications | vauthors=Nagatomo T, Hosohata Y, Ohnuki T, Nakamura T, Hattori K, Suzuki J, Ishiguro M | journal=Cardiovascular Drug Reviews |date=Spring 2001 | volume=19 | issue=1 | pages=9–24 | doi=10.1111/j.1527-3466.2001.tb00180.x | pmid=11314603| doi-access=free }}</ref>

==See also==

* [[Pindolol]]

==References==

[[Category:Beta blockers]]

[[Category:Prodrugs]]

[[Category:~~Benzoates~~]]

[[Category:Benzoate esters]]

[[Category:~~Amines~~]]

[[Category:N-tert-butyl-phenoxypropanolamines]]

[[Category:~~Phenol~~ ethers]]

[[Category:Indole ethers at the benzene ring]]

[[Category:Indoles]]

[[es:Bopindolol]]

[[it:Bopindololo]]

[[ru:Бопиндолол]]