Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Eliprodil: Difference between pages
(Difference between pages)
Content deleted Content added
Saving copy of the {{drugbox}} taken from revid 456734174 of page Eliprodil for the Chem/Drugbox validation project (updated: 'CAS_number'). |
|||
Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:Eliprodil|oldid=456734174}} 456734174] of page [[Eliprodil]] with values updated to verified values.}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
| Verifiedfields = changed |
||
| Watchedfields = changed |
|||
| verifiedrevid = |
| verifiedrevid = 461093042 |
||
| IUPAC_name = 1-(4- |
| IUPAC_name = 1-(4-Chlorophenyl)-2-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]ethanol |
||
| image = Eliprodil.png |
|||
| |
| image = Eliprodil.svg |
||
| width = 250px |
|||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = |
| tradename = |
||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
||
| pregnancy_US = <!-- A / B |
| pregnancy_US = <!-- A / B / C / D / X --> |
||
| pregnancy_category = |
| pregnancy_category = |
||
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
||
| legal_CA = <!-- Schedule I --> |
| legal_CA = <!-- Schedule I --> |
||
| legal_UK = <!-- Class A --> |
| legal_UK = <!-- Class A --> |
||
| legal_US = |
| legal_US = |
||
| legal_status = |
| legal_status = |
||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
| bioavailability = |
| bioavailability = |
||
| protein_bound = |
| protein_bound = |
||
| metabolism = |
| metabolism = |
||
| excretion = |
| excretion = |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CAS_number_Ref = {{cascite| |
| CAS_number_Ref = {{cascite|changed|??}} |
||
| CAS_number = |
| CAS_number = 119431-25-3 |
||
| ATC_prefix = |
| ATC_prefix = None |
||
| ATC_suffix = |
| ATC_suffix = |
||
| PubChem = 60703 |
| PubChem = 60703 |
||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| DrugBank = |
| DrugBank = |
||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 54708 |
| ChemSpiderID = 54708 |
||
| ChEBI = 91784 |
|||
| UNII_Ref = {{fdacite| |
| UNII_Ref = {{fdacite|correct|FDA}} |
||
| UNII = YW62A6TW29 |
| UNII = YW62A6TW29 |
||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
||
Line 41: | Line 43: | ||
<!--Chemical data--> |
<!--Chemical data--> |
||
| C=20 | H=23 | Cl=1 | F=1 | N=1 | O=1 |
| C=20 | H=23 | Cl=1 | F=1 | N=1 | O=1 |
||
| molecular_weight = 347.854 g/mol |
|||
| smiles = C1CN(CCC1CC2=CC=C(C=C2)F)CC(C3=CC=C(C=C3)Cl)O |
| smiles = C1CN(CCC1CC2=CC=C(C=C2)F)CC(C3=CC=C(C=C3)Cl)O |
||
| InChI = 1/C20H23ClFNO/c21-18-5-3-17(4-6-18)20(24)14-23-11-9-16(10-12-23)13-15-1-7-19(22)8-2-15/h1-8,16,20,24H,9-14H2 |
|||
| InChIKey = GGUSQTSTQSHJAH-UHFFFAOYAM |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C20H23ClFNO/c21-18-5-3-17(4-6-18)20(24)14-23-11-9-16(10-12-23)13-15-1-7-19(22)8-2-15/h1-8,16,20,24H,9-14H2 |
| StdInChI = 1S/C20H23ClFNO/c21-18-5-3-17(4-6-18)20(24)14-23-11-9-16(10-12-23)13-15-1-7-19(22)8-2-15/h1-8,16,20,24H,9-14H2 |
||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChIKey = GGUSQTSTQSHJAH-UHFFFAOYSA-N |
| StdInChIKey = GGUSQTSTQSHJAH-UHFFFAOYSA-N |
||
| synonyms = |
| synonyms = |
||
}} |
}} |
||
'''Eliprodil''' (codenamed '''SL-82.0715''') is an [[NMDA antagonist]] drug candidate which selectively inhibits the NR2B (GLUN2B) subtype NMDA receptor at submicromolar concentrations. Eliprodil failed a Phase III clinical trial for the treatment of acute [[ischemic stroke]] in 1996, sponsored by Synthélabo Recherche.<ref>The Pharma Letter. 2 December 1996 [http://www.thepharmaletter.com/article/synthelabo-s-eliprodil-fails-in-stroke-trials Synthelabo's Eliprodil Fails In Stroke Trials]</ref><ref name=DeKeyser>{{cite journal | vauthors = De Keyser J, Sulter G, Luiten PG | title = Clinical trials with neuroprotective drugs in acute ischaemic stroke: are we doing the right thing? | journal = Trends in Neurosciences | volume = 22 | issue = 12 | pages = 535–40 | date = December 1999 | pmid = 10542428 | doi = 10.1016/s0166-2236(99)01463-0 | s2cid = 16302841 | url = https://www.rug.nl/research/portal/en/publications/clinical-trials-with-neuroprotective-drugs-in-acute-ischaemic-stroke(7deb2c8f-aa7e-4685-8dc2-2d41a70da739).html }}</ref><ref name=Lee>{{cite journal | vauthors = Lee JM, Zipfel GJ, Choi DW | title = The changing landscape of ischaemic brain injury mechanisms | journal = Nature | volume = 399 | issue = 6738 Suppl | pages = A7-14 | date = June 1999 | pmid = 10392575 | doi = 10.1038/399a007 | s2cid = 10086931 }}</ref> |
|||
[[NMDA receptors]] are a key component in mediating glutamate-induced [[excitotoxicity]], and it is believed that [[NMDA antagonists]] would be [[Neuroprotection|neuroprotective]] after a stroke or other [[traumatic brain injury]].<ref name=Ikonomidou>{{cite journal | vauthors = Ikonomidou C, Turski L | title = Why did NMDA receptor antagonists fail clinical trials for stroke and traumatic brain injury? | journal = The Lancet. Neurology | volume = 1 | issue = 6 | pages = 383–6 | date = October 2002 | pmid = 12849400 | doi = 10.1016/s1474-4422(02)00164-3 | s2cid = 31477519 }}</ref> After a traumatic brain injury, neurons become deprived of glucose and oxygen. These neurons quickly lose ATP and become depolarized, which releases glutamate. The extracellular buildup of glutamate triggers the overstimulation of [[AMPA]] and NMDA receptors. This, in turn, causes an influx of Na<sup>+</sup> and Ca<sup>2+</sup>. Therefore, when NMDA receptors are activated, there is an increase in intracellular Ca<sup>2+</sup> concentration. High Ca<sup>2+</sup> causes fatal metabolic consequences, including neuronal cell death.<ref name=Lee/> |
|||
== References == |
|||
{{Reflist}} |
|||
{{Ionotropic glutamate receptor modulators}} |
|||
{{Sigma receptor modulators}} |
|||
[[Category:Abandoned drugs]] |
|||
[[Category:Chloroarenes]] |
|||
[[Category:NMDA receptor antagonists]] |
|||
[[Category:Fluoroarenes]] |
|||
[[Category:Phenylethanolamines]] |
|||
[[Category:Piperidines]] |
|||
{{nervous-system-drug-stub}} |