Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Mozavaptan: Difference between pages
(Difference between pages)
Content deleted Content added
Saving copy of the {{drugbox}} taken from revid 455600808 of page Mozavaptan for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number'). |
Entranced98 (talk | contribs) +sd |
||
| Line 1: | Line 1: | ||
{{short description|Chemical compound}} |
|||
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:Mozavaptan|oldid=455600808}} 455600808] of page [[Mozavaptan]] with values updated to verified values.}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
|||
| verifiedrevid = |
| verifiedrevid = 462255885 |
||
| IUPAC_name = ''N''-[4-(5-Dimethylamino-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl)phenyl]-2-methylbenzamide |
| IUPAC_name = ''N''-[4-(5-Dimethylamino-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl)phenyl]-2-methylbenzamide |
||
| image = Mozavaptan structure.svg |
| image = Mozavaptan structure.svg |
||
| Line 25: | Line 26: | ||
<!--Identifiers--> |
<!--Identifiers--> |
||
| IUPHAR_ligand = 2197 |
|||
| ⚫ | |||
| CAS_number_Ref = {{cascite|correct|CAS}} |
|||
| ⚫ | |||
| ATC_prefix = none |
| ATC_prefix = none |
||
| ATC_suffix = |
| ATC_suffix = |
||
| Line 33: | Line 36: | ||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChIKey = WRNXUQJJCIZICJ-UHFFFAOYSA-N |
| StdInChIKey = WRNXUQJJCIZICJ-UHFFFAOYSA-N |
||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|||
| ChEMBL = 420762 |
| ChEMBL = 420762 |
||
| PubChem = 119369 |
| PubChem = 119369 |
||
| Line 45: | Line 49: | ||
| chemical_formula = |
| chemical_formula = |
||
| C=27 | H=29 | N=3 | O=2 |
| C=27 | H=29 | N=3 | O=2 |
||
| smiles = Cc1ccccc1C(=O)Nc2ccc(cc2)C(=O)N3c4ccccc4C(CCC3)N(C)C |
|||
| molecular_weight = 427.53 g/mol |
|||
| smiles = CC1=CC=CC=C1C(=O)NC2=CC=C(C=C2)C(=O)N3CCCC(C4=CC=CC=C43)N(C)C |
|||
| InChI = 1S/C27H29N3O2/c1-19-9-4-5-10-22(19)26(31)28-21-16-14-20(15-17-21)27(32)30-18-8-13-24(29(2)3)23-11-6-7-12-25(23)30/h4-7,9-12,14-17,24H,8,13,18H2,1-3H3,(H,28,31) |
|||
}} |
}} |
||
'''Mozavaptan''' ([[International Nonproprietary Name|INN]]) is a [[vasopressin receptor antagonist]] marketed by [[Otsuka Pharmaceutical Co.|Otsuka]]. In Japan, it was approved in October 2006 for [[hyponatremia]] (low blood [[sodium]] levels) caused by [[syndrome of inappropriate antidiuretic hormone]] (SIADH) due to ADH producing tumors. |
|||
==References== |
|||
* {{cite journal | vauthors = Spreitzer H | date = November 20, 2006 | title = Neue Wirkstoffe - Conivaptan | journal = Österreichische Apothekerzeitung | issue = 24/2006 | language = German }} |
|||
* {{cite web | title = Conivaptan hydrochloride | url = http://www.prous.com/molecules/default.asp?ID=153 | publisher = Prous Science | work = Molecule of the Month | date = November 2006 |archive-url = https://web.archive.org/web/20120213003638/http://www.prous.com/molecules/default.asp?ID=153|archive-date = 2012-02-13}} |
|||
{{Diuretics}} |
|||
{{Oxytocin and vasopressin receptor modulators}} |
|||
[[Category:Diuretics]] |
|||
[[Category:Benzanilides]] |
|||
[[Category:Benzazepines]] |
|||
[[Category:Vasopressin receptor antagonists]] |
|||
[[Category:2-Tolyl compounds]] |
|||
{{antihypertensive-stub}} |
|||