Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Pivoxazepam: Difference between pages
(Difference between pages)
Content deleted Content added
Saving copy of the {{drugbox}} taken from revid 456963320 of page Pivoxazepam for the Chem/Drugbox validation project (updated: 'CAS_number'). |
m Removing from Category:GABAA receptor positive allosteric modulators in subcat using Cat-a-lot |
||
| Line 1: | Line 1: | ||
{{short description|Chemical compound}} |
|||
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:Pivoxazepam|oldid=456963320}} 456963320] of page [[Pivoxazepam]] with values updated to verified values.}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
| Verifiedfields = changed |
||
| Watchedfields = changed |
|||
| verifiedrevid = |
| verifiedrevid = 464208349 |
||
| IUPAC_name = (''RS'')-7-Chloro-2-oxo-5-phenyl-2,3-dihydro-1''H''-1,4-benzodiazepin-3-yl pivalate |
| IUPAC_name = (''RS'')-7-Chloro-2-oxo-5-phenyl-2,3-dihydro-1''H''-1,4-benzodiazepin-3-yl pivalate |
||
| image = Pivoxazepam.svg |
| image = Pivoxazepam.svg |
||
| width = |
| width = 222 |
||
| |
| chirality = [[Racemic mixture]] |
||
| drug_name = Pivoxazepam |
|||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = |
| tradename = |
||
| Line 20: | Line 19: | ||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CAS_number_Ref = {{cascite| |
| CAS_number_Ref = {{cascite|changed|??}} |
||
| CAS_number = |
| CAS_number = 55299-10-0 |
||
| ATC_prefix = |
| ATC_prefix = |
||
| PubChem = 68722 |
| PubChem = 68722 |
||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 61972 |
| ChemSpiderID = 61972 |
||
| UNII_Ref = {{fdacite| |
| UNII_Ref = {{fdacite|correct|FDA}} |
||
| UNII = F4ER8Z6Q3U |
| UNII = F4ER8Z6Q3U |
||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
||
| Line 34: | Line 33: | ||
<!--Chemical data--> |
<!--Chemical data--> |
||
| C=20 | H=19 | Cl=1 | N=2 | O=3 |
| C=20 | H=19 | Cl=1 | N=2 | O=3 |
||
| molecular_weight = 370.829 |
|||
| smiles = Clc3cc\1c(NC(=O)C(OC(=O)C(C)(C)C)/N=C/1c2ccccc2)cc3 |
| smiles = Clc3cc\1c(NC(=O)C(OC(=O)C(C)(C)C)/N=C/1c2ccccc2)cc3 |
||
| InChI = 1/C20H19ClN2O3/c1-20(2,3)19(25)26-18-17(24)22-15-10-9-13(21)11-14(15)16(23-18)12-7-5-4-6-8-12/h4-11,18H,1-3H3,(H,22,24) |
|||
| InChIKey = FTJLKTBLZOULCL-UHFFFAOYAD |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C20H19ClN2O3/c1-20(2,3)19(25)26-18-17(24)22-15-10-9-13(21)11-14(15)16(23-18)12-7-5-4-6-8-12/h4-11,18H,1-3H3,(H,22,24) |
| StdInChI = 1S/C20H19ClN2O3/c1-20(2,3)19(25)26-18-17(24)22-15-10-9-13(21)11-14(15)16(23-18)12-7-5-4-6-8-12/h4-11,18H,1-3H3,(H,22,24) |
||
| Line 43: | Line 39: | ||
| StdInChIKey = FTJLKTBLZOULCL-UHFFFAOYSA-N |
| StdInChIKey = FTJLKTBLZOULCL-UHFFFAOYSA-N |
||
}} |
}} |
||
'''Pivoxazepam''' is a drug which is a [[benzodiazepine]] derivative. It is the pivalate (2,2-dimethylpropanoate) [[ester]] of [[oxazepam]].<ref name="pmid10316">{{cite journal | vauthors = Sánchez MC, Colomé J, Gelpí E | title = Electron capture and multiple ion detection of benzodiazepine esters in pharmacokinetic studies | journal = Journal of Chromatography | volume = 126 | pages = 601–13 | date = November 1976 | pmid = 10316 | doi = 10.1016/s0021-9673(01)84105-4 }}</ref> It has [[sedative]] and [[anxiolytic]] actions like those of other benzodiazepines. Compared to its parent drug, oxazepam, pivoxazepam is more rapidly absorbed and slightly more sedative. |
|||
==See also== |
|||
*[[Benzodiazepine]] |
|||
*[[List of benzodiazepines]] |
|||
==References== |
|||
{{reflist}} |
|||
{{Benzodiazepines}} |
|||
{{GABAAR PAMs}} |
|||
[[Category:Benzodiazepines]] |
|||
[[Category:Chloroarenes]] |
|||
[[Category:Lactams]] |
|||
[[Category:Pivalate esters]] |
|||
{{sedative-stub}} |
|||