Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Sulforidazine: Difference between pages
(Difference between pages)
Content deleted Content added
Saving copy of the {{drugbox}} taken from revid 447385284 of page Sulforidazine for the Chem/Drugbox validation project (updated: 'CAS_number'). |
change generic short description |
||
| Line 1: | Line 1: | ||
{{Short description|Typical antipsychotic medication}} |
|||
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:Sulforidazine|oldid=447385284}} 447385284] of page [[Sulforidazine]] with values updated to verified values.}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
|||
| ⚫ | |||
| Watchedfields = changed |
|||
| ⚫ | |||
| ⚫ | |||
| image = Sulforidazine. |
| image = Sulforidazine.svg |
||
| width = 200 |
|||
| image2 = Sulforidazine3d.png |
| image2 = Sulforidazine3d.png |
||
| width2 = 180 |
|||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = |
| tradename = |
||
| pregnancy_category = |
| pregnancy_category = |
||
| legal_status = |
| legal_status = |
||
| routes_of_administration = |
| routes_of_administration = |
||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
| bioavailability = |
| bioavailability = |
||
| metabolism = |
| metabolism = |
||
| excretion = |
| excretion = |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CAS_number_Ref = {{cascite|changed|??}} |
|||
| CAS_number = |
| CAS_number = 14759-06-9 |
||
| ATC_prefix = none |
| ATC_prefix = none |
||
| PubChem = 31765 |
| PubChem = 31765 |
||
| Line 26: | Line 30: | ||
| UNII_Ref = {{fdacite|correct|FDA}} |
| UNII_Ref = {{fdacite|correct|FDA}} |
||
| UNII = B7599I244X |
| UNII = B7599I244X |
||
| ChEBI = 135644 |
|||
| ChEMBL = 2107268 |
|||
<!--Chemical data--> |
<!--Chemical data--> |
||
| ⚫ | |||
| C=21 | H=26 | N=2 | O=2 | S=2 |
| C=21 | H=26 | N=2 | O=2 | S=2 |
||
| molecular_weight = 402.575 g/mol |
|||
| smiles = O=S(=O)(c2cc1N(c3c(Sc1cc2)cccc3)CCC4N(C)CCCC4)C |
| smiles = O=S(=O)(c2cc1N(c3c(Sc1cc2)cccc3)CCC4N(C)CCCC4)C |
||
| InChI = 1/C21H26N2O2S2/c1-22-13-6-5-7-16(22)12-14-23-18-8-3-4-9-20(18)26-21-11-10-17(15-19(21)23)27(2,24)25/h3-4,8-11,15-16H,5-7,12-14H2,1-2H3 |
|||
| InChIKey = FLGCRGJDQJIJAW-UHFFFAOYAO |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C21H26N2O2S2/c1-22-13-6-5-7-16(22)12-14-23-18-8-3-4-9-20(18)26-21-11-10-17(15-19(21)23)27(2,24)25/h3-4,8-11,15-16H,5-7,12-14H2,1-2H3 |
| StdInChI = 1S/C21H26N2O2S2/c1-22-13-6-5-7-16(22)12-14-23-18-8-3-4-9-20(18)26-21-11-10-17(15-19(21)23)27(2,24)25/h3-4,8-11,15-16H,5-7,12-14H2,1-2H3 |
||
| Line 38: | Line 42: | ||
| StdInChIKey = FLGCRGJDQJIJAW-UHFFFAOYSA-N |
| StdInChIKey = FLGCRGJDQJIJAW-UHFFFAOYSA-N |
||
}} |
}} |
||
'''Sulforidazine''' ('''Imagotan''', '''Psychoson''', '''Inofal''') a [[typical antipsychotic]] and a [[metabolite]] of [[thioridazine]]; it and [[mesoridazine]] are more potent than the parent compound, whose pharmacological effects are believed by some to be largely due to its metabolism into sulforidazine and mesoridazine.<ref>{{cite journal|vauthors=Niedzwiecki DM, Mailman RB, Cubeddu LX |title= Greater potency of mesoridazine and sulforidazine compared with the parent compound, thioridazine, on striatal dopamine autoreceptors| journal=Journal of Pharmacology and Experimental Therapeutics|date=March 1984 |volume=228 |issue=3| pages=636–9|pmid=6707914}}</ref> |
|||
==Synthesis== |
|||
[[File:Sulforidazine synthesis.svg|thumb|center|500px|[https://pharmaceutical-substances.thieme.com/ps/search-results?docUri=KD-19-0102 Thieme] Synthesis:<ref>Morrow, Ryan J.; Millership, Jeff S.; Collier, Paul S. (2005). "Facile Syntheses of the Three Major Metabolites of Thioridazine". Helvetica Chimica Acta. 88 (5): 962–967. doi:10.1002/hlca.200590089.</ref> Patent:<ref>FR1363683 idem Bruschweiler Conrad, Schwarb Gustav, Winkler Hans, Renz Jany, {{US patent|3314948}} (1967 to Sandoz Ltd).</ref>]] |
|||
2-bromo-2'-amino-4'-methylsulphonyl-diphenyl Sulphide, [https://pubchem.ncbi.nlm.nih.gov/compound/43448246 CID:43448246] ('''1''') |
|||
2-bromo-2'-acetamino-4'-methylsulphonyl diphenylsulphide ('''2''') |
|||
2-(2-Chloroethyl)-1-Methylpiperidine [50846-01-0] ('''3''') |
|||
== References == |
|||
{{Reflist|2}} |
|||
{{Antipsychotics}} |
|||
{{Adrenergics}} |
|||
{{Cholinergics}} |
|||
{{Dopaminergics}} |
|||
{{Histaminergics}} |
|||
{{Tricyclics}} |
|||
[[Category:Abandoned drugs]] |
|||
[[Category:Typical antipsychotics]] |
|||
[[Category:Phenothiazines]] |
|||
[[Category:Piperidines]] |
|||
[[Category:Tertiary amines]] |
|||
{{nervous-system-drug-stub}} |
|||