Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Talbutal: Difference between pages
(Difference between pages)
Content deleted Content added
Saving copy of the {{drugbox}} taken from revid 457066046 of page Talbutal for the Chem/Drugbox validation project (updated: 'ChEMBL'). |
added Category:Sec-Butyl compounds using HotCat |
||
| Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:Talbutal|oldid=457066046}} 457066046] of page [[Talbutal]] with values updated to verified values.}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
| Verifiedfields = changed |
||
| Watchedfields = changed |
|||
| verifiedrevid = |
| verifiedrevid = 470476789 |
||
| IUPAC_name = 5-allyl-5-''sec''-butylpyrimidine-2,4,6(1''H'',3''H'',5''H'')-trione |
| IUPAC_name = (RS)-5-allyl-5-''sec''-butylpyrimidine-2,4,6(1''H'',3''H'',5''H'')-trione |
||
| image = Talbutal.svg |
| image = Talbutal.svg |
||
| width = 120 |
| width = 120 |
||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = |
| tradename = |
||
| pregnancy_category = |
| pregnancy_category = |
||
| legal_CA = Schedule IV |
|||
| legal_US = Schedule III |
| legal_US = Schedule III |
||
| routes_of_administration = |
| routes_of_administration = |
||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
| bioavailability = |
| bioavailability = |
||
| metabolism = |
| metabolism = |
||
| elimination_half-life = |
| elimination_half-life = |
||
| excretion = |
| excretion = |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CASNo_Ref = {{cascite|correct|CAS}} |
|||
| CAS_number_Ref = {{cascite|correct|??}} |
| CAS_number_Ref = {{cascite|correct|??}} |
||
| CAS_number = 115-44-6 |
| CAS_number = 115-44-6 |
||
| Line 26: | Line 24: | ||
| ATC_suffix = CA07 |
| ATC_suffix = CA07 |
||
| PubChem = 8275 |
| PubChem = 8275 |
||
| DrugBank_Ref = {{drugbankcite| |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| DrugBank = DB00306 |
| DrugBank = DB00306 |
||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| Line 33: | Line 31: | ||
| UNII = 4YIR8202AX |
| UNII = 4YIR8202AX |
||
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
||
| ChEMBL = |
| ChEMBL = 1200802 |
||
<!--Chemical data--> |
|||
| C=11 | H=16 | N=2 | O=3 |
| C=11 | H=16 | N=2 | O=3 |
||
| molecular_weight = 224.256 g/mol |
|||
| smiles = O=C1NC(=O)NC(=O)C1(C(C)CC)C\C=C |
| smiles = O=C1NC(=O)NC(=O)C1(C(C)CC)C\C=C |
||
| InChI = 1/C11H16N2O3/c1-4-6-11(7(3)5-2)8(14)12-10(16)13-9(11)15/h4,7H,1,5-6H2,2-3H3,(H2,12,13,14,15,16) |
|||
| InChIKey = BJVVMKUXKQHWJK-UHFFFAOYAK |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C11H16N2O3/c1-4-6-11(7(3)5-2)8(14)12-10(16)13-9(11)15/h4,7H,1,5-6H2,2-3H3,(H2,12,13,14,15,16) |
| StdInChI = 1S/C11H16N2O3/c1-4-6-11(7(3)5-2)8(14)12-10(16)13-9(11)15/h4,7H,1,5-6H2,2-3H3,(H2,12,13,14,15,16) |
||
| Line 45: | Line 41: | ||
| synonyms = <small>5-(1-methylpropyl)-5-(2-propenyl)-2,4,6(1''H'',3''H'',5''H'')-pyrimidinetrione</small> |
| synonyms = <small>5-(1-methylpropyl)-5-(2-propenyl)-2,4,6(1''H'',3''H'',5''H'')-pyrimidinetrione</small> |
||
}} |
}} |
||
'''Talbutal''' ('''Lotusate''') is a [[barbiturate]] with a short to intermediate duration of action. It is a [[structural isomerism|structural isomer]] of [[butalbital]]. Talbutal is a schedule III drug in the U.S. |
|||
==Pharmacology== |
|||
Talbutal is a short to intermediate-acting barbiturate. Barbiturates act as nonselective depressants of the [[central nervous system]] (CNS), capable of producing all levels of CNS mood alteration from excitation to mild sedation, hypnosis, and deep coma. In sufficiently high therapeutic doses, barbiturates induce [[anesthesia]].<ref name="Mutschler">{{Cite book| vauthors = Mutschler E, Schäfer-Korting M |title=Arzneimittelwirkungen|language=German|location=Stuttgart|publisher=Wissenschaftliche Verlagsgesellschaft|year=2001|edition=8|pages=280ff|isbn=3-8047-1763-2}}</ref> |
|||
==Mechanism of action== |
|||
Talbutal binds at a distinct binding site associated with a Cl<sup>−</sup> ionophore at the [[GABAA receptor|GABA<sub>A</sub> receptor]], increasing the duration of time for which the Cl<sup>−</sup> ionophore is open. The post-synaptic inhibitory effect of GABA in the thalamus is, therefore, prolonged. |
|||
==Toxicity== |
|||
Symptoms of acute barbiturate poisoning include drowsiness, confusion, coma, respiratory depression, [[hypotension]],<ref name="Mutschler" /> and shock. |
|||
==References== |
|||
{{Refimprove|date=December 2009}} |
|||
{{reflist}} |
|||
{{Hypnotics and sedatives}} |
|||
{{GABAAR PAMs}} |
|||
[[Category:Barbiturates]] |
|||
[[Category:Allyl compounds]] |
|||
[[Category:Sec-Butyl compounds]] |
|||
{{sedative-stub}} |
|||