Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Ticarcillin: Difference between pages
(Difference between pages)
Content deleted Content added
Saving copy of the {{drugbox}} taken from revid 459801764 of page Ticarcillin for the Chem/Drugbox validation project (updated: ''). |
formatting, grammar |
||
Line 1: | Line 1: | ||
{{Short description|Antibiotic medication}} |
|||
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:Ticarcillin|oldid=459801764}} 459801764] of page [[Ticarcillin]] with values updated to verified values.}} |
|||
{{Drugbox |
{{Drugbox |
||
| |
| Watchedfields = changed |
||
| verifiedrevid = |
| verifiedrevid = 470610157 |
||
| IUPAC_name = (2''S'',5''R'',6''R'')-6-{[(2'' |
| IUPAC_name = (2''S'',5''R'',6''R'')-6-{[(2''R'')-2-carboxy-2-(3-thienyl)acetyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
||
| image = Ticarcillin.svg |
| image = Ticarcillin.svg |
||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = |
| tradename = |
||
| Drugs.com = {{drugs.com|monograph|ticarcillin-disodium-and-clavulanate-potassium}} |
| Drugs.com = {{drugs.com|monograph|ticarcillin-disodium-and-clavulanate-potassium}} |
||
| MedlinePlus = a685037 |
| MedlinePlus = a685037 |
||
Line 14: | Line 13: | ||
| legal_status = Rx-only |
| legal_status = Rx-only |
||
| routes_of_administration = [[Intravenous therapy|Intravenous]] |
| routes_of_administration = [[Intravenous therapy|Intravenous]] |
||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
| bioavailability = |
| bioavailability = |
||
| protein_bound = 45% |
| protein_bound = 45% |
||
| metabolism = |
| metabolism = |
||
| elimination_half-life = 1.1 hours |
| elimination_half-life = 1.1 hours |
||
| excretion = [[Kidney|Renal]] |
| excretion = [[Kidney|Renal]] |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CASNo_Ref = {{cascite|correct|CAS}} |
|||
| CAS_number_Ref = {{cascite|correct|??}} |
| CAS_number_Ref = {{cascite|correct|??}} |
||
| CAS_number = 34787-01-4 |
| CAS_number = 34787-01-4 |
||
| ATC_prefix = J01 |
| ATC_prefix = J01 |
||
| ATC_suffix = CA13 |
| ATC_suffix = CA13 |
||
| ATC_supplemental = |
| ATC_supplemental = {{ATC|J01|CR03}} |
||
| PubChem = 36921 |
| PubChem = 36921 |
||
| DrugBank_Ref = {{drugbankcite| |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| DrugBank = DB01607 |
| DrugBank = DB01607 |
||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
Line 38: | Line 34: | ||
| KEGG_Ref = {{keggcite|correct|kegg}} |
| KEGG_Ref = {{keggcite|correct|kegg}} |
||
| KEGG = D08593 |
| KEGG = D08593 |
||
| ChEBI_Ref = {{ebicite| |
| ChEBI_Ref = {{ebicite|correct|EBI}} |
||
| ChEBI = 9587 |
| ChEBI = 9587 |
||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
||
| ChEMBL = 1449 |
| ChEMBL = 1449 |
||
<!--Chemical data--> |
<!--Chemical data--> |
||
| C=15 | H=16 | N=2 | O=6 | S=2 |
| C=15 | H=16 | N=2 | O=6 | S=2 |
||
| molecular_weight = 384.429 g/mol |
|||
| smiles = O=C(O)[C@@H]2N3C(=O)[C@@H](NC(=O)[C@@H](c1ccsc1)C(=O)O)[C@H]3SC2(C)C |
| smiles = O=C(O)[C@@H]2N3C(=O)[C@@H](NC(=O)[C@@H](c1ccsc1)C(=O)O)[C@H]3SC2(C)C |
||
| InChI = 1/C15H16N2O6S2/c1-15(2)9(14(22)23)17-11(19)8(12(17)25-15)16-10(18)7(13(20)21)6-3-4-24-5-6/h3-5,7-9,12H,1-2H3,(H,16,18)(H,20,21)(H,22,23)/t7-,8-,9+,12-/m1/s1 |
|||
| InChIKey = OHKOGUYZJXTSFX-KZFFXBSXBL |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C15H16N2O6S2/c1-15(2)9(14(22)23)17-11(19)8(12(17)25-15)16-10(18)7(13(20)21)6-3-4-24-5-6/h3-5,7-9,12H,1-2H3,(H,16,18)(H,20,21)(H,22,23)/t7-,8-,9+,12-/m1/s1 |
| StdInChI = 1S/C15H16N2O6S2/c1-15(2)9(14(22)23)17-11(19)8(12(17)25-15)16-10(18)7(13(20)21)6-3-4-24-5-6/h3-5,7-9,12H,1-2H3,(H,16,18)(H,20,21)(H,22,23)/t7-,8-,9+,12-/m1/s1 |
||
Line 54: | Line 46: | ||
| StdInChIKey = OHKOGUYZJXTSFX-KZFFXBSXSA-N |
| StdInChIKey = OHKOGUYZJXTSFX-KZFFXBSXSA-N |
||
}} |
}} |
||
'''Ticarcillin''' is a [[carboxypenicillin]]. It can be sold and used in combination with [[clavulanate]] as [[ticarcillin/clavulanic acid]]. Because it is a penicillin, it also falls within the larger class of [[beta-lactam|β-lactam]] antibiotics. Its main clinical use is as an injectable antibiotic for the treatment of [[Gram-negative]] bacteria, particularly ''[[Pseudomonas aeruginosa]]'' and [[Proteus vulgaris]]. It is also one of the few antibiotics capable of treating ''[[Stenotrophomonas maltophilia]]'' infections. |
|||
It is provided as a white or pale-yellow powder. It is highly soluble in water, but should be dissolved only immediately before use to prevent degradation. |
|||
<!-- Society and culture --> |
|||
It was patented in 1963.<ref name=Fis2006>{{cite book | vauthors = Fischer J, Ganellin CR |title=Analogue-based Drug Discovery |date=2006 |publisher=John Wiley & Sons |isbn=9783527607495 |page=491 |url=https://books.google.com/books?id=FjKfqkaKkAAC&pg=PA491 |language=en}}</ref> |
|||
== Mechanism of action == |
|||
Ticarcillin's antibiotic properties arise from its ability to prevent cross-linking of [[peptidoglycan]] during [[cell wall]] synthesis, when the bacteria try to [[Binary fission|divide]], causing cell death.{{cn|date=March 2023}} |
|||
Ticarcillin, like [[penicillin]], contains a β-lactam ring that can be cleaved by [[beta-lactamase|β-lactamase]]s, resulting in inactivation of the antibiotic. Those bacteria that can express β-lactamases are, therefore, resistant to β-lactam antibiotics. Due at least in part to the common β-lactam ring, ticarcillin can cause reactions in patients allergic to penicillin. Ticarcillin is also often paired with a [[beta-lactamase inhibitor|β-lactamase inhibitor]] such as [[clavulanic acid]] ([[co-ticarclav]]).{{cn|date=March 2023}} |
|||
==Other uses== |
|||
In [[molecular biology]], ticarcillin is used to as an alternative to [[ampicillin]] to test the uptake of [[marker gene]]s into bacteria. It prevents the appearance of satellite colonies that occur when ampicillin breaks down in the medium. It is also used in plant molecular biology to kill ''[[Agrobacterium]]'', which is used to deliver genes to plant cells. |
|||
== Dosing and administration == |
|||
Ticarcillin is not absorbed orally, so must be given by intravenous or intramuscular injection. |
|||
== Trade names and preparations == |
|||
* Ticarcillin: Ticar was formerly marketed by [[Beecham (pharmaceutical company)|Beecham]], then [[SmithKline Beecham]] until 1999, when it merged with Glaxo to form [[GlaxoSmithKline]]; it is no longer available in the UK. US distribution ceased in 2004. Ticar was replaced by Timentin. |
|||
However Timentin contains clavulanate unlike Ticar |
|||
* [[Ticarcillin/clavulanate]]: Timentin, in Australia, the UK, and the US, was marketed by Beecham, then GlaxoSmithKline. |
|||
* Available in India as TICANTROL (TICARCILLIN/ clavulanate) marketed by SCUTONIX LIFESCIENCES, Bombay |
|||
==Synthesis== |
|||
[[Carbenicillin]] is used in the clinic primarily because of its low toxicity and its utility in treating [[urinary tract infections]] due to susceptible [[Pseudomonas]] species. Its low potency, low oral activity, and susceptibility to bacterial [[beta-lactamases]] make it vulnerable to replacement by agents without these deficits. One contender in this race is ticaricillin. Its origin depended on the well-known fact that a divalent sulfur is roughly equivalent to a vinyl group (cf [[methiopropamine]], [[sufentanil]], [[pizotyline]] etc.). |
|||
[[File:Ticarcillin synthesis.svg|thumb|center|700px|Ticarcillin synthesis: GEORGE BRAIN EDWARD, CHARLES NAYLER JOHN HERBERT; {{Cite patent|country=BE|number=646991}} (1964 to [[Beecham]]).]] |
|||
One synthesis began by making the monobenzyl ester of 3-Thienylmalonic acid, converting this to the acid chloride with SOCl2, and condensing it with 6-Aminopenicillanic acid ([[6-APA]]). Hydrogenolysis (Pd/C) completed the synthesis of ticarcillin. |
|||
==References== |
|||
{{reflist}} |
|||
{{PenicillinAntiBiotics}} |
|||
[[Category:Penicillins]] |
|||
[[Category:Thiophenes]] |