Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Ticarcillin: Difference between pages

(Difference between pages)
Page 1
Page 2
Content deleted Content added
Saving copy of the {{drugbox}} taken from revid 459801764 of page Ticarcillin for the Chem/Drugbox validation project (updated: '').
 
formatting, grammar
 
Line 1: Line 1:
{{Short description|Antibiotic medication}}
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:Ticarcillin|oldid=459801764}} 459801764] of page [[Ticarcillin]] with values updated to verified values.}}
{{Drugbox
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 424169699
| verifiedrevid = 470610157
| IUPAC_name = (2''S'',5''R'',6''R'')-6-{[(2''S'')-2-carboxy-2-(3-thienyl)acetyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid
| IUPAC_name = (2''S'',5''R'',6''R'')-6-{[(2''R'')-2-carboxy-2-(3-thienyl)acetyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid
| image = Ticarcillin.svg
| image = Ticarcillin.svg

<!--Clinical data-->
<!--Clinical data-->
| tradename =
| tradename =
| Drugs.com = {{drugs.com|monograph|ticarcillin-disodium-and-clavulanate-potassium}}
| Drugs.com = {{drugs.com|monograph|ticarcillin-disodium-and-clavulanate-potassium}}
| MedlinePlus = a685037
| MedlinePlus = a685037
Line 14: Line 13:
| legal_status = Rx-only
| legal_status = Rx-only
| routes_of_administration = [[Intravenous therapy|Intravenous]]
| routes_of_administration = [[Intravenous therapy|Intravenous]]

<!--Pharmacokinetic data-->
<!--Pharmacokinetic data-->
| bioavailability =
| bioavailability =
| protein_bound = 45%
| protein_bound = 45%
| metabolism =
| metabolism =
| elimination_half-life = 1.1 hours
| elimination_half-life = 1.1 hours
| excretion = [[Kidney|Renal]]
| excretion = [[Kidney|Renal]]

<!--Identifiers-->
<!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 34787-01-4
| CAS_number = 34787-01-4
| ATC_prefix = J01
| ATC_prefix = J01
| ATC_suffix = CA13
| ATC_suffix = CA13
| ATC_supplemental = {{ATC|J01|CR03}}
| ATC_supplemental = {{ATC|J01|CR03}}
| PubChem = 36921
| PubChem = 36921
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01607
| DrugBank = DB01607
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
Line 38: Line 34:
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D08593
| KEGG = D08593
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 9587
| ChEBI = 9587
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1449
| ChEMBL = 1449

<!--Chemical data-->
<!--Chemical data-->
| C=15 | H=16 | N=2 | O=6 | S=2
| C=15 | H=16 | N=2 | O=6 | S=2
| molecular_weight = 384.429 g/mol
| smiles = O=C(O)[C@@H]2N3C(=O)[C@@H](NC(=O)[C@@H](c1ccsc1)C(=O)O)[C@H]3SC2(C)C
| smiles = O=C(O)[C@@H]2N3C(=O)[C@@H](NC(=O)[C@@H](c1ccsc1)C(=O)O)[C@H]3SC2(C)C
| InChI = 1/C15H16N2O6S2/c1-15(2)9(14(22)23)17-11(19)8(12(17)25-15)16-10(18)7(13(20)21)6-3-4-24-5-6/h3-5,7-9,12H,1-2H3,(H,16,18)(H,20,21)(H,22,23)/t7-,8-,9+,12-/m1/s1
| InChIKey = OHKOGUYZJXTSFX-KZFFXBSXBL
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C15H16N2O6S2/c1-15(2)9(14(22)23)17-11(19)8(12(17)25-15)16-10(18)7(13(20)21)6-3-4-24-5-6/h3-5,7-9,12H,1-2H3,(H,16,18)(H,20,21)(H,22,23)/t7-,8-,9+,12-/m1/s1
| StdInChI = 1S/C15H16N2O6S2/c1-15(2)9(14(22)23)17-11(19)8(12(17)25-15)16-10(18)7(13(20)21)6-3-4-24-5-6/h3-5,7-9,12H,1-2H3,(H,16,18)(H,20,21)(H,22,23)/t7-,8-,9+,12-/m1/s1
Line 54: Line 46:
| StdInChIKey = OHKOGUYZJXTSFX-KZFFXBSXSA-N
| StdInChIKey = OHKOGUYZJXTSFX-KZFFXBSXSA-N
}}
}}
'''Ticarcillin''' is a [[carboxypenicillin]]. It can be sold and used in combination with [[clavulanate]] as [[ticarcillin/clavulanic acid]]. Because it is a penicillin, it also falls within the larger class of [[beta-lactam|β-lactam]] antibiotics. Its main clinical use is as an injectable antibiotic for the treatment of [[Gram-negative]] bacteria, particularly ''[[Pseudomonas aeruginosa]]'' and [[Proteus vulgaris]]. It is also one of the few antibiotics capable of treating ''[[Stenotrophomonas maltophilia]]'' infections.

It is provided as a white or pale-yellow powder. It is highly soluble in water, but should be dissolved only immediately before use to prevent degradation.

<!-- Society and culture -->
It was patented in 1963.<ref name=Fis2006>{{cite book | vauthors = Fischer J, Ganellin CR |title=Analogue-based Drug Discovery |date=2006 |publisher=John Wiley & Sons |isbn=9783527607495 |page=491 |url=https://books.google.com/books?id=FjKfqkaKkAAC&pg=PA491 |language=en}}</ref>

== Mechanism of action ==
Ticarcillin's antibiotic properties arise from its ability to prevent cross-linking of [[peptidoglycan]] during [[cell wall]] synthesis, when the bacteria try to [[Binary fission|divide]], causing cell death.{{cn|date=March 2023}}

Ticarcillin, like [[penicillin]], contains a β-lactam ring that can be cleaved by [[beta-lactamase|β-lactamase]]s, resulting in inactivation of the antibiotic. Those bacteria that can express β-lactamases are, therefore, resistant to β-lactam antibiotics. Due at least in part to the common β-lactam ring, ticarcillin can cause reactions in patients allergic to penicillin. Ticarcillin is also often paired with a [[beta-lactamase inhibitor|β-lactamase inhibitor]] such as [[clavulanic acid]] ([[co-ticarclav]]).{{cn|date=March 2023}}

==Other uses==
In [[molecular biology]], ticarcillin is used to as an alternative to [[ampicillin]] to test the uptake of [[marker gene]]s into bacteria. It prevents the appearance of satellite colonies that occur when ampicillin breaks down in the medium. It is also used in plant molecular biology to kill ''[[Agrobacterium]]'', which is used to deliver genes to plant cells.

== Dosing and administration ==
Ticarcillin is not absorbed orally, so must be given by intravenous or intramuscular injection.

== Trade names and preparations ==
* Ticarcillin: Ticar was formerly marketed by [[Beecham (pharmaceutical company)|Beecham]], then [[SmithKline Beecham]] until 1999, when it merged with Glaxo to form [[GlaxoSmithKline]]; it is no longer available in the UK. US distribution ceased in 2004. Ticar was replaced by Timentin.
However Timentin contains clavulanate unlike Ticar
* [[Ticarcillin/clavulanate]]: Timentin, in Australia, the UK, and the US, was marketed by Beecham, then GlaxoSmithKline.
* Available in India as TICANTROL (TICARCILLIN/ clavulanate) marketed by SCUTONIX LIFESCIENCES, Bombay

==Synthesis==
[[Carbenicillin]] is used in the clinic primarily because of its low toxicity and its utility in treating [[urinary tract infections]] due to susceptible [[Pseudomonas]] species. Its low potency, low oral activity, and susceptibility to bacterial [[beta-lactamases]] make it vulnerable to replacement by agents without these deficits. One contender in this race is ticaricillin. Its origin depended on the well-known fact that a divalent sulfur is roughly equivalent to a vinyl group (cf [[methiopropamine]], [[sufentanil]], [[pizotyline]] etc.).
[[File:Ticarcillin synthesis.svg|thumb|center|700px|Ticarcillin synthesis: GEORGE BRAIN EDWARD, CHARLES NAYLER JOHN HERBERT; {{Cite patent|country=BE|number=646991}} (1964 to [[Beecham]]).]]
One synthesis began by making the monobenzyl ester of 3-Thienylmalonic acid, converting this to the acid chloride with SOCl2, and condensing it with 6-Aminopenicillanic acid ([[6-APA]]). Hydrogenolysis (Pd/C) completed the synthesis of ticarcillin.
==References==
{{reflist}}

{{PenicillinAntiBiotics}}

[[Category:Penicillins]]
[[Category:Thiophenes]]