Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Vinbarbital: Difference between pages
(Difference between pages)
Content deleted Content added
Saving copy of the {{drugbox}} taken from revid 447550763 of page Vinbarbital for the Chem/Drugbox validation project (updated: 'ChEMBL', 'DrugBank', 'CAS_number'). |
m Removing from Category:GABAA receptor positive allosteric modulators in subcat using Cat-a-lot |
||
| Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:Vinbarbital|oldid=447550763}} 447550763] of page [[Vinbarbital]] with values updated to verified values.}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
|||
| ⚫ | |||
| Watchedfields = changed |
|||
| ⚫ | |||
| IUPAC_name = 5-ethyl-5-[(1''E'')-1-methylbut-1-en-1-yl]pyrimidine-2,4,6(1''H'',3''H'',5''H'')-trione |
| IUPAC_name = 5-ethyl-5-[(1''E'')-1-methylbut-1-en-1-yl]pyrimidine-2,4,6(1''H'',3''H'',5''H'')-trione |
||
| image = |
| image = Vinbarbital_skeletal.svg |
||
| width = 100 |
| width = 100 |
||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = |
| tradename = |
||
| pregnancy_category = |
| pregnancy_category = |
||
| legal_CA = Schedule |
| legal_CA = Schedule IV |
||
| legal_US = Schedule III |
| legal_US = Schedule III |
||
| routes_of_administration = Oral |
| routes_of_administration = Oral |
||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
| bioavailability = |
| bioavailability = |
||
| metabolism = |
| metabolism = |
||
| elimination_half-life = |
| elimination_half-life = |
||
| excretion = |
| excretion = |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CAS_number_Ref = {{cascite|changed|??}} |
|||
| CAS_number = <!-- blanked - oldvalue: 2430-49-1 --> |
|||
| CAS_number = 125-42-8 |
|||
| ATC_prefix = N05 |
| ATC_prefix = N05 |
||
| ATC_suffix = CA09 |
| ATC_suffix = CA09 |
||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|||
| ChEMBL = 503565 |
| ChEMBL = 503565 |
||
| PubChem = 5284636 |
| PubChem = 5284636 |
||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| DrugBank = |
| DrugBank = |
||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 4447681 |
| ChemSpiderID = 4447681 |
||
| Line 32: | Line 36: | ||
| UNII = 7NZH2C1T6O |
| UNII = 7NZH2C1T6O |
||
| KEGG_Ref = {{keggcite|correct|kegg}} |
| KEGG_Ref = {{keggcite|correct|kegg}} |
||
| KEGG = |
| KEGG = D07322 |
||
<!--Chemical data--> |
<!--Chemical data--> |
||
| C=11 | H=16 | N=2 | O=3 |
| C=11 | H=16 | N=2 | O=3 |
||
| molecular_weight = 224.256 |
|||
| smiles = O=C1NC(=O)NC(=O)C1(/C(=C/CC)C)CC |
| smiles = O=C1NC(=O)NC(=O)C1(/C(=C/CC)C)CC |
||
| InChI = 1/C11H16N2O3/c1-4-6-7(3)11(5-2)8(14)12-10(16)13-9(11)15/h6H,4-5H2,1-3H3,(H2,12,13,14,15,16)/b7-6+ |
|||
| InChIKey = RAFOHKSPUDGZPR-VOTSOKGWBI |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C11H16N2O3/c1-4-6-7(3)11(5-2)8(14)12-10(16)13-9(11)15/h6H,4-5H2,1-3H3,(H2,12,13,14,15,16)/b7-6+ |
| StdInChI = 1S/C11H16N2O3/c1-4-6-7(3)11(5-2)8(14)12-10(16)13-9(11)15/h6H,4-5H2,1-3H3,(H2,12,13,14,15,16)/b7-6+ |
||
| Line 45: | Line 46: | ||
| StdInChIKey = RAFOHKSPUDGZPR-VOTSOKGWSA-N |
| StdInChIKey = RAFOHKSPUDGZPR-VOTSOKGWSA-N |
||
}} |
}} |
||
'''Vinbarbital''' is a hypnotic drug which is a [[barbiturate]] derivative.<ref>{{cite journal | vauthors = Mueller VA | title = An analysis and evaluation of vinbarbital sodium for obstetric amnesia and analgesia | journal = American Journal of Obstetrics and Gynecology | volume = 59 | issue = 3 | pages = 679–84 | date = March 1950 | pmid = 15405833 | doi = 10.1016/0002-9378(50)90253-5 }}</ref> It was developed by Sharp and Dohme in 1939.<ref>{{Patent |US|2187703}}</ref> |
|||
== References == |
|||
{{Reflist}} |
|||
{{Hypnotics and sedatives}} |
|||
{{GABAAR PAMs}} |
|||
[[Category:Barbiturates]] |
|||
[[Category:Sedatives]] |
|||
[[Category:Alkene derivatives]] |
|||
{{sedative-stub}} |
|||