Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Afurolol: Difference between pages
(Difference between pages)
Content deleted Content added
Saving copy of the {{drugbox}} taken from revid 451553291 of page Afurolol for the Chem/Drugbox validation project (updated: 'CAS_number'). |
Entranced98 (talk | contribs) +sd |
||
| Line 1: | Line 1: | ||
{{short description|Chemical compound}} |
|||
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:Afurolol|oldid=451553291}} 451553291] of page [[Afurolol]] with values updated to verified values.}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
|||
| ⚫ | |||
| Watchedfields = changed |
|||
| ⚫ | |||
| IUPAC_name = 7-[3-(''tert''-Butylamino)-2-hydroxy-propoxy]-3''H''-isobenzofuran-1-one |
| IUPAC_name = 7-[3-(''tert''-Butylamino)-2-hydroxy-propoxy]-3''H''-isobenzofuran-1-one |
||
| image = Afurolol.png |
| image = Afurolol.png |
||
| Line 9: | Line 11: | ||
| pregnancy_category = |
| pregnancy_category = |
||
| legal_status = |
| legal_status = |
||
| routes_of_administration = |
| routes_of_administration = |
||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
| Line 15: | Line 17: | ||
| metabolism = |
| metabolism = |
||
| elimination_half-life = |
| elimination_half-life = |
||
| excretion = |
| excretion = |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CAS_number_Ref = {{cascite|changed|??}} |
|||
| CAS_number = |
| CAS_number = 65776-67-2 |
||
| ATC_prefix = |
|||
| |
| ATC_prefix = none |
||
| ATC_suffix = |
|||
| PubChem = 176877 |
| PubChem = 176877 |
||
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|||
| ChEMBL = 1742435 |
|||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| DrugBank = |
| DrugBank = |
||
| Line 31: | Line 36: | ||
<!--Chemical data--> |
<!--Chemical data--> |
||
| C=15 | H=21 | N=1 | O=4 |
| C=15 | H=21 | N=1 | O=4 |
||
| molecular_weight = 279.33 g/mol |
|||
| smiles = O=C1OCc2cccc(OCC(O)CNC(C)(C)C)c12 |
| smiles = O=C1OCc2cccc(OCC(O)CNC(C)(C)C)c12 |
||
| InChI = 1/C15H21NO4/c1-15(2,3)16-7-11(17)9-19-12-6-4-5-10-8-20-14(18)13(10)12/h4-6,11,16-17H,7-9H2,1-3H3 |
|||
| InChIKey = NFXPPCYKSAAUMQ-UHFFFAOYAG |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C15H21NO4/c1-15(2,3)16-7-11(17)9-19-12-6-4-5-10-8-20-14(18)13(10)12/h4-6,11,16-17H,7-9H2,1-3H3 |
| StdInChI = 1S/C15H21NO4/c1-15(2,3)16-7-11(17)9-19-12-6-4-5-10-8-20-14(18)13(10)12/h4-6,11,16-17H,7-9H2,1-3H3 |
||
| Line 40: | Line 42: | ||
| StdInChIKey = NFXPPCYKSAAUMQ-UHFFFAOYSA-N |
| StdInChIKey = NFXPPCYKSAAUMQ-UHFFFAOYSA-N |
||
}} |
}} |
||
'''Alfurolol''' is a [[beta blocker]].<ref name="urlThe Use of Common Stems in the Selection of International Nonproprietary Names (INN) for Pharmaceutical Substances: Alphabetical list of stems together with corresponding INNs">{{cite web | url = http://apps.who.int/medicinedocs/en/d/Js4895e/6.html | archive-url = https://web.archive.org/web/20120307220148/http://apps.who.int/medicinedocs/en/d/Js4895e/6.html | url-status = dead | archive-date = March 7, 2012 | title = The Use of Common Stems in the Selection of International Nonproprietary Names (INN) for Pharmaceutical Substances: Alphabetical list of stems together with corresponding INNs}}</ref><ref name="pmid12666241">{{cite journal | vauthors = Narimatsu S, Takemi C, Kuramoto S, Tsuzuki D, Hichiya H, Tamagake K, Yamamoto S | title = Stereoselectivity in the oxidation of bufuralol, a chiral substrate, by human cytochrome P450s | journal = Chirality | volume = 15 | issue = 4 | pages = 333–9 | date = May 2003 | pmid = 12666241 | doi = 10.1002/chir.10212 }}</ref> |
|||
== References == |
|||
{{Reflist}} |
|||
{{Antihypertensives}} |
|||
{{Adrenergics}} |
|||
[[Category:Beta blockers]] |
|||
[[Category:Antihypertensive agents]] |
|||
[[Category:Phthalides]] |
|||
[[Category:N-tert-butyl-phenoxypropanolamines]] |
|||
{{antihypertensive-stub}} |
|||