Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Alatrofloxacin: Difference between pages

(Difference between pages)
Page 1
Page 2
Content deleted Content added
VisualWikitext
Saving copy of the {{drugbox}} taken from revid 456678117 of page Alatrofloxacin for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number').
 
m Cleaned up using AutoEd
 
Line 1: Line 1:
{{Short description|Chemical compound}}
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:Alatrofloxacin|oldid=456678117}} 456678117] of page [[Alatrofloxacin]] with values updated to verified values.}}
{{ref improve|date=August 2014}}
{{Drugbox
{{Drugbox
| Verifiedfields = changed
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 456676786
| verifiedrevid = 477316351
| IUPAC_name = 7-[(1''R'',5''S'')-6-{[(2''S'')-1-{[(2''S'')-<br>2-aminopropanoyl]amino}-1-oxopropan-2-yl]amino}-<br>3-azabicyclo[3.1.0]hexan-3-yl]-1-(2,4-difluorophenyl)-<br>6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic&nbsp;acid
| IUPAC_name = 7-[(1''R'',5''S'')-6-<nowiki/>{[(2''S'')-1-<nowiki/>{[(2''S'')-2-Aminopropanoyl]amino}-1-oxopropan-2-yl]amino}-3-azabicyclo[3.1.0]hexan-3-yl]-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid
| image = Alatrofloxacin.svg
| image = Alatrofloxacin.svg
| width = 250
| width = 250


<!--Clinical data-->
<!--Clinical data-->
| tradename =
| tradename =
| Drugs.com = {{drugs.com|CONS|alatrofloxacin}}
| Drugs.com = {{drugs.com|CONS|alatrofloxacin}}
| MedlinePlus = a605016
| MedlinePlus = a605016
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = C
| pregnancy_US = C
| pregnancy_category =
| pregnancy_category =
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
Line 30: Line 32:
<!--Identifiers-->
<!--Identifiers-->
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = <!-- blanked - oldvalue: 157182-32-6 -->
| CAS_number = 146961-76-4
| CAS_supplemental = {{CAS|157605-25-9}}
| ATC_prefix = none
| ATC_prefix = none
| ATC_suffix =
| ATC_suffix =
| PubChem = 5489474
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 21106252
| ChemSpiderID = 21243647
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 7QVV6I50DT
| UNII = 7QVV6I50DT
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = <!-- blanked - oldvalue: 1201197 -->
| ChEMBL = 1201197

⚫
| C=26 | H=25 | F=3 | N=6 | O=5
<!--Chemical data-->
| molecular_weight = 558.509 g/mol
⚫
| C=26 | H=25 | F=3 | N=6 | O=5
| smiles = Fc1ccc(c(F)c1)N/3c2nc(c(F)cc2C(=O)C(\C(=O)O)=C\3)N5C[C@@H]4C(NC(=O)[C@@H](NC(=O)[C@@H](N)C)C)[C@@H]4C5

| InChI = 1/C26H25F3N6O5/c1-10(30)24(37)31-11(2)25(38)32-20-14-7-34(8-15(14)20)23-18(29)6-13-21(36)16(26(39)40)9-35(22(13)33-23)19-4-3-12(27)5-17(19)28/h3-6,9-11,14-15,20H,7-8,30H2,1-2H3,(H,31,37)(H,32,38)(H,39,40)/t10-,11-,14-,15+,20?/m0/s1
| smiles = C[C@@H](C(=O)N[C@@H](C)C(=O)N[C@H]1[C@H]2[C@@H]1CN(C2)C3=C(C=C4C(=O)C(=CN(C4=N3)C5=C(C=C(C=C5)F)F)C(=O)O)F)N
| InChIKey = UUZPPAMZDFLUHD-LZGARRQBBY
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C26H25F3N6O5/c1-10(30)24(37)33-25(38)11(2)31-20-14-7-34(8-15(14)20)23-18(29)6-13-21(36)16(26(39)40)9-35(22(13)32-23)19-4-3-12(27)5-17(19)28/h3-6,9-11,14-15,20,31H,7-8,30H2,1-2H3,(H,39,40)(H,33,37,38)/t10?,11?,14-,15+,20?
| StdInChI = 1S/C26H25F3N6O5/c1-10(30)24(37)31-11(2)25(38)32-20-14-7-34(8-15(14)20)23-18(29)6-13-21(36)16(26(39)40)9-35(22(13)33-23)19-4-3-12(27)5-17(19)28/h3-6,9-11,14-15,20H,7-8,30H2,1-2H3,(H,31,37)(H,32,38)(H,39,40)/t10-,11-,14-,15+,20+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = GAJLLIJXQAMBHW-HVOYUNNHSA-N
| StdInChIKey = UUZPPAMZDFLUHD-VUJLHGSVSA-N
}}
}}

'''Alatrofloxacin''' ('''Trovan IV''') is a [[fluoroquinolone antibiotic]] developed by [[Pfizer]], delivered as a [[mesylate]] [[salt (chemistry)|salt]].<ref>{{cite web|title=Center for Drug Evaluation and Research {{ndash}} Application Number: 020759/020760 {{ndash}} Chemistry Review(s)|publisher=[[Food and Drug Administration]]|url=http://www.accessdata.fda.gov/drugsatfda_docs/nda/97/020760a_chemr.pdf|access-date=29 August 2014}}</ref>

[[Trovafloxacin]] and alatrofloxacin were both withdrawn from the U.S. market in June 2006 due to [[hepatotoxicity]] leading to liver transplant or death.<ref>{{cite journal | vauthors = Qureshi ZP, Seoane-Vazquez E, Rodriguez-Monguio R, Stevenson KB, Szeinbach SL | title = Market withdrawal of new molecular entities approved in the United States from 1980 to 2009 | journal = Pharmacoepidemiology and Drug Safety | volume = 20 | issue = 7 | pages = 772–777 | date = July 2011 | pmid = 21574210 | doi = 10.1002/pds.2155 | s2cid = 23821961 }}</ref>

== See also ==
* [[Fluoroquinolones]]

== References ==
{{Reflist}}

{{QuinoloneAntiBiotics}}

[[Category:Fluoroquinolone antibiotics]]
[[Category:Prodrugs]]
[[Category:Hepatotoxins]]
[[Category:Withdrawn drugs]]
[[Category:Naphthyridines]]
[[Category:Carboxylic acids]]

{{antibiotic-stub}}
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"