Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Astringin: Difference between pages

| Watchedfields = changed

| verifiedrevid = 477369056

| ImageFile = Astringin.svg

| ImageSize = 300px

| IUPACName = 3-[(''E'')-2-(2,3-Dihydroxyphenyl)ethen-1-yl]-5-hydroxyphenyl β-<small>D</small>-glucopyranoside

| SystematicName = (2''S'',3''R'',4''S'',5''S'',6''R'')-2-{3-[(''E'')-2-(3,4-Dihydroxyphenyl)ethen-1-yl]-5-hydroxyphenoxy}-6-(hydroxymethyl)oxane-3,4,5-triol

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 29884-49-9

| CASNo_Ref = {{cascite|changed|??}}

| CASNoOther =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 4ER6YKM4YL

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 2899

| SMILES = O(c2cc(O)cc(\C=C\c1ccc(O)c(O)c1)c2)[C@@H]3O[C@@H]([C@@H](O)[C@H](O)[C@H]3O)CO

| InChI = 1/C20H22O9/c21-9-16-17(25)18(26)19(27)20(29-16)28-13-6-11(5-12(22)8-13)2-1-10-3-4-14(23)15(24)7-10/h1-8,16-27H,9H2/b2-1+/t16-,17-,18+,19-,20-/m1/s1

| InChIKey = PERPNFLGJXUDDW-CUYWLFDKBH

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

|Section2={{Chembox Properties

| C=20 | H=22 | O=9

| MeltingPt =

| BoilingPt =

|Section3={{Chembox Hazards

| AutoignitionPt =

'''Astringin''' is a [[stilbenoid]], the 3-β-<small>D</small>-glucoside of [[piceatannol]].<ref>{{PubChem|5281712}}</ref> It can be found in the bark of ''[[Picea sitchensis]]''<ref>{{cite journal | doi = 10.1016/S0031-9422(00)88881-0| title = Stilbene glucosides in the bark of Picea sitchensis| date = 1976| last1 = Aritomi| first1 = Masakazu| last2 = Donnelly| first2 = Dervilla M.X.| journal = Phytochemistry| volume = 15| issue = 12| pages = 2006–2008| bibcode = 1976PChem..15.2006A}}</ref><ref>{{cite journal | doi = 10.1016/0031-9422(91)83610-W| title = Astringin and isorhapontin distribution in Sitka spruce trees| date = 1991| last1 = Toscano Underwood| first1 = Claudia D.| last2 = Pearce| first2 = Raymond B.| journal = Phytochemistry| volume = 30| issue = 7| pages = 2183–2189| bibcode = 1991PChem..30.2183T}}</ref> and ''[[Picea abies]]'' (Norway spruce).<ref>{{cite journal | doi = 10.1111/j.1439-0329.1992.tb01436.x| title = Stilbenes and resin acids in relation to the penetration of Heterobasidion annosum through the bark of Picea abies| date = 1992| last1 = Lindberg| first1 = M.| last2 = Lundgren| first2 = L.| last3 = Gref| first3 = R.| last4 = Johansson| first4 = M.| journal = European Journal of Forest Pathology| volume = 22| issue = 2| pages = 95–106}}</ref>

It is also present in ''[[Vitis vinifera]]'' cells cultures<ref>{{cite journal | pmid = 9191572 | url = http://www.clinchem.org/content/43/6/1092.full.pdf+html | date = 1997 | last1 = Mérillon | first1 = J. M. | last2 = Fauconneau | first2 = B. | last3 = Teguo | first3 = P. W. | last4 = Barrier | first4 = L. | last5 = Vercauteren | first5 = J. | last6 = Huguet | first6 = F. | title = Antioxidant activity of the stilbene astringin, newly extracted from Vitis vinifera cell cultures | journal = Clinical Chemistry | volume = 43 | issue = 6 Pt 1 | pages = 1092–1093 | doi = 10.1093/clinchem/43.6.1092 }}</ref> and in [[wine]].<ref>{{cite journal |last1=Vitrac |first1=Xavier |last2=Bornet |first2=Aurélie |last3=Vanderlinde |first3=Regina |last4=Valls |first4=Josep |last5=Richard |first5=Tristan |last6=Delaunay |first6=Jean-Claude |last7=Mérillon |first7=Jean-Michel |last8=Teissédre |first8=Pierre-Louis |title=Determination of Stilbenes (δ-viniferin, trans-astringin, trans-piceid, cis- and trans-resveratrol, ε-viniferin) in Brazilian Wines |journal=Journal of Agricultural and Food Chemistry |volume=53 |issue=14 |pages=5664–9 |year=2005 |pmid=15998130 |doi=10.1021/jf050122g}}</ref>

== See also ==

*[[Phenolic compounds in wine]]

== References ==

{{reflist}}

{{Stilbenes}}

[[Category:Stilbenoid glycosides]]

[[Category:Phenol glucosides]]

{{aromatic-stub}}