Carminic acid
From Wikipedia, the free encyclopedia
| Carminic acid[1] | |
|---|---|
 |
|
| IUPAC name |
7-α-D-Glucopyranosyl-9,10-dihydro-
3,5,6,8-tetrahydroxy-1-methyl-9,10- dioxoanthracenecarboxylic acid |
| Other names | Carminic acid C.I. Natural Red 4 C.I. 75470 |
| Identifiers | |
| CAS number | 1260-17-9  |
| SMILES |
O=C(O)c2c(c3C(=O)c1c(O)c(c(O)c(O)c1C(=O)c3cc2O)[C@H]4O[C@@H]([C@@H](O)[C@H](O)[C@H]4O)CO)C
|
| InChI |
1/C22H20O13/c1-4-8-5(2-6(24)9(4)22(33)34)13(25)10-11(15(8)27)16(28)12(18(30)17(10)29)21-20(32)19(31)14(26)7(3-23)35-21/h2,7,14,19-21,23-24,26,28-32H,3H2,1H3,(H,33,34)/t7-,14-,19+,20-,21-/m1/s1
|
| InChI key | DGQLVPJVXFOQEV-NGOCYOHBBS |
| ChemSpider ID | 14068 |
| Properties | |
| Molecular formula | C22H20O13 |
| Molar mass | 492.38 g/mol |
| Density | ? g/cm3 |
| Melting point |
120 °C (decomp.) |
| (what is this?) (verify) Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) |
|
| Infobox references | |
Carminic acid (C22H20O13) is a red glucosidal hydroxyanthrapurin that occurs naturally in some scale insects, such as the cochineal and the Polish cochineal. The insects produce the acid as a deterrent to predators. Carminic acid is the colouring agent in carmine. Synonyms are C.I. 75470 and C.I. Natural Red 4.
The chemical structure of carminic acid consists of a core anthraquinone structure linked to a glucose sugar unit. Carminic acid was first synthesized by organic chemists in 1991.[2]
[edit] References
- ^ Merck Index, 11th Edition, 1850.
- ^ Allevi, P. et al. 1991. The 1st Total Synthesis of Carminic Acid. Journal of the Chemical Society-Chemical Communications 18:1319–1320.
