| Chlorophyll d |
 |
| Identifiers |
| CAS number |
519-63-1 N |
| PubChem |
16070025 |
| ChemSpider |
16736116 Y |
| ChEBI |
CHEBI:38199 Y |
| Jmol-3D images |
Image 1 |
-
CC(C)CCC[C@@H](C)CCC[C@@H](C)CCCC(\C)=C\COC(=O)CC[C@H]6[C@H](C)C=5/C=C/2\N\1[Mg]n4c(\C=C\3/N=C(/C=C/1C(\C=O)=C\2\C)C(/C)=C/3/CC)c(C)c7c4\C(=C6/N=5)[C@@H](C(=O)OC)C7=O
|
-
InChI=1S/C54H71N4O6.Mg/c1-12-38-34(7)42-27-46-40(29-59)36(9)41(56-46)26-43-35(8)39(51(57-43)49-50(54(62)63-11)53(61)48-37(10)44(58-52(48)49)28-45(38)55-42)22-23-47(60)64-25-24-33(6)21-15-20-32(5)19-14-18-31(4)17-13-16-30(2)3;/h24,26-32,35,39,50H,12-23,25H2,1-11H3,(H-,55,56,57,58,59,61);/q-1;+2/p-1/b33-24+;/t31-,32-,35+,39+,50-;/m1./s1 Y
Key: QXWRYZIMSXOOPY-SKHCYZARSA-M Y
InChI=InChI=1S/C54H71N4O6.Mg/c1-12-38-34(7)42-27-46-40(29-59)36(9)41(56-46)26-43-35(8)39(51(57-43)49-50(54(62)63-11)53(61)48-37(10)44(58-52(48)49)28-45(38)55-42)22-23-47(60)64-25-24-33(6)21-15-20-32(5)19-14-18-31(4)17-13-16-30(2)3;/h24,26-32,35,39,50H,12-23,25H2,1-11H3,(H-,55,56,57,58,59,61);/q-1;+2/p-1/b33-24+;/t31-,32-,35+,39+,50-;/m1./s1
|
| Properties |
| Molecular formula |
C54H70MgO6N4 |
N (verify) (what is: Y/ N?)
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) |
| Infobox references |
Chlorophyll d is a form of chlorophyll, identified in 1996. It is present in marine red algae and cyanobacteria which use energy captured from sunlight for photosynthesis.[1] Chlorophyll d absorbs far-red light, at 710 nm wavelength, just outside the optical range.[2] An organism that contains chlorophyll d is adapted to an environment such as moderately deep water, where it can use far red light for photosynthesis,[3] although there is not a lot of visible light.[4]
|
|
|
Ball-and-stick model
|
Space-filling model
|
References[edit]