Valspodar: Difference between revisions
Appearance
Content deleted Content added
m Reverted edits by 183.82.100.234 (talk) to last version by WhatamIdoing |
Added a Chembox for the compound based on ChemSPider record and confirmed from Sigma-Aldrich site |
||
Line 1: | Line 1: | ||
⚫ | |||
{{Chembox |
|||
| ImageFile = |
|||
| ImageSize = |
|||
| IUPACName = (3S,6S,9S,12R,15S,18S,21S,24S,30S,33S)-6,9,18,24-Tetraisobutyl-3,21,30-triisopropyl-1,4,7,10,12,15,19,25,28-nonamethyl-33-[(2R,4E)-2-methyl-4-hexenoyl]-1,4,7,10,13,16,19,22,25,28,31-undecaazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone |
|||
| OtherNames = |
|||
| Section1 = {{Chembox Identifiers |
|||
| CASNo = 121584-18-7 |
|||
| PubChem = 5281884 |
|||
| ChemSpiderID = 4445174 |
|||
| SMILES = C/C=C/C[C@@H](C)C(=O)[C@H]1C(=O)N[C@H](C(=O)N(CC(=O)N([C@H](C(=O)N[C@H](C(=O)N([C@H](C(=O)N[C@H](C(=O)N[C@@H](C(=O)N([C@H](C(=O)N([C@H](C(=O)N([C@H](C(=O)N1C)C(C)C)C)CC(C)C)C)CC(C)C)C)C)C)CC(C)C)C)C(C)C)CC(C)C)C)C)C(C)C |
|||
| InChI = 1/C63H111N11O12/c1-26-27-28-41(16)53(76)52-57(80)67-49(38(10)11)61(84)68(19)33-48(75)69(20)44(29-34(2)3)56(79)66-50(39(12)13)62(85)70(21)45(30-35(4)5)55(78)64-42(17)54(77)65-43(18)58(81)71(22)46(31-36(6)7)59(82)72(23)47(32-37(8)9)60(83)73(24)51(40(14)15)63(86)74(52)25/h26-27,34-47,49-52H,28-33H2,1-25H3,(H,64,78)(H,65,77)(H,66,79)(H,67,80)/b27-26+/t41-,42+,43-,44+,45+,46+,47+,49+,50+,51+,52+/m1/s1 |
|||
| InChIKey = YJDYDFNKCBANTM-QCWCSKBGBB |
|||
| StdInChI = 1S/C63H111N11O12/c1-26-27-28-41(16)53(76)52-57(80)67-49(38(10)11)61(84)68(19)33-48(75)69(20)44(29-34(2)3)56(79)66-50(39(12)13)62(85)70(21)45(30-35(4)5)55(78)64-42(17)54(77)65-43(18)58(81)71(22)46(31-36(6)7)59(82)72(23)47(32-37(8)9)60(83)73(24)51(40(14)15)63(86)74(52)25/h26-27,34-47,49-52H,28-33H2,1-25H3,(H,64,78)(H,65,77)(H,66,79)(H,67,80)/b27-26+/t41-,42+,43-,44+,45+,46+,47+,49+,50+,51+,52+/m1/s1 |
|||
| StdInChIKey = YJDYDFNKCBANTM-QCWCSKBGSA-N |
|||
}} |
|||
| Section2 = {{Chembox Properties |
|||
| Formula = C<sub>63</sub>H<sub>111</sub>N<sub>11</sub>O<sub>12</sub> |
|||
| MolarMass = 1214.622 |
|||
| Appearance = |
|||
| Density = |
|||
| MeltingPt = |
|||
| BoilingPt = |
|||
| Solubility = |
|||
}} |
|||
| Section3 = {{Chembox Hazards |
|||
| MainHazards = |
|||
| FlashPt = |
|||
| Autoignition = |
|||
}} |
|||
}}'' |
|||
⚫ | |||
Its primary use is that of a [[p-glycoprotein]] inhibitor. Previous studies in animal models have found it to be effective at preventing [[Cancer|cancer cell]] resistance to [[chemotherapy|chemotherapeutics]], but these findings did not translate to clinical success.<ref name="TaoSotomayor2012" /> |
Its primary use is that of a [[p-glycoprotein]] inhibitor. Previous studies in animal models have found it to be effective at preventing [[Cancer|cancer cell]] resistance to [[chemotherapy|chemotherapeutics]], but these findings did not translate to clinical success.<ref name="TaoSotomayor2012" /> |
Revision as of 12:40, 18 August 2014
Names | |
---|---|
IUPAC name
(3S,6S,9S,12R,15S,18S,21S,24S,30S,33S)-6,9,18,24-Tetraisobutyl-3,21,30-triisopropyl-1,4,7,10,12,15,19,25,28-nonamethyl-33-[(2R,4E)-2-methyl-4-hexenoyl]-1,4,7,10,13,16,19,22,25,28,31-undecaazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone
| |
Identifiers | |
3D model (JSmol)
|
|
ChemSpider | |
PubChem CID
|
|
CompTox Dashboard (EPA)
|
|
| |
| |
Properties | |
C63H111N11O12 | |
Molar mass | 1214.622 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
'Valspodar or PSC833 is an experimental cancer treatment and chemosensitizer drug.[1] It is a derivative of ciclosporin D.
Its primary use is that of a p-glycoprotein inhibitor. Previous studies in animal models have found it to be effective at preventing cancer cell resistance to chemotherapeutics, but these findings did not translate to clinical success.[2]
Adverse effects
Valspodar can cause nerve damage.[1]
References
- ^ a b Wilkes, Gail; Ades, Terri B. (2004). Consumers Guide to Cancer Drugs. Jones & Bartlett Learning. p. 226. ISBN 9780763722548. Retrieved 29 May 2013.
- ^ Tao, Jian'guo; Sotomayor, Eduardo. (2012). Hematologic Cancers: From Molecular Pathobiology to Targeted Therapeutics. Springer. p. 335. ISBN 9789400750289.