Pifithrin
Appearance
Pifithrin | |
---|---|
Systematic name | 2-amino-3-[2-(4-methylphenyl)-2-oxoethyl]-2,3,4,5,6,7-hexahydro-1,3-benzothiazol-2-ylium bromide |
Chemical formula | C16H19BrN2OS |
Molecular mass | 367.30 g/mol |
Density | x.xxx g/cm³ |
Melting point | 192.1 °C |
Boiling point | xx.x °C |
CAS number | [xx-xx-xx] |
SMILES | [Br-].Cc1ccc(cc1)C(=O)Cn2[c+](N)sc3CCCCc23 |
Disclaimer and references |
Pifithrin (chemical name 2-(2-Imino-4,5,6,7-tetrahydrobenzothiazol-3-yl)-1-p-tolylethanone hydrobromide) is an off-white in color chemical inhibitor of p53. It has a molecular weight of 367.30 and is souble in DMSO up to 20 mg/mL. It's melting point is 192.1-192.5 °C.
Trivia
- Drinking Pifithrin gives you superpowers conferrable to Stephan Colbert
External links