Jump to content

Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Α-Naphthoflavone: Difference between pages

(Difference between pages)
Page 1
Page 2
Content deleted Content added
Saving copy of the {{chembox}} taken from revid 467360935 of page Alpha-Naphthoflavone for the Chem/Drugbox validation project (updated: 'CASNo').
 
ce
 
Line 1: Line 1:
{{lowercasetitle}}
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid [{{fullurl:Alpha-Naphthoflavone|oldid=467360935}} 467360935] of page [[Alpha-Naphthoflavone]] with values updated to verified values.}}
{{chembox
{{chembox
| Verifiedfields = changed
| Verifiedfields = changed
| verifiedrevid = 456681449
| verifiedrevid = 477319533
|Name=''alpha''-Naphthoflavone
| Name=α-Naphthoflavone
|ImageFile=Naphthoflavone.png
| ImageFile=Naphthoflavone.png
|ImageSize=200px
| ImageSize=200px
|IUPACName=2-phenylbenzo[h]chromen-4-one
| IUPACName=Benzo[7,8]flavone
| SystematicName=2-Phenyl-4''H''-naphtho[1,2-''b'']pyran-4-one
|OtherNames=7,8-Benzoflavone, ANF,2-phenylbenzo[h]chromen-4-one
| OtherNames=7,8-Benzoflavone<br>ANF<br>2-Phenyl-benzo[''h'']chromen-4-one
|Section1={{Chembox Identifiers
|Section1={{Chembox Identifiers
| InChI = 1/C19H12O2/c20-17-12-18(14-7-2-1-3-8-14)21-19-15-9-5-4-6-13(15)10-11-16(17)19/h1-12H
| InChI = 1/C19H12O2/c20-17-12-18(14-7-2-1-3-8-14)21-19-15-9-5-4-6-13(15)10-11-16(17)19/h1-12H
| InChIKey = VFMMPHCGEFXGIP-UHFFFAOYAW
| InChIKey = VFMMPHCGEFXGIP-UHFFFAOYAW
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 76995
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 283196
| ChEMBL = 283196
Line 18: Line 21:
| StdInChIKey = VFMMPHCGEFXGIP-UHFFFAOYSA-N
| StdInChIKey = VFMMPHCGEFXGIP-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|changed|??}}
| CASNo_Ref = {{cascite|changed|??}}
| CASNo = <!-- blanked - oldvalue: 604-59-1 -->
| CASNo=604-59-1
| PubChem=
| PubChem=11790
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB07453
| DrugBank = DB07453
| EC_number = 210-071-1
| UNII = FML65D8PY5
| DTXSID = DTXSID2040650
| SMILES = O=C\1c4c(O/C(=C/1)c2ccccc2)c3ccccc3cc4
| SMILES = O=C\1c4c(O/C(=C/1)c2ccccc2)c3ccccc3cc4
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
Line 27: Line 33:
}}
}}
|Section2={{Chembox Properties
|Section2={{Chembox Properties
| C=19 |H=12 |O=2
| C=19 | H=12 | O=2
| Appearance=
| Appearance=
| Density=
| Density=
| MeltingPt=
| MeltingPt=
| BoilingPt=
| BoilingPt=
| Solubility=
| Solubility=
}}
}}
|Section3={{Chembox Hazards
|Section3={{Chembox Hazards
| MainHazards=
| MainHazards=
| FlashPt=
| FlashPt=
| AutoignitionPt =
| Autoignition=
}}
}}
}}
}}

'''α-Naphthoflavone''', also known as '''7,8-benzoflavone''' and '''2-phenyl-benzo[''h'']chromen-4-one''', is a synthetic<ref name=Campbell>{{cite journal | title = Flavonoid inhibition of aromatase enzyme activity in human preadipocytes |author1=Campbell, Deborah R. |author2=Kurzer, Mindy S. | journal = Journal of Steroid Biochemistry and Molecular Biology | year = 1993 | volume = 46 | issue = 3 | pages = 381–388 | doi = 10.1016/0960-0760(93)90228-O | pmid = 9831487|s2cid=25861427 }}</ref><ref name=Kellis>{{cite journal |author1=Kellis JT Jr |author2=Vickery LE | title = Inhibition of human estrogen synthetase (aromatase) by flavones | journal = Science | year = 1984 | volume = 225 | issue = 4666 | pages = 1032–1034 | doi = 10.1126/science.6474163 | pmid = 6474163|bibcode=1984Sci...225.1032K }}</ref> [[flavone]] derivative. It can be prepared from [[2-naphthol]] and [[cinnamaldehyde]].<ref>{{cite journal | doi = 10.1021/jo00312a023 | title = A new chromone and flavone synthesis and its utilization for the synthesis of potentially antitumorigenic polycyclic chromones and flavones | year = 1990 | last1 = Harvey | first1 = Ronald G. | last2 = Hahn | first2 = Jung Tai | last3 = Bukowska | first3 = Maria | last4 = Jackson | first4 = Henry | journal = The Journal of Organic Chemistry | volume = 55 | issue = 25 | pages = 6161}}</ref>

α-Naphthoflavone is a potent [[enzyme inhibitor|inhibitor]] of the [[enzyme]] [[aromatase]], the enzyme that converts [[testosterone]] to [[estrogen]].<ref name=Campbell/><ref name=Kellis/> α-Naphthoflavone has been shown to cause abnormal testicular development in young chickens.<ref>{{cite journal |author1=Trefil, P. |author2=Micakova, A. |author3=Stiborova, M. |author4=Poplstein, M. |author5=Brillard, J.P. |author6=Hodek, P. | title = Effects of alpha-naphthoflavone on body growth and gonad development in chickens (Gallus domesticus) | journal = Czech Journal of Animal Science | year = 2004 | volume = 49 | issue = 6 | pages = 231–238|doi=10.17221/4305-CJAS |doi-access=free }}</ref>

==See also==
* [[beta-Naphthoflavone|β-Naphthoflavone]]
* [[C19H12O2|C<sub>19</sub>H<sub>12</sub>O<sub>2</sub>]]

==References==
{{Reflist}}

{{DEFAULTSORT:Naphthoflavone, Alpha-}}

[[Category:CYP1A2 inhibitors]]
[[Category:Aromatase inhibitors]]
[[Category:Benzochromenes]]
[[Category:Flavonoids]]


{{Organic-compound-stub}}