2,N,N-TMT: Difference between revisions

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 428819098

<!--Clinical data-->

| tradename =

| pregnancy_US =

| legal_AU =

| legal_DE = NpSG

| legal_UK = Class A

| legal_US =

| legal_status =

| routes_of_administration =

<!--Pharmacokinetic data-->

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

<!--Identifiers-->

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 1080-95-1

| ChEMBL = 7580

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = P15UO6J3FK

| ChemSpiderID = 9994827

| ATC_prefix =

| ATC_suffix =

| PubChem = 11820174

<!--Chemical data-->

| C=13 | H=18 | N=2

| smiles = Cc1c(c2ccccc2[nH]1)CCN(C)C

| StdInChI = 1S/C13H18N2/c1-10-11(8-9-15(2)3)12-6-4-5-7-13(12)14-10/h4-7,14H,8-9H2,1-3H3

| StdInChIKey = NDGCOWDSLVNLGE-UHFFFAOYSA-N

| melting_point =

| melting_high =

'''2,''N,N''-trimethyltryptamine''', '''2,''N,N''-TMT''', or '''2-Me-DMT''' is a [[tryptamine]] [[Chemical derivative|derivative]] that is a [[Psychedelic drug|psychedelic]] drug. It was invented by [[Alexander Shulgin]] and reported in his book [[TiHKAL]] (#34).<ref>[https://www.erowid.org/library/books_online/tihkal/tihkal34.shtml Erowid Online Books : "TIHKAL" - #34 2-ME-DMT<!-- Bot generated title -->]</ref> It is claimed to show psychoactive effects at a dosage of 50–100&nbsp;mg orally, but these are relatively mild compared to other similar drugs, suggesting that while the 2-methyl group has blocked the binding of metabolic enzymes, it is also interfering with binding to the 5HT_2A receptor target that mediates the hallucinogenic effects of these drugs.

== Legal status ==

Sweden's public health agency suggested classifying 2-Me-DMT as a hazardous substance, on May 15, 2019.<ref>{{cite web | url=https://www.folkhalsomyndigheten.se/nyheter-och-press/nyhetsarkiv/2019/maj/folkhalsomyndigheten-foreslar-att-20-amnen-klassas-som-narkotika-eller-halsofarlig-vara/ | title=Folkhälsomyndigheten föreslår att 20 ämnen klassas som narkotika eller hälsofarlig vara | publisher=Folkhälsomyndigheten | language=sv | date=15 May 2019 | access-date=11 November 2019 | archive-date=20 October 2021 | archive-url=https://web.archive.org/web/20211020121058/https://www.folkhalsomyndigheten.se/nyheter-och-press/nyhetsarkiv/2019/maj/folkhalsomyndigheten-foreslar-att-20-amnen-klassas-som-narkotika-eller-halsofarlig-vara/ | url-status=dead }}</ref>

* [https://isomerdesign.com/PiHKAL/read.php?domain=tk&id=34 2-Me-DMT entry in TiHKAL • info]

{{Tryptamines}}

{{DEFAULTSORT:TMT, 2, N, N-}}

[[Category:Dimethylamino compounds]]