Annulatin: Difference between revisions

Page 1
Page 2
Content deleted Content added
CheMoBot (talk | contribs)
Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Wikipedia:WikiProject Chemicals/Chem
ChemInform
 
(18 intermediate revisions by 15 users not shown)
Line 1: Line 1:
{{one source|date=August 2014}}
{{chembox
{{chembox
| Watchedfields = changed
| verifiedrevid = 445857905
| verifiedrevid = 445859665
| Name = Annulatin
| Name = Annulatin
| ImageFile = Annulatin.svg
| ImageFile = Annulatin.svg
Line 6: Line 8:
| ImageName = Chemical structure of annulatin
| ImageName = Chemical structure of annulatin
| ImageAlt = Chemical structure of annulatin
| ImageAlt = Chemical structure of annulatin
| IUPACName =
| IUPACName = 3′,4′,5,5′,7-Pentahydroxy-3-methoxyflavone
| SystematicName = 5,7-Dihydroxy-3-methoxy-2-(3,4,5-trihydroxyphenyl)-4''H''-1-benzopyran-4-one
| OtherNames = Myricetin 3-Methylether<br>3',4',5,5',7-Pentahydroxy-3-methoxyflavone
| OtherNames = Myricetin 3-Methylether
|Section1= {{Chembox Identifiers
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 1486-67-5
| CASNo = 1486-67-5
| UNII_Ref = {{fdacite|correct|FDA}}
| CASNo_Ref =
| CASOther =
| UNII = E49FR3626E
| PubChem =
| PubChem = 44259709
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 24227213
| ChemSpiderID = 24227213
| SMILES = COc1c(=O)c2c(cc(cc2oc1c3cc(c(c(c3)O)O)O)O)O
| SMILES = COc1c(=O)c2c(cc(cc2oc1c3cc(c(c(c3)O)O)O)O)O
| InChI = 1/C16H12O8/c1-23-16-14(22)12-8(18)4-7(17)5-11(12)24-15(16)6-2-9(19)13(21)10(20)3-6/h2-5,17-21H,1H3
| InChI = 1/C16H12O8/c1-23-16-14(22)12-8(18)4-7(17)5-11(12)24-15(16)6-2-9(19)13(21)10(20)3-6/h2-5,17-21H,1H3
| InChIKey = XWTLYULBWZQAAZ-UHFFFAOYAS
| InChIKey = XWTLYULBWZQAAZ-UHFFFAOYAS
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C16H12O8/c1-23-16-14(22)12-8(18)4-7(17)5-11(12)24-15(16)6-2-9(19)13(21)10(20)3-6/h2-5,17-21H,1H3
| StdInChI = 1S/C16H12O8/c1-23-16-14(22)12-8(18)4-7(17)5-11(12)24-15(16)6-2-9(19)13(21)10(20)3-6/h2-5,17-21H,1H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = XWTLYULBWZQAAZ-UHFFFAOYSA-N
| StdInChIKey = XWTLYULBWZQAAZ-UHFFFAOYSA-N
| MeSHName =
| MeSHName =
}}
}}
|Section2= {{Chembox Properties
|Section2={{Chembox Properties
| C=16 | H=12 | O=8
| Formula = C<sub>16</sub>H<sub>12</sub>O<sub>8</sub>
| MolarMass = 332.25 g/mol
| ExactMass = 332.053216 u
| Appearance =
| Appearance =
| Density =
| Density = 1.807 g/mL
| MeltingPt = <!-- °C -->
| MeltingPt =
| BoilingPt = <!-- °C -->
| BoilingPt =
| Solubility =
| Solubility =
}}
}}
| Section3 = {{Chembox Hazards
|Section3={{Chembox Hazards
| MainHazards =
| MainHazards =
| FlashPt =
| FlashPt =
| Autoignition =
| AutoignitionPt =
| RPhrases = <!-- {{R10}}, {{R23}}, {{R34}}, {{R50}} etc. -->
| SPhrases = <!-- {{S1/2}}, {{S9}}, {{S16}}, {{S26}}, {{S36/37/39}}, {{S45}}, {{S61}} etc. -->
}}
}}
}}
}}
'''Annulatin''' is an [[O-methylated flavonol]] found in the roots of ''[[Pteroxygonum giraldii]]''.<ref>Antioxidant Flavone Glycosides from the Root of Pteroxygonum giraldii. Bao-Lin Li, Zhan-Jun Yang, Lin-Ling Jiang, Xi-Quan Zhang, Hong-Mei Gu, Hui-Chun Wang and Xian-Hua Tian, Bull. Korean Chem. Soc. 2009, Vol. 30, No. 7, pp. 1459-1462, {{doi|10.1002/chin.200949203}}</ref>


'''Annulatin''' is an [[O-methylated flavonol]] found in the roots of ''[[Pteroxygonum giraldii]]''.<ref>{{cite journal | doi = 10.1002/chin.200949203| title = ChemInform Abstract: Antioxidant Flavone Glycosides from the Root of Pteroxygonum giraldii| date = 2009| last1 = Li| first1 = Bao-Lin| last2 = Yang| first2 = Zhan-Jun| last3 = Jiang| first3 = Lin-Ling| last4 = Zhang| first4 = Xi-Quan| last5 = Gu| first5 = Hong-Mei| last6 = Wang| first6 = Hui-Chun| last7 = Tian| first7 = Xian-Hua| journal = ChemInform| volume = 40| issue = 49}}</ref>
==References==

== References ==
{{reflist}}
{{reflist}}


{{Flavonol}}
{{Flavonol}}


[[Category:Flavonols]]
[[Category:O-methylated flavonols]]


{{Natural-phenol-stub}}
{{aromatic-stub}}