Apigetrin: Difference between revisions
Content deleted Content added
Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'ChEMBL'). |
m Reverted edit by 210.0.158.130 (talk) to last version by LegionMammal978 |
||
| (20 intermediate revisions by 15 users not shown) | |||
| Line 1: | Line 1: | ||
{{one source|date=September 2014}} |
|||
{{chembox |
{{chembox |
||
| Verifiedfields = changed |
| Verifiedfields = changed |
||
| Watchedfields = changed |
|||
| verifiedrevid = |
| verifiedrevid = 457135003 |
||
| |
| Name = Apigetrin |
||
| Reference= |
|||
| |
| Reference= |
||
| ImageFile = Apigetrin.svg |
|||
| |
| ImageName = |
||
| IUPACName = 7-(β-<small>D</small>-Glucopyranosyloxy)-4′,5-dihydroxyflavone |
|||
| ImageName = |
|||
| |
| SystematicName = 5-Hydroxy-2-(4-hydroxyphenyl)-7-{[(2''S'',3''R'',4''S'',5''S'',6''R'')-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-4''H''-1-benzopyran-4-one |
||
| ⚫ | |||
5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
|||
| ⚫ | |||
| ⚫ | |||
| ⚫ | |||
| ⚫ | |||
| ⚫ | |||
| ChemSpiderID = 4444290 |
| ChemSpiderID = 4444290 |
||
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
||
| ChEMBL = |
| ChEMBL = 1159512 |
||
| InChI = 1/C21H20O10/c22-8-16-18(26)19(27)20(28)21(31-16)29-11-5-12(24)17-13(25)7-14(30-15(17)6-11)9-1-3-10(23)4-2-9/h1-7,16,18-24,26-28H,8H2/t16-,18-,19+,20-,21-/m1/s1 |
| InChI = 1/C21H20O10/c22-8-16-18(26)19(27)20(28)21(31-16)29-11-5-12(24)17-13(25)7-14(30-15(17)6-11)9-1-3-10(23)4-2-9/h1-7,16,18-24,26-28H,8H2/t16-,18-,19+,20-,21-/m1/s1 |
||
| InChIKey = KMOUJOKENFFTPU-QNDFHXLGBM |
| InChIKey = KMOUJOKENFFTPU-QNDFHXLGBM |
||
| Line 23: | Line 24: | ||
| CASNo_Ref = {{cascite|correct|CAS}} |
| CASNo_Ref = {{cascite|correct|CAS}} |
||
| CASNo = 578-74-5 |
| CASNo = 578-74-5 |
||
| |
| UNII_Ref = {{fdacite|correct|FDA}} |
||
| UNII = 7OF2S66PCH |
|||
| KEGG_Ref = {{keggcite|correct|kegg}} |
|||
| KEGG = C04608 |
|||
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|||
| ChEBI = 16778 |
| ChEBI = 16778 |
||
| SMILES = O=C\3c4c(O)cc(O[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)CO)cc4O/C(c2ccc(O)cc2)=C/3 |
| SMILES = O=C\3c4c(O)cc(O[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)CO)cc4O/C(c2ccc(O)cc2)=C/3 |
||
| |
| PubChem = 5280704 |
||
}} |
}} |
||
| |
|Section2={{Chembox Properties |
||
| C=21 | H=20 | O=10 |
|||
| Formula = C<sub>21</sub>H<sub>20</sub>O<sub>10</sub> |
|||
| ⚫ | |||
| MolarMass = 432.3775 g/mol |
|||
| ExactMass = 432.105647 |
|||
| ⚫ | |||
}} |
}} |
||
}} |
}} |
||
'''Apigetrin''' is a chemical compound that can be found in [[dandelion coffee]]. |
|||
'''Apigetrin''' is a chemical compound that can be found in [[dandelion coffee]] and in ''[[Teucrium gnaphalodes]]''.<ref>{{cite journal | doi = 10.1021/np50041a040| title = Flavonoid Aglycones and Glycosides from Teucrium gnaphalodes| journal = Journal of Natural Products| volume = 48| issue = 5| pages = 859| year = 1985| last1 = Barberán| first1 = F. A. T.| last2 = Gil| first2 = M. I.| last3 = Tomás| first3 = F.| last4 = Ferreres| first4 = F.| last5 = Arques| first5 = A.}}</ref> |
|||
| ⚫ | |||
| ⚫ | |||
{{reflist}} |
{{reflist}} |
||
==External links== |
== External links == |
||
* [http://www.chemblink.com/products/578-74-5.htm Apigetrin on chemlink.com] |
* [http://www.chemblink.com/products/578-74-5.htm Apigetrin on chemlink.com] |
||
| Line 47: | Line 51: | ||
[[Category:Flavone glucosides]] |
[[Category:Flavone glucosides]] |
||
{{ |
{{organic-compound-stub}} |
||
[[fr:Apigétrine]] |
|||