Calcium glubionate: Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
+{{Short description|Chemical compound}}
+{{refimprove|date=January 2022}}
 {{Drugbox
+| Verifiedfields = changed
-| IUPAC_name        = calcium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate (2R,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanoate
+| Watchedfields = changed
-| image             = calcium glubionate.png
+| verifiedrevid = 399702300
+| IUPAC_name = calcium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate (2R,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanoate
+| image = calcium glubionate.png
+<!--Clinical data-->
+| tradename =
+| Drugs.com = {{drugs.com|CONS|calcium_glubionate}}
+| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
+| pregnancy_US = <!-- A / B            / C / D / X -->
+| pregnancy_category =
+| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
+| legal_CA = <!--             / Schedule I, II, III, IV, V, VI, VII, VIII -->
+| legal_UK = <!-- GSL         / P       / POM / CD / Class A, B, C -->
+| legal_US = <!-- OTC                   / Rx-only  / Schedule I, II, III, IV, V -->
+| legal_status =
+| routes_of_administration =
+<!--Pharmacokinetic data-->
+| bioavailability =
+| protein_bound =
+| metabolism =
+| elimination_half-life =
+| excretion =
+<!--Identifiers-->
+| CAS_number_Ref = {{cascite|changed|??}}
+| CAS_number = 12569-38-9
+| ATC_prefix = A12
+| ATC_suffix = AA02
+| PubChem = 64776
+| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
+| DrugBank =
+| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
 | ChemSpiderID = 58310
+| UNII_Ref = {{fdacite|changed|FDA}}
-| InChI = 1/C12H22O12.C6H12O7.Ca/c13-1-3(15)10(7(18)8(19)11(21)22)24-12-9(20)6(17)5(16)4(2-14)23-12;7-1-2(8)3(9)4(10)5(11)6(12)13;/h3-10,12-20H,1-2H2,(H,21,22);2-5,7-11H,1H2,(H,12,13);/q;;+2/p-2/t3-,4-,5+,6+,7-,8-,9-,10-,12+;2-,3-,4+,5-;/m11./s1
+| UNII = 3CF7K0SD0Q
-| InChIKey = YPCRNBPOUVJVMU-PKSWLJDPBX
+<!--Chemical data-->
+| C=18 | H=32 | Ca=1 | O=19
 | smiles = [Ca+2].[O-]C(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.[O-]C(=O)[C@H](O)[C@@H](O)[C@H](O[C@@H]1O[C@@H]([C@H](O)[C@H](O)[C@H]1O)CO)[C@H](O)CO
+| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
 | StdInChI = 1S/C12H22O12.C6H12O7.Ca/c13-1-3(15)10(7(18)8(19)11(21)22)24-12-9(20)6(17)5(16)4(2-14)23-12;7-1-2(8)3(9)4(10)5(11)6(12)13;/h3-10,12-20H,1-2H2,(H,21,22);2-5,7-11H,1H2,(H,12,13);/q;;+2/p-2/t3-,4-,5+,6+,7-,8-,9-,10-,12+;2-,3-,4+,5-;/m11./s1
+| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
 | StdInChIKey = YPCRNBPOUVJVMU-LCGAVOCYSA-L
-| CAS_number        =
-| ATC_prefix        = A12
-| ATC_suffix        = AA02
-| PubChem           = 64776
-| DrugBank          =
-| chemical_formula  = C<sub>18</sub>H<sub>32</sub>CaO<sub>19</sub>
-| molecular_weight  = 592.513 g/mol
-| bioavailability   =
-| protein_bound     =
-| metabolism        =
-| elimination_half-life =
-| excretion         =
-| pregnancy_AU      =  <!-- A / B1 / B2 / B3 / C / D / X -->
-| pregnancy_US      =  <!-- A / B            / C / D / X -->
-| pregnancy_category=
-| legal_AU          =  <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
-| legal_CA          =  <!--             / Schedule I, II, III, IV, V, VI, VII, VIII -->
-| legal_UK          =  <!-- GSL         / P       / POM / CD / Class A, B, C -->
-| legal_US          =  <!-- OTC                   / Rx-only  / Schedule I, II, III, IV, V -->
-| legal_status      =
-| routes_of_administration =
 }}
+'''Calcium glubionate''' (or '''glubionate calcium''') is a [[Dietary mineral|mineral supplement]] that is used to treat [[hypocalcemia]].<ref>{{cite book | vauthors = Kizior RJ, Hodgson KJ | chapter = Calcium glubionate | veditors = Collette J, Graves J | publisher =Elsevier Health Sciences |title=Saunders nursing drug handbook 2020 |date=2020 |location=St. Louis, Missouri |isbn=978-0-323-69401-8 |page=186 | chapter-url=https://books.google.com/books?id=DLyKDwAAQBAJ&dq=calcium+glubionate&pg=PA186}}</ref>
-'''Calcium glubionate''' (or '''glubionate calcium''') is a [[Dietary mineral|mineral supplement]].
+== References ==
+{{Reflist}}
 {{Mineral supplements}}
+{{Calcium compounds}}
 [[Category:Calcium compounds]]