Jump to content

Carboquone: Difference between revisions

Page 1
Page 2
Content deleted Content added
CheMoBot (talk | contribs)
Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Wikipedia:WikiProject Chemicals/Chembox validation|Chem/Drugbox
Importing Wikidata short description: "Chemical compound"
 
(17 intermediate revisions by 16 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{citesources|date=June 2009}}
{{drugbox
{{Drugbox
| Watchedfields = changed
| verifiedrevid = 444188235
| IUPAC_name = {2-[2,5-''bis''(aziridin-1-yl)-4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl]-2-methoxyethyl} carbamate
| image = Carboquone.png
<!--Clinical data-->
| tradename =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =
<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
<!--Identifiers-->
| CAS_number = 24279-91-2
| ATC_prefix = L01
| ATC_suffix = AC03
| PubChem = 2569
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 1CB0HBT12C
| UNII = 1CB0HBT12C
| ChEMBL = 443014
| verifiedrevid = 443467490
| ChemSpiderID = 2471
| IUPAC_name = {2-[2,5-''bis''(aziridin-1-yl)-4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl]-2-methoxyethyl} carbamate
| smiles = O=C(OCC(OC)C=1C(=O)\C(=C(/C(=O)C=1N2CC2)C)N3CC3)N
| image = Carboquone.png
| StdInChI = 1S/C15H19N3O5/c1-8-11(17-3-4-17)14(20)10(9(22-2)7-23-15(16)21)12(13(8)19)18-5-6-18/h9H,3-7H2,1-2H3,(H2,16,21)
| CAS_number = 24279-91-2
| StdInChIKey = SHHKQEUPHAENFK-UHFFFAOYSA-N
| ATC_prefix = L01
<!--Chemical data-->
| ATC_suffix = AC03
| PubChem = 2569
| C=15 | H=19 | N=3 | O=5
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| C=15|H=19|N=3|O=5
| molecular_weight = 321.33 g/mol
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category=
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =
}}
}}


'''Carboquone''' is a [[Drug#Medication|drug]] used in [[chemotherapy]].<ref>{{cite journal | vauthors = Saito T | title = [An anticancer drug--carboquone] | language = Japanese | journal = Gan to Kagaku Ryoho. Cancer & Chemotherapy | volume = 15 | issue = 3 | pages = 549–54 | date = March 1988 | pmid = 3279914 | trans-title = An anticancer drug--carboquone }}</ref>
'''Carboquone''' is a drug used in [[chemotherapy]].


== References ==
{{reflist}}


== See also ==
*[[Chemotherapy]]
*[[Aziridine]]


{{Chemotherapeutic agents}}
{{Chemotherapeutic agents}}
Line 40: Line 55:
[[Category:Alkylating antineoplastic agents]]
[[Category:Alkylating antineoplastic agents]]
[[Category:Ethers]]
[[Category:Ethers]]
[[Category:Benzoquinones]]
[[Category:1,4-Benzoquinones]]



{{antineoplastic-drug-stub}}
{{antineoplastic-drug-stub}}