Jump to content

Clopyralid: Difference between revisions

Page 1
Page 2
Content deleted Content added
CheMoBot (talk | contribs)
Updating {{chembox}} (changes to verified fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref') per Chem/Drugbox validation (rep
mNo edit summary
Tags: Visual edit Mobile edit Mobile web edit
 
(40 intermediate revisions by 28 users not shown)
Line 1: Line 1:
{{chembox
{{Chembox
| Verifiedfields = changed
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 417604893
| verifiedrevid = 431582573
| Reference = <ref>''Merck Index'', 11th Edition, '''2398'''.</ref>
| Reference = <ref>''Merck Index'', 11th Edition, '''2398'''.</ref>
| ImageFile = Clopyralid.png
| ImageFile = Clopyralid.png
| ImageSize = 150px
| ImageSize = 160
| ImageFile1 = Clopyralid-3D-spacefill.png
| IUPACName = 3,6-Dichloro-2-pyridinecarboxylic acid
| ImageSize1 = 180
| ImageAlt1 = Adding space-filling model, adding alt text
| PIN = 3,6-Dichloropyridine-2-carboxylic acid
| OtherNames = 3,6-Dichloropicolinic acid
| OtherNames = 3,6-Dichloropicolinic acid
| Section1 = {{Chembox Identifiers
|Section1={{Chembox Identifiers
| Abbreviations = 3,6-DCP
| Abbreviations = 3,6-DCP
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 1702-17-6
| CASNo = 1702-17-6
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 10G14M0WDH
| EINECS =
| EINECS =
| PubChem =
| SMILES = O=C(O)C1=C(Cl)C=CC(Cl)=N1
| SMILES = O=C(O)C1=C(Cl)C=CC(Cl)=N1
| InChI =
| PubChem = 15553
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 14797
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1650605
| SMILES1 = c1cc(nc(c1Cl)C(=O)O)Cl
| InChI = 1/C6H3Cl2NO2/c7-3-1-2-4(8)9-5(3)6(10)11/h1-2H,(H,10,11)
| InChIKey = HUBANNPOLNYSAD-UHFFFAOYAP
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C6H3Cl2NO2/c7-3-1-2-4(8)9-5(3)6(10)11/h1-2H,(H,10,11)
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = HUBANNPOLNYSAD-UHFFFAOYSA-N
| RTECS =
| RTECS =
| MeSHName =
| MeSHName =
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI =
| ChEBI =
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C18779
| KEGG = C18779
}}
| ATCCode_prefix =
|Section2={{Chembox Properties
| ATCCode_suffix =
| ATC_Supplemental =}}
| Section2 = {{Chembox Properties
| Formula = C<sub>6</sub>H<sub>3</sub>Cl<sub>2</sub>NO<sub>2</sub>
| Formula = C<sub>6</sub>H<sub>3</sub>Cl<sub>2</sub>NO<sub>2</sub>
| MolarMass = 192.00
| MolarMass = 192.00
| Appearance = White crystalline solid
| Appearance = White crystalline solid
| Density =
| Density =
| MeltingPt = 150-152 °C
| MeltingPtC = 150 to 152
| MeltingPt_notes =
| Melting_notes =
| BoilingPt =
| BoilingPt =
| Boiling_notes =
| BoilingPt_notes =
| Solubility = ~1000 ppm
| Solubility = ~1000 ppm
| SolubleOther =
| SolubleOther =
| Solvent =
| Solvent =
| pKa =
| pKa =
| pKb = }}
| pKb =
}}
| Section7 = {{Chembox Hazards
|Section7={{Chembox Hazards
| EUClass =
| EUIndex =
| MainHazards =
| MainHazards =
| NFPA-H =
| NFPA-H =
| NFPA-F =
| NFPA-F =
| NFPA-R =
| NFPA-R =
| NFPA-O =
| NFPA-S =
| RPhrases =
| SPhrases =
| RSPhrases =
| FlashPt =
| FlashPt =
| Autoignition =
| AutoignitionPt =
| ExploLimits =
| ExploLimits =
| PEL = }}
| PEL =
}}
}}
}}


'''Clopyralid''' (3,6-dichloro-2-pyridinecarboxylic acid) is a selective [[herbicide]] used for control of broadleaf weeds, especially [[thistle]]s and [[clover]]s. Clopyralid is in the [[picolinic acid]] family of herbicides, which also includes [[aminopyralid]], [[picloram]], [[triclopyr]], and several less common herbicides.<ref name=VT>Staff, Virginia Tech Cooperative Extension. Revised May 14, 2012 [http://pubs.ext.vt.edu/VTTP/VTTP-6/VTTP-6_pdf.pdf Pyridine Herbicide Carryover: Causes and Precautions] {{Webarchive|url=https://web.archive.org/web/20161130011248/http://pubs.ext.vt.edu/VTTP/VTTP-6/VTTP-6_pdf.pdf |date=2016-11-30 }} Accessed May 27, 2013</ref><ref>Bob Hartzler, extension weed management specialist, Department of Agronomy, Iowa State University. February 21, 2006 [http://www.weeds.iastate.edu/mgmt/2006/aminopyralid.shtml Aminopyralid - New herbicide for pastures, roadsides, etc.] {{Webarchive|url=https://web.archive.org/web/20141103050326/http://www.weeds.iastate.edu/mgmt/2006/aminopyralid.shtml |date=2014-11-03 }} Accessed May 27, 2013</ref> For control of creeping thistle, ''[[Cirsium arvense]]'', a noxious, perennial weed, clopyralid is one of the few effective herbicides available. It is particularly damaging to peas, tomatoes, and sunflowers, and can render potatoes, lettuce, and spinach inedible.<ref name=Moody>{{cite news | url=http://www.thetimes.co.uk/tto/environment/article3696921.ece | title=Weedkiller banned in US 'is getting into compost and killing garden vegetables' | newspaper=The Times | location=London | first=Oliver | last=Moody | date=23 February 2013}}</ref> It does not affect grasses (family [[Poaceae]]).{{Citation needed|date = December 2012}}
'''Clopyralid''' (3,6-dichloro-2-pyridinecarboxylic acid) is a selective [[herbicide]] used for control of broadleaf weeds, especially [[thistle]]s and [[clover]]s. For control of Creeping Thistle, ''[[Cirsium arvense]]'', a noxious, perennial weed, clopyralid is the only effective herbicide available.


Clopyralid is known for its ability to persist in dead plants and [[compost]], and has accumulated to phytotoxic levels in finished compost in a few highly publicized cases. This first came to light in Washington, when during 2000 and 2001, residues of clopyralid were detected in commercial compost, and compost made at a municipal site damaged tomatoes and other garden plants planted in it. Word quickly spread to other local and state governments, and in 2002, [[DowAgro]], the manufacturer of clopyralid, voluntarily deregistered it for use on domestic lawns in the US<ref>David E. Haskell , California Department of Pesticide Regulation [http://www.cwss.org/proceedingsfiles/2003/045_2003.pdf Clopyralid in Compost]{{dead link|date=August 2017 |bot=InternetArchiveBot |fix-attempted=yes }} 2003 Proceedings of the California Weed Science Society 55:163-166</ref> and it is banned in several US states, but it is found in consumer products in Europe such as Scotts Verdone Extra and Vitax Lawn Clear 2.<ref name=Moody />
Clopyralid is in the [[pyridine]] family of herbicides, which also includes [[picloram]], [[triclopyr]], and several less common herbicides. It is particularly active on members of the [[Asteraceae]] and the [[Fabaceae]]. It does not affect members of the [[Poaceae]] (grasses).


Clopyralid is licensed for lawn use in [[France]] and under these names:
Clopyralid is notorious for its ability to persist in dead plants and [[compost]], and has accumulated to phytotoxic levels in finished compost in a few highly publicized cases. In [[Seattle]], [[Washington (U.S. state)|Washington]], clopyralid was widely used for weed control in lawns until prohibited in 1999. There, a city-mandated curbside grass clipping collection and composting program produced compost with measurable levels of clopyralid. Subsequently, [[DowAgro]], the manufacturer of clopyralid, voluntarily deregistered it for lawn uses.

Clopyralid is licensed for lawn use in France and under the following names:
Bayer Jardin: Désherbant jeune gazon and Scanner Sélectif gazon
Bayer Jardin: Désherbant jeune gazon and Scanner Sélectif gazon
Vilmorin: désherbant Gazon LONPAR.
Vilmorin: désherbant Gazon LONPAR.
Brand names of clopyralid in the US market include Stinger, Transline, Reclaim.<ref>http://www.weedscience.com/summary/ChemFamilySum.asp?lstActive=&btnSub1=Go&lstHRAC=24&btnSub2=Go</ref>
Brand names of clopyralid in the US market include Stinger, Transline, Reclaim,<ref name=VT /><ref>{{cite web |url=http://www.weedscience.com/summary/ChemFamilySum.asp?lstActive=&btnSub1=Go&lstHRAC=24&btnSub2=Go |title=Herbicide Resistant Weeds |accessdate=2011-03-07 |url-status=dead |archiveurl=https://web.archive.org/web/20110718023102/http://www.weedscience.com/summary/ChemFamilySum.asp?lstActive=&btnSub1=Go&lstHRAC=24&btnSub2=Go |archivedate=2011-07-18 }}</ref> Curtail, Confront, Clopyr AG, Lontrel, Millennium Ultra, Millenium Ultra Plus and Redeem.

==See also==

* [[Aminopyralid]]


==References==
==References==
<references/>
<references/>

==External links==
* [http://www.alanwood.net/pesticides/clopyralid.html Clopyralid data sheet]


{{Herbicides}}
{{Herbicides}}


[[Category:Herbicides]]
[[Category:Auxinic herbicides]]
[[Category:Pyridines]]
[[Category:Chloropyridines]]
[[Category:Carboxylic acids]]
[[Category:Carboxylic acids]]
[[Category:Organochlorides]]

[[fr:Clopyralid]]
[[gl:Clopiralid]]
[[nl:Clopyralide]]