Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Cobalt(II) acetate: Difference between pages

| Verifiedfields = changed

| verifiedrevid = 476996050

| ImageFile1 = Nickel(II)-acetate-tetrahydrate-3D-balls.png

| ImageFile2 = Octan kobaltnatý.JPG

|Section1={{Chembox Identifiers

| UNII1_Ref = {{fdacite|correct|FDA}}

| UNII1 = 7648Z91O1N

| UNII1_Comment = (tetrahydrate)

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo_Comment = (anhydrous)

| CASNo2_Ref = {{cascite|correct|CAS}}

| CASNo2 = 6147-53-1

| CASNo2_Comment = (tetrahydrate)

| SMILES_Comment = ionic form

| SMILES1 = O=C(C)O[Co]OC(C)=O

| SMILES1_Comment = coordination form (anhydrate)

| SMILES2 = O=C(C)O[Co-4]([O+H2])([O+H2])([O+H2])([O+H2])OC(C)=O

| SMILES2_Comment = coordination form (tetrahydrate)

|Section2={{Chembox Properties

| Formula = Co(C₂H₃O₂)₂

| MeltingPtC = 140

| MeltingPt_notes = (tetrahydrate)

| SolubleOther = soluble in [[ethanol|alcohol]], dilute acids, [[pentyl acetate]] (tetrahydrate)

| MagSus = +11,000·10⁻⁶ cm³/mol

|Section3={{Chembox Hazards

| ExternalSDS = [http://hazard.com/msds/mf/baker/baker/files/c4895.htm J.T. Baker MSDS]

| AutoignitionPt =

'''Cobalt(II) acetate''' is the [[cobalt]] [[Salt (chemistry)|salt]] of [[acetic acid]]. It is commonly found as the [[tetrahydrate]] Co(CH₃CO₂)₂·4 H₂O, abbreviated Co(OAc)₂·4 H₂O. It is used as a [[Catalysis|catalyst]].

==Synthesis and structure==

Like many other [[transition metal acetates]], cobalt(II) acetate forms by the reaction of cobalt oxide or hydroxide and acetic acid:

: CoO + 2{{nbsp}}CH₃CO₂H + 3{{nbsp}}H₂O → Co(CH₃CO₂)₂·4 H₂O

The tetrahydrate has been shown by [[X-ray crystallography]] to adopt an octahedral structure, the central cobalt centre being coordinated by four water molecules and two acetate [[ligand]]s.<ref>{{cite journal |doi=10.1107/S1600536803019093|title=Cobalt diacetate tetrahydrate|year=2003|last1=Sobolev|first1=Alexandre N.|last2=Miminoshvili|first2=Elguja B.|last3=Miminoshvili|first3=Ketevan E.|last4=Sakvarelidze|first4=Tamara N.|journal=Acta Crystallographica Section E|volume=59|issue=10|pages=m836–m837}}</ref> The analogous [[nickel acetate]] is isostructural.<ref>{{cite journal | doi = 10.1107/S0365110X5300171X | journal = [[Acta Crystallogr.]] | title = The crystal structures of nickel acetate, Ni(CH₃COO)₂&middot;4H₂O, and cobalt acetate, Co(CH₃COO)₂&middot;4H₂O | year = 1953 | last1 = Van Niekerk | first1 = J. N. | last2 = Schoening | first2 = F. R. L. | volume = 6 | issue = 7 | pages = 609–612}}</ref>

Various hydrates are known including Co(CH₃CO₂)₂·H₂O and [Co(CH₃CO₂)₂]₅·0.5 H₂O.<ref>{{cite journal |doi=10.1002/zaac.200900457|title=Infinite Coordination Polymers of One- and Two-dimensional Cobalt Acetates|year=2010|last1=Zhang|first1=Gao|last2=Lin|first2=Jian|last3=Guo|first3=Dong-Wei|last4=Yao|first4=Shi-Yan|last5=Tian|first5=Yun-Qi|journal=Zeitschrift für Anorganische und Allgemeine Chemie|volume=636|issue=7|pages=1401–1404}}</ref>

==Reactions and uses==

Cobalt acetate is a precursor to various [[oil drying agent]]s, catalysts that allow paints and varnishes to harden.<ref>John Dallas Donaldson, Detmar Beyersmann, "Cobalt and Cobalt Compounds" in Ullmann's Encyclopedia of Industrial Chemistry, Wiley-VCH, Weinheim, 2005. {{doi|10.1002/14356007.a07_281.pub2}}</ref>

[[Anhydrous]] cobalt acetate is a widely used source of cobalt in the synthesis of materials,<ref>{{cite journal |doi=10.1038/nmat4113|title=Metal–organic framework nanosheets in polymer composite materials for gas separation|year=2015|last1=Rodenas|first1=Tania|last2=Luz|first2=Ignacio|last3=Prieto|first3=Gonzalo|last4=Seoane|first4=Beatriz|last5=Miro|first5=Hozanna|last6=Corma|first6=Avelino|last7=Kapteijn|first7=Freek|last8=Llabrés i Xamena|first8=Francesc X.|last9=Gascon|first9=Jorge|journal=Nature Materials|volume=14|issue=1|pages=48–55|pmid=25362353|pmc=4270742|bibcode=2015NatMa..14...48R}}</ref> catalyst,<ref>{{cite journal |doi=10.1016/j.tet.2006.06.065|title=Recent advances in homogeneous transition metal-catalyzed aerobic alcohol oxidations|year=2006|last1=Schultz|first1=Mitchell J.|last2=Sigman|first2=Matthew S.|journal=Tetrahedron|volume=62|issue=35|pages=8227–8241}}</ref> and complexes.<ref>{{cite journal | doi = 10.1021/ed054p443 | journal = [[J. Chem. Educ.]] | title = Oxygen Uptake by a Cobalt(II) Complex | author = Appleton, T. G. | year = 1977 | volume = 54 | issue = 7 | pages = 443}}</ref>

==Safety==

Cobalt salts are poisonous.<ref>[http://www.mallbaker.com/americas/msds/english/c4895_msds_us_default.pdf MallBaker MSDS]{{dead link|date=August 2017 |bot=InternetArchiveBot |fix-attempted=yes }}</ref>

==References==

{{Reflist}}

== External Links ==

{{Cobalt compounds}}

{{Acetates}}

[[Category:Acetates]]

[[Category:Cobalt(II) compounds]]