Jump to content

Corticorelin: Difference between revisions

Page 1
Page 2
Content deleted Content added
CheMoBot (talk | contribs)
Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Wikipedia:WikiProject Chemicals/Chembox validati
Importing Wikidata short description: "Chemical compound"
 
(17 intermediate revisions by 10 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{drugbox
{{Drugbox
| Watchedfields = changed
| verifiedrevid = 444310397
| IUPAC_name =
| image = <!--Corticorelin.png seems to be ovine corticorelin-->

<!--Clinical data-->
| tradename =
| Drugs.com = {{drugs.com|international|corticorelin}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life = 9 minutes
| excretion =

<!--Identifiers-->
| CAS_number = 86784-80-7
| ATC_prefix = V04
| ATC_suffix = CD04
| PubChem = 16186200
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB05394
| KEGG = D03905
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 305OE8862Y
| UNII = 305OE8862Y
| ChemSpiderID = 17315094
| verifiedrevid = 437129131

| IUPAC_name =
<!--Chemical data-->
| image = Corticorelin.png
| CAS_number = 79804-71-0
| C=208 | H=344 | N=60| O=63 | S=2
| molecular_weight =
| ATC_prefix = V04
| smiles = [H]/N=C(\N)/NCCC[C@@H](C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](C)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(=O)N)C(=O)N[C@@H](CCCN/C(=N/[H])/N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N)NC(=O)[C@H](C)NC(=O)[C@H](CCSC)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C(C)C)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCN/C(=N/[H])/N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc2c[nH]cn2)NC(=O)[C@H](Cc3ccccc3)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@H]([C@@H](C)CC)NC(=O)[C@@H]4CCCN4C(=O)[C@@H]5CCCN5C(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CO)N
| ATC_suffix = CD04
| StdInChI=1S/C208H344N60O63S2/c1-30-106(20)161(165(215)291)263-202(328)163(108(22)32-3)264-184(310)129(58-67-157(285)286)243-182(308)131(70-78-333-29)246-187(313)134(80-99(6)7)250-176(302)118(45-36-37-71-209)237-174(300)120(47-39-73-225-207(218)219)239-194(320)143(89-152(214)276)256-197(323)145(94-270)260-193(319)141(87-115-91-222-96-227-115)248-169(295)112(26)230-172(298)122(51-60-149(211)273)240-177(303)123(52-61-150(212)274)234-168(294)111(25)232-185(311)133(79-98(4)5)249-181(307)124(53-62-151(213)275)241-178(304)125(54-63-153(277)278)235-167(293)110(24)229-171(297)119(46-38-72-224-206(216)217)233-166(292)109(23)231-173(299)130(69-77-332-28)245-179(305)127(56-65-155(281)282)244-188(314)138(84-103(14)15)258-200(326)160(105(18)19)262-183(309)128(57-66-156(283)284)242-175(301)121(48-40-74-226-208(220)221)238-186(312)135(81-100(8)9)251-189(315)136(82-101(10)11)252-192(318)142(88-116-92-223-97-228-116)255-191(317)140(86-114-43-34-33-35-44-114)259-203(329)164(113(27)272)266-196(322)139(85-104(16)17)253-195(321)144(90-159(289)290)257-190(316)137(83-102(12)13)254-198(324)146(95-271)261-201(327)162(107(21)31-2)265-199(325)147-49-41-75-267(147)205(331)148-50-42-76-268(148)204(330)132(59-68-158(287)288)247-180(306)126(55-64-154(279)280)236-170(296)117(210)93-269/h33-35,43-44,91-92,96-113,117-148,160-164,269-272H,30-32,36-42,45-90,93-95,209-210H2,1-29H3,(H2,211,273)(H2,212,274)(H2,213,275)(H2,214,276)(H2,215,291)(H,222,227)(H,223,228)(H,229,297)(H,230,298)(H,231,299)(H,232,311)(H,233,292)(H,234,294)(H,235,293)(H,236,296)(H,237,300)(H,238,312)(H,239,320)(H,240,303)(H,241,304)(H,242,301)(H,243,308)(H,244,314)(H,245,305)(H,246,313)(H,247,306)(H,248,295)(H,249,307)(H,250,302)(H,251,315)(H,252,318)(H,253,321)(H,254,324)(H,255,317)(H,256,323)(H,257,316)(H,258,326)(H,259,329)(H,260,319)(H,261,327)(H,262,309)(H,263,328)(H,264,310)(H,265,325)(H,266,322)(H,277,278)(H,279,280)(H,281,282)(H,283,284)(H,285,286)(H,287,288)(H,289,290)(H4,216,217,224)(H4,218,219,225)(H4,220,221,226)/t106-,107-,108-,109-,110-,111-,112-,113+,117-,118-,119-,120-,121-,122-,123-,124-,125-,126-,127-,128-,129-,130-,131-,132-,133-,134-,135-,136-,137-,138-,139-,140-,141-,142-,143-,144-,145-,146-,147-,148-,160-,161-,162-,163-,164-/m0/s1
| PubChem = 16132344
| StdInChIKey = GBONBLHJMVUBSJ-FAUHKOHMSA-N
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| C=205|H=339|N=59|O=63|S=1
| molecular_weight = 4670.31 g/mol
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category=
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =
}}
}}


'''Corticorelin''' is a diagnostic agent. It is a [[corticotropin-releasing hormone]].<ref name="pmid8053970">{{cite journal |author=Andoh K, Kimura T, Saeki I, ''et al'' |title=General pharmacological properties of the human corticotropin-releasing hormone corticorelin (human) |journal=Arzneimittelforschung |volume=44 |issue=6 |pages=715–26 |year=1994 |month=June |pmid=8053970 |doi= |url=}}</ref>
'''Corticorelin''' ([[International Nonproprietary Name|INN]], trade name '''Xerecept''') is a [[diagnostic agent]]. It is a synthetic form of human [[corticotropin-releasing hormone]] (hCRH).<ref name="pmid8053970">{{cite journal |vauthors=Andoh K, Kimura T, Saeki I |title=General pharmacological properties of the human corticotropin-releasing hormone corticorelin (human) |journal=Arzneimittelforschung |volume=44 |issue=6 |pages=715–26 |date=June 1994 |pmid=8053970 |display-authors=etal}}</ref>


==Medical uses==
The corticorelin stimulation test helps to differentiate between the etiologies of [[ACTH]]-dependent [[hypercortisolism]]. It is used to evaluate the status of the [[pituitary-adrenal axis]] in the differentiation of a pituitary source from an ectopic source of excessive ACTH secretion.
The corticorelin stimulation test helps to differentiate between the causes for [[adrenocorticotropic hormone]] (ACTH)-dependent [[hypercortisolism]]. It is used to distinguish a [[pituitary]] source of excessive ACTH secretion from a different source.


* If corticorelin injection increases plasma levels of ACTH and cortisol, a diagnosis of [[Cushing's disease]] is achieved (ACTH of pituitary origin).
* If corticorelin injection increases plasma levels of ACTH and [[cortisol]], a diagnosis of [[Cushing's disease]] is achieved (ACTH of pituitary origin).
* If corticorelin injection leads to little or no response in plasma levels of ACTH or cortisol, a diagnosis of [[Ectopic ACTH syndrome]] is confirmed.
* If corticorelin injection leads to little or no response in plasma levels of ACTH or cortisol, a diagnosis of [[ectopic ACTH syndrome]] is confirmed.

==Side effects==
The most common side effects (in 1% to 10% of patients) are transient [[dysosmia]] and [[dysgeusia]] (distortion of the sense of smell and taste), as well as a sensation of warmth. About 0.1 to 1% of patients experience [[hypersensitivity]], [[hypotension]] (lowering of blood pressure), [[tachycardia]] (increased heart rate), [[flush (physiology)|flush]], [[dyspnoea]] (breathing difficulties), a cold sensation in the throat, the urge to urinate, and dizziness. [[Pituitary apoplexy]] has been reported in patients with [[pituitary tumour]]s.<ref name="AC" />

==Interactions==
The effects of corticorelin are reduced by [[corticosteroid]]s, [[antihistamine]]s, [[antiserotonergic]]s and [[oxytocin]]. They are amplified by [[vasopressin]] and [[Vasopressin analogue|its analogues]].<ref name="AC">{{cite book|title=Austria-Codex|publisher=Österreichischer Apothekerverlag|location=Vienna|year=2018|language=de}}</ref>


==See also==
==See also==
* [[ACTH stimulation test]]
* [[ACTH stimulation test]]
* [[Dexamethasone suppression test]]
* [[Metyrapone]]
* [[Pituitary-adrenal axis]]
* [[Tetracosactide]]


==References==
==References==
{{reflist}}
{{Reflist}}

{{pharm-stub}}


{{Diagnostic agents}}
{{Diagnostic agents}}


[[Category:Corticotropin-releasing hormone]]
[[Category:Corticotropin-releasing hormone receptor agonists]]
[[Category:Peptides]]
[[Category:Peptides]]
[[Category:World Anti-Doping Agency prohibited substances]]