Diprophylline: Difference between revisions

| verifiedrevid = 411566250

| IUPAC_name = 7-(2,3-dihydroxypropyl)-1,3-dimethyl-3,7-dihydro-1''H''-purine-2,6-dione

| image = Dyphylline.png

| InChI = 1/C10H14N4O4/c1-12-8-7(9(17)13(2)10(12)18)14(5-11-8)3-6(16)4-15/h5-6,15-16H,3-4H2,1-2H3

| InChIKey = KSCFJBIXMNOVSH-UHFFFAOYAI

| CASNo_Ref = {{cascite|correct|CAS}}

| CAS_number = 479-18-5

| ATC_prefix = none

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 1752

| ATC_suffix =

| ChEBI = 4728

| PubChem = 3182

| DrugBank = DB00651

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 3070

| C = 10 | H = 14 | N = 4 | O = 4

| molecular_weight = 254.24 g/mol

| smiles = O=C2N(c1ncn(c1C(=O)N2C)CC(O)CO)C

| synonyms = 7-(2,3-dihydroxy-propyl)theophylline

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| pregnancy_category =

| legal_status =

| routes_of_administration =

'''Dyphylline''' ('''Dilor''', '''Lufyllin'''), also known as '''diprophylline''', is a [[xanthine]] [[chemical derivative|derivative]] with [[bronchodilator]] and [[vasodilator]] effects. It is used in the treatment of [[respiratory disorder]]s like [[asthma]], [[cardiac dyspnea]], and [[bronchitis]]. It acts as an [[adenosine receptor]] [[receptor antagonist|antagonist]] and [[phosphodiesterase inhibitor]].<ref name="pmid2997628">{{cite journal | author = Schwabe U, Ukena D, Lohse MJ | title = Xanthine derivatives as antagonists at A1 and A2 adenosine receptors | journal = Naunyn-Schmiedeberg's Archives of Pharmacology | volume = 330 | issue = 3 | pages = 212–21 | year = 1985 | month = September | pmid = 2997628 | doi = | url = }}</ref><ref name="pmid225216">{{cite journal | author = Iancu L, Shneur A, Cohen H | title = Trials with xanthine derivatives in systemic treatment of psoriasis | journal = Dermatologica | volume = 159 | issue = 1 | pages = 55–61 | year = 1979 | pmid = 225216 | doi = | url = }}</ref>

{{Stimulants}}

[[Category:Diols]]

[[pl:Diprofilina]]

[[zh:二羟丙茶碱]]