Disodium citrate: Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
 {{Chembox
+| Verifiedfields = changed
-| verifiedrevid = 399910573
+| Watchedfields  = changed
-|  ImageFile = Disodium citrate.png
+| ImageFile      = Disodium citrate.png
-|  IUPACName = disodium hydrogen 2-hydroxypropane-1,2,3-tricarboxylate
+| ImageSize      = 220px
-|  OtherNames = Citrato ácido de sódio
+| verifiedrevid  = 445304286
-|  Section1 = {{Chembox Identifiers
+| IUPACName      = Disodium 3-carboxy-3-hydroxypentanedioate<ref>https://pubchem.ncbi.nlm.nih.gov/compound/8950#section=IUPAC-Name&fullscreen=true</ref>
-|    ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
+| OtherNames     =
-| ChemSpiderID = 10701794
+| Section1       = {{Chembox Identifiers
-| InChI = 1/C6H8O7.2Na/c7-3(8)1-6(13,5(11)12)2-4(9)10;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;/q;2*+1/p-3
+|    ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
-| InChIKey = CEYULKASIQJZGP-DFZHHIFOAJ
+| PubChem = 8950
-| SMILES = [Na+].[Na+].O=C([O-])CC(O)(CC(=O)[O-])C([O-])=O
+| ChemSpiderID = 8606
-| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
+| EINECS = 205-623-3
-| StdInChI = 1S/C6H8O7.2Na/c7-3(8)1-6(13,5(11)12)2-4(9)10;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;/q;2*+1/p-3
+| RTECS = GE7580000
-| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
+| InChI = 1S/C6H8O7.2Na/c7-3(8)1-6(13,5(11)12)2-4(9)10;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;/q;2*+1/p-2
-| StdInChIKey = CEYULKASIQJZGP-UHFFFAOYSA-K
+| InChIKey = CEYULKASIQJZGP-UHFFFAOYSA-L
+| SMILES = C(C(=O)[O-])C(CC(=O)[O-])(C(=O)O)O.[Na+].[Na+]
+| CASNo_Ref = {{cascite|correct|??}}
 | CASNo = 144-33-2
+| UNII_Ref = {{fdacite|correct|FDA}}
+| UNII = 6FO62KCQ7A
   }}
-|  Section2 = {{Chembox Properties
+| Section2       = {{Chembox Properties
-|    C = 6 | H = 6 | O = 7 | Na = 2
+| C = 6 | H = 6 | O = 7 | Na = 2
+| Appearance = white crystalline powder
+| MeltingPtC = 149
+  }}
+| Section7       = {{Chembox Hazards
+| NFPA-H = 0
+| NFPA-F = 1
+| NFPA-R = 0
   }}
 }}
+'''Disodium citrate''', also known as disodium hydrogen citrate,    (Neo-Alkacitron) and sesquihydrate, is an [[acid salt]] of [[citric acid]] with the chemical formula {{chem2|Na2C6H6O7}}.<ref>{{Cite web |last=PubChem |title=Disodium citrate |url=https://pubchem.ncbi.nlm.nih.gov/compound/8950 |access-date=2022-08-30 |website=pubchem.ncbi.nlm.nih.gov |language=en}}</ref> It is used as an [[antioxidant]] in food and to improve the effects of other antioxidants. It is also used as an [[acidity regulator]] and [[sequestrant]]. Typical products include [[gelatin]], jam, sweets, [[ice cream]], [[Carbonation|carbonated beverages]], [[milk powder]], [[wine]], and [[processed cheese]]s.
-'''Disodium citrate''', or disodium hydrogen citrate, is a [[sodium]] [[acid salt]] of [[citric acid]] ([[sodium citrate]]) with the chemical formula Na<sub>2</sub>HC<sub>6</sub>H<sub>5</sub>O<sub>7</sub>, or
-Na<sub>2</sub>H(C<sub>3</sub>H<sub>5</sub>O(COO)<sub>3</sub>). It is used as an [[antioxidant]] in food as well as to improve the effects of other antioxidants. It is also used as an [[acidity regulator]] and [[sequestrant]].
+== Uses ==
-Typical products include [[gelatin]], jam, sweets, [[ice cream]], [[Carbonation|carbonated beverages]], [[milk powder]], [[wine]], and [[processed cheese]]s.
-==As Medicine==
+=== Food ===
+It is used as an [[antioxidant]] in food and to improve the effects of other antioxidants.<ref name="drugsupdate">{{cite web | url = http://www.drugsupdate.com/brand/generic/Disodium%20Hydrogen%20Citrate/36902 | title = Alkarate from Macleods: Disodium Hydrogen Citrate | publisher = drugsupdate.com | access-date = 2013-04-20 | archive-date = 2020-07-25 | archive-url = https://web.archive.org/web/20200725080700/https://www.drugsupdate.com/brand/generic/Disodium%20Hydrogen%20Citrate/36902 | url-status = dead }}</ref> It is also used as an [[acidity regulator]] and [[sequestrant]].<ref name="drugsupdate" /> Typical products include [[gelatin]], jam, sweets, [[ice cream]], [[Carbonation|carbonated beverages]], [[milk powder]], [[wine]], and [[processed cheese]]s. Disodium citrate can also be used as a thickening agent or stabilizer.<ref>{{Cite web |last=PubChem |title=Disodium citrate |url=https://pubchem.ncbi.nlm.nih.gov/compound/8950 |access-date=2022-08-30 |website=pubchem.ncbi.nlm.nih.gov |language=en}}</ref>
-May be prescribed to patients, to alleviate discomfort, suffering from Urinary tract Infection.
+=== Manufacturing ===
-==References==
+Disodium citrate can also be used as an ingredient in household products that remove stains.<ref>{{Cite web |last=PubChem |title=Disodium citrate |url=https://pubchem.ncbi.nlm.nih.gov/compound/8950 |access-date=2022-09-19 |website=pubchem.ncbi.nlm.nih.gov |language=en}}</ref>
-{{Unreferenced|date=November 2006}}
+=== Health ===
-{{DEFAULTSORT:Disodium Citrate}}
+Disodium citrate may be used in patients to alleviate discomfort from urinary-tract infections.<ref>{{cite web | url = https://glowpink.com/blog/cital-syrup/ | title = OTC Treatment | access-date = 2016-04-19 | archive-date = 2018-07-28 | archive-url = https://web.archive.org/web/20180728002859/https://glowpink.com/blog/cital-syrup/ | url-status = dead }}</ref><ref>{{Cite web |title=Disodium Hydrogen Citrate Syrup |url=https://labeling.pfizer.com/ShowLabeling.aspx?id=14817 |access-date=2022-09-26 |website=labeling.pfizer.com}}</ref>
-[[Category:Citrates]]
+==References==
+{{reflist}}{{DEFAULTSORT:Disodium Citrate}}
-[[pt:Citrato dissódico]]
+[[Category:Citrates]]
+[[Category:Organic sodium salts]]
+[[Category:Acid salts]]
+[[Category:E-number additives]]