EHNA: Difference between revisions
Appearance
Content deleted Content added
No edit summary |
Entranced98 (talk | contribs) Importing Wikidata short description: "Chemical compound" |
||
(21 intermediate revisions by 17 users not shown) | |||
Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{ |
{{Technical|date=March 2021}} |
||
{{drugbox | |
|||
{{Infobox drug |
|||
⚫ | |||
| verifiedrevid = 403603363 |
|||
⚫ | |||
| image = EHNA.svg |
| image = EHNA.svg |
||
| width = 180 |
| width = 180 |
||
<!--Clinical data--> |
|||
| tradename = |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
<!--Pharmacokinetic data--> |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
<!--Identifiers--> |
|||
| CAS_number = 59262-86-1 |
| CAS_number = 59262-86-1 |
||
| ATC_prefix = |
| ATC_prefix = |
||
| ATC_suffix = |
| ATC_suffix = |
||
| PubChem = |
| PubChem = 3206 |
||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|||
| DrugBank = |
|||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
||
| ChEMBL = 50378 |
| ChEMBL = 50378 |
||
| |
| ChemSpiderID = 3094 |
||
⚫ | |||
<!--Chemical data--> |
|||
| molecular_weight = 313.826 g/mol |
|||
⚫ | |||
⚫ | |||
| smiles = CCCCCCC(C(C)O)n1cnc2c1ncnc2N |
|||
⚫ | |||
| StdInChI=1S/C14H23N5O/c1-3-4-5-6-7-11(10(2)20)19-9-18-12-13(15)16-8-17-14(12)19/h8-11,20H,3-7H2,1-2H3,(H2,15,16,17) |
|||
⚫ | |||
| StdInChIKey = IOSAAWHGJUZBOG-UHFFFAOYSA-N |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
}} |
}} |
||
⚫ | '''EHNA''' ('''e'''rythro-9-(2-'''h'''ydroxy-3-'''n'''only)'''a'''denine) is a [[ |
||
⚫ | '''EHNA''' ('''e'''rythro-9-(2-'''h'''ydroxy-3-'''n'''only)'''a'''denine) is a potent [[adenosine deaminase]] inhibitor,<ref>{{cite web|title=Sigma Aldrich|url=http://www.sigmaaldrich.com/catalog/product/sigma/e114?lang=en®ion=US|access-date=16 January 2013}}</ref> which also acts as a [[phosphodiesterase inhibitor]] that selectively inhibits [[Phosphodiesterase 2|phosphodiesterase type 2]] (PDE2).<ref>{{cite journal | vauthors = Podzuweit T, Nennstiel P, Müller A | title = Isozyme selective inhibition of cGMP-stimulated cyclic nucleotide phosphodiesterases by erythro-9-(2-hydroxy-3-nonyl) adenine | journal = Cellular Signalling | volume = 7 | issue = 7 | pages = 733–8 | date = September 1995 | pmid = 8519602 | doi = 10.1016/0898-6568(95)00042-N }}</ref><ref>{{cite journal | vauthors = Méry PF, Pavoine C, Pecker F, Fischmeister R | title = Erythro-9-(2-hydroxy-3-nonyl)adenine inhibits cyclic GMP-stimulated phosphodiesterase in isolated cardiac myocytes | journal = Molecular Pharmacology | volume = 48 | issue = 1 | pages = 121–30 | date = July 1995 | pmid = 7623766 }}</ref> |
||
⚫ | |||
<references/> |
|||
⚫ | |||
{{reflist}} |
|||
{{Phosphodiesterase inhibitors}} |
{{Phosphodiesterase inhibitors}} |
||
Line 37: | Line 53: | ||
[[Category:PDE2 inhibitors]] |
[[Category:PDE2 inhibitors]] |
||
[[Category:Purines]] |
[[Category:Purines]] |
||
[[Category: |
[[Category:Secondary alcohols]] |
||