Elenolic acid: Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
 {{chembox
+| Verifiedfields = changed
-| verifiedrevid = 399915691
+| Watchedfields = changed
+| verifiedrevid = 444651676
 |   Name = Elenolic acid
 |   ImageFile = Elenolic acid structure.png
 | ImageSize = 200px
 |   ImageName = Elenolic acid
-|   IUPACName = 2-[(2''S'',3''S'',4''S'')-3-formyl-5-methoxycarbonyl-2-methyl-3, 4-dihydro-2H-pyran-4-yl]acetic acid
+|   PIN = [(2''S'',3''S'',4''S'')-3-Formyl-5-(methoxycarbonyl)-2-methyl-3,4-dihydro-2''H''-pyran-4-yl]acetic acid
 | Section1 = {{Chembox Identifiers
 |   ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
@@ Line 16: / Line 18: @@
 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
 | StdInChIKey = MQFAJBBHEYTHKF-BIIVOSGPSA-N
+| CASNo_Ref = {{cascite|correct|CAS}}
-| CASNo =
+| CASNo = 34422-12-3
+| UNII = 5C9M8PFI8E
+| UNII_Ref = {{fdacite|correct|FDA}}
 |   PubChem  = 169607
 |   SMILES = CC1C(C(C(=CO1)C(=O)OC)CC(=O)O)C=O
@@ Line 22: / Line 27: @@
 | Section2 = {{Chembox Properties
 |   C=11|H=14|O=6
-|   Density =
+|   Density = 1.308 g/mL
 |   MeltingPt =
-|   BoilingPt =
+|   BoilingPtC = 408.9
   }}
 }}
-'''Elenolic acid''' is a component of [[olive oil]] and [[olive leaf extract]].  It can be considered as a marker for maturation of olives.<ref>{{cite journal | last1 = Esti | first1 = M | last2 = Cinquanta | first2 = L | last3 = La Notte | first3 = E | title = Phenolic Compounds in Different Olive Varieties | journal = Journal of agricultural and food chemistry | volume = 46 | issue = 1 | pages = 32–35 | year = 1998 | pmid = 10554192 | doi=10.1021/jf970391+}}</ref>
+'''Elenolic acid''' is a component of [[olive oil]], olive infusion and [[olive leaf extract]].  It can be considered as a marker for maturation of olives.<ref>{{cite journal | last1 = Esti | first1 = M | last2 = Cinquanta | first2 = L | last3 = La Notte | first3 = E | title = Phenolic Compounds in Different Olive Varieties | journal = Journal of Agricultural and Food Chemistry | volume = 46 | issue = 1 | pages = 32–35 | year = 1998 | pmid = 10554192 | doi=10.1021/jf970391+}}</ref>
+[[Oleuropein]], a chemical compound found in olive leaf from the olive tree, together with other closely related compounds such as [[10-hydroxyoleuropein]], [[ligstroside]] and [[10-hydroxyligstroside]], are [[tyrosol]] [[ester]]s of elenolic acid.
 == References ==
@@ Line 38: / Line 45: @@
 [[Category:Dihydropyrans]]
 [[Category:Methyl esters]]
+[[Category:Olive oil]]
+[[Category:Olives]]
-[[it:Acido elenolico]]
+[[Category:Aldehydic acids]]
-[[ja:エレノール酸]]
+[[Category:Enones]]