Heptabarb: Difference between revisions

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 443853293

| IUPAC_name = 5-cyclohept-1-en-1-yl-5-ethylpyrimidine-2,4,6(1''H'',3''H'',5''H'')-trione

| image = Heptabarbital structure.svg

| width = 135

<!--Clinical data-->

| tradename =

| pregnancy_category =

| legal_status =

| legal_CA = Schedule IV

| routes_of_administration = Oral<ref name="pmid9299">{{cite journal |vauthors=Breimer DD, de Boer AG | title = Pharmacokinetics and relative bioavailability of heptabarbital and heptabarbital sodium after oral administration to man | journal = European Journal of Clinical Pharmacology | volume = 9 | issue = 2–3 | pages = 169–78 |date=December 1975 | pmid = 9299 | doi = 10.1007/bf00614014| s2cid = 32380531 }}</ref>

<!--Pharmacokinetic data-->

| bioavailability = 83%<ref name="pmid9299" />

| metabolism = [[Hepatic]]

| elimination_half-life = 6.1-11.2 hours<ref name="pmid9299" />

| excretion = [[Renal]]<ref name="pmid9299" />

<!--Identifiers-->

| CAS_number = 509-86-4

| ATC_prefix = N05

| ATC_suffix = CA11

| PubChem = 10518

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB01354

| synonyms = G-475

<!--Chemical data-->

| C=13 | H=18 | N=2 | O=3

| smiles = O=C1NC(=O)NC(=O)C1(/C2=C/CCCCC2)CC

'''Heptabarb''' ([[International Nonproprietary Name|INN]]; '''Eudan''', '''Medapan''', '''Medomin''', '''Noctyn'''), also known as '''heptabarbitone''' ([[British Approved Name|BAN]]) or '''heptabarbital''', is a [[sedative]] and [[hypnotic]] [[drug]] of the [[barbiturate]] family.<ref name="GanellinTriggle1997">{{cite book | vauthors = Ganellin CR, Triggle DJ, Macdonald F | title = Dictionary of pharmacological agents | url = https://books.google.com/books?id=A0THacd46ZsC&pg=PA1003 | access-date = 26 November 2011 | year = 1997 | publisher = CRC Press | isbn = 978-0-412-46630-4 | page = 1003}}</ref><ref name="Index nominum 2000: international drug directory">{{cite book | title = Index nominum 2000: international drug directory | url = https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA513 | access-date = 26 November 2011 | year = 2000 | publisher = Taylor & Francis US | isbn = 978-3-88763-075-1 | page = 513}}</ref> It was used in [[Europe]] for the treatment of [[insomnia]] from the 1950s onwards, but has since been discontinued.<ref name="GanellinTriggle1997" /><ref name="Index nominum 2000: international drug directory" />

== See also ==

* [[Barbiturate]]

== References ==

{{Reflist}}

{{Hypnotics and sedatives}}

{{GABAAR PAMs}}

[[Category:Barbiturates]]

[[Category:Hypnotics]]

[[Category:Pyrimidines]]

[[Category:Sedatives]]

[[Category:Cycloalkenes]]

{{sedative-stub}}