MEDA: Difference between revisions
Content deleted Content added
Updating {{chembox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:W |
Ira Leviton (talk | contribs) m Clean up duplicate template arguments using findargdups |
||
| (19 intermediate revisions by 18 users not shown) | |||
| Line 1: | Line 1: | ||
{{About|the psychedelic drug|the instrument on the Perseverance rover|Mars Environmental Dynamics Analyzer}} |
|||
{{one source|date=July 2019}} |
|||
{{chembox |
{{chembox |
||
| Verifiedfields = changed |
|||
| ⚫ | |||
| Watchedfields = changed |
|||
| ⚫ | |||
| ImageFile = MEDA.png |
| ImageFile = MEDA.png |
||
| ImageSize = 200px |
| ImageSize = 200px |
||
| |
| PIN = 1-(8-Methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)propan-2-amine |
||
| OtherNames = |
| OtherNames = |
||
| |
|Section1={{Chembox Identifiers |
||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 24034 |
| ChemSpiderID = 24034 |
||
| KEGG_Ref = {{keggcite|correct|kegg}} |
| KEGG_Ref = {{keggcite|correct|kegg}} |
||
| KEGG = D03376 |
| KEGG = D03376 |
||
| InChI |
| InChI=1S/C12H17NO3/c1-8(13)5-9-6-10(14-2)12-11(7-9)15-3-4-16-12/h6-8H,3-5,13H2,1-2H3 |
||
| InChIKey = |
| InChIKey = HEYPARQBPGSFKW-UHFFFAOYSA-N |
||
| StdInChI_Ref = {{stdinchicite| |
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
||
| StdInChI = 1S/ |
| StdInChI = 1S/C12H17NO3/c1-8(13)5-9-6-10(14-2)12-11(7-9)15-3-4-16-12/h6-8H,3-5,13H2,1-2H3 |
||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChIKey = NRVFDGZJTPCULU-UHFFFAOYSA-N |
| StdInChIKey = NRVFDGZJTPCULU-UHFFFAOYSA-N |
||
| CASNo_Ref = {{cascite|correct|??}} |
|||
| CASNo = 23693-25-6 |
| CASNo = 23693-25-6 |
||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| UNII = T2DAA4TB22 |
|||
| PubChem = 25798 |
| PubChem = 25798 |
||
| SMILES = |
| SMILES = NC(CC1=CC2=C(OCCO2)C(OC)=C1)C |
||
}} |
}} |
||
| |
|Section2={{Chembox Properties |
||
| C=12 |
|||
| Formula = C<sub>12</sub>H<sub>17</sub>NO<sub>3</sub> |
|||
| H=17 |
|||
| MolarMass = 223.268 g/mol |
|||
| N=1 |
|||
| O=3 |
|||
| Appearance = |
| Appearance = |
||
| Density = |
| Density = |
||
| Line 28: | Line 37: | ||
| BoilingPt = |
| BoilingPt = |
||
| Solubility = }} |
| Solubility = }} |
||
| |
|Section3={{Chembox Hazards |
||
| MainHazards = |
| MainHazards = |
||
| FlashPt = |
| FlashPt = |
||
| |
| AutoignitionPt = }} |
||
}} |
}} |
||
'''MEDA''' |
'''MEDA''' ('''3-methoxy-4,5-ethylenedioxyamphetamine''') is a lesser-known [[Psychedelics, dissociatives and deliriants|psychedelic drug]]. MEDA was first synthesized by [[Alexander Shulgin]]. In his book ''[[PiHKAL]]'', the minimum dosage is listed as 200 mg, and the duration unknown.<ref>[http://www.erowid.org/library/books_online/pihkal/pihkal120.shtml MEDA entry in ''PiHKAL'']</ref> MEDA produces few to no effects. Very little data exists about the pharmacological properties, metabolism, and toxicity of MEDA. |
||
== See also == |
== See also == |
||
| Line 41: | Line 50: | ||
* [[Psychedelics, dissociatives and deliriants]] |
* [[Psychedelics, dissociatives and deliriants]] |
||
== |
== References == |
||
{{reflist}} |
|||
* [http://www.erowid.org/library/books_online/pihkal/pihkal120.shtml MEDA entry in ''PiHKAL''] |
|||
* [http://pihkal.info/read.php?domain=pk&id=120 MEDAentry in PiHKAL • info] |
|||
[[Category:Substituted amphetamines]] |
|||
{{PiHKAL}} |
|||
[[Category:Amphetamines]] |
|||
{{Psychoactive-stub}} |
{{Psychoactive-stub}} |
||