Magnesium orotate: Difference between revisions
Content deleted Content added
Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[WP:CHEMVALID|Chem/Drugbox validation |
Entranced98 (talk | contribs) Importing Wikidata short description: "Chemical compound" |
||
| (24 intermediate revisions by 21 users not shown) | |||
| Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{Drugbox |
{{Drugbox |
||
| Watchedfields = changed |
|||
| verifiedrevid = |
| verifiedrevid = 447933425 |
||
| IUPAC_name = magnesium 2,6-dioxo-3H-pyrimidine-4-carboxylate |
| IUPAC_name = magnesium 2,6-dioxo-3H-pyrimidine-4-carboxylate |
||
| image = magnesium orotate.png |
| image = magnesium orotate.png |
||
| Line 15: | Line 17: | ||
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
||
| legal_status = |
| legal_status = |
||
| routes_of_administration = |
| routes_of_administration = |
||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
| Line 22: | Line 24: | ||
| metabolism = |
| metabolism = |
||
| elimination_half-life = |
| elimination_half-life = |
||
| excretion = |
| excretion = |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CAS_number_Ref = {{cascite|correct|CAS}} |
|||
| CAS_number = |
| CAS_number = 34717-03-8 |
||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| UNII = GI96W46M5A |
|||
| ATC_prefix = A12 |
| ATC_prefix = A12 |
||
| ATC_suffix = CC09 |
| ATC_suffix = CC09 |
||
| PubChem = 3036905 |
| PubChem = 3036905 |
||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| DrugBank = |
| DrugBank = |
||
| ChemSpiderID = 2300801 |
|||
<!--Chemical data--> |
<!--Chemical data--> |
||
| C=10 | H=6 | Mg=1 | N=4 | O=8 |
|||
| chemical_formula = C<sub>10</sub>H<sub>6</sub>MgN<sub>4</sub>O<sub>8</sub> |
|||
| smiles = [Mg+2].O=C([O-])\C1=C\C(=O)NC(=O)N1.[O-]C(=O)\C1=C\C(=O)NC(=O)N1 |
|||
| StdInChI = 1S/2C5H4N2O4.Mg/c2*8-3-1-2(4(9)10)6-5(11)7-3;/h2*1H,(H,9,10)(H2,6,7,8,11);/q;;+2/p-2 |
|||
| molecular_weight = 334.482 g/mol |
|||
| StdInChIKey = QWLHYYKDLOVBNV-UHFFFAOYSA-L |
|||
}} |
}} |
||
'''Magnesium orotate''', the [[magnesium]] [[salt (chemistry)|salt]] of [[orotic acid]], is a [[Dietary mineral|mineral supplement]]. |
'''Magnesium orotate''', the [[magnesium]] [[salt (chemistry)|salt]] of [[orotic acid]], is a [[Dietary mineral|mineral supplement]]. It can be used in treating extracellular [[Magnesium deficiency (medicine)|magnesium deficiency]], as well as in mitigating magnesium depletion that inhibits the binding of [[adenosine triphosphate]] via orotic acid, which provides binding sites.<ref>{{cite journal | vauthors = Classen HG | title = Magnesium orotate--experimental and clinical evidence | journal = Romanian Journal of Internal Medicine | volume = 42 | issue = 3 | pages = 491–501 | date = 2004 | pmid = 16366126 }}</ref> |
||
== References == |
|||
{{reflist}} |
|||
{{Mineral supplements}} |
{{Mineral supplements}} |
||
| Line 46: | Line 56: | ||
{{gastrointestinal-drug-stub}} |
{{gastrointestinal-drug-stub}} |
||
[[es:Oroato de magnesio]] |
|||