Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Masoprocol: Difference between pages
Appearance
(Difference between pages)
Content deleted Content added
Saving copy of the {{drugbox}} taken from revid 456542026 of page Masoprocol for the Chem/Drugbox validation project (updated: 'DrugBank', 'ChEMBL'). |
expanded a little bit |
||
Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:Masoprocol|oldid=456542026}} 456542026] of page [[Masoprocol]] with values updated to verified values.}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
| Verifiedfields = changed |
||
| verifiedrevid = |
| verifiedrevid = 462100402 |
||
| IUPAC_name = 4-[(2''R'',3''S'')-4-(3,4-dihydroxyphenyl)-2,3-dimethylbutyl]benzene-1,2-diol |
| IUPAC_name = 4-[(2''R'',3''S'')-4-(3,4-dihydroxyphenyl)-2,3-dimethylbutyl]benzene-1,2-diol |
||
| image = Masoprocol.svg |
| image = Masoprocol.svg |
||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = |
| tradename = Actinex |
||
| Drugs.com = {{drugs.com|CONS|masoprocol}} |
| Drugs.com = {{drugs.com|CONS|masoprocol}} |
||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
||
Line 17: | Line 16: | ||
| legal_status = |
| legal_status = |
||
| routes_of_administration = [[Topical]] |
| routes_of_administration = [[Topical]] |
||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
| bioavailability = Very low |
| bioavailability = Very low |
||
Line 24: | Line 22: | ||
| elimination_half-life = |
| elimination_half-life = |
||
| excretion = |
| excretion = |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CASNo_Ref = {{cascite|correct|CAS}} |
|||
| CAS_number_Ref = {{cascite|correct|??}} |
| CAS_number_Ref = {{cascite|correct|??}} |
||
| CAS_number = |
| CAS_number = 27686-84-6 |
||
| ATC_prefix = L01 |
| ATC_prefix = L01 |
||
| ATC_suffix = XX10 |
| ATC_suffix = XX10 |
||
| ATC_supplemental = |
| ATC_supplemental = |
||
| PubChem = 71398 |
| PubChem = 71398 |
||
| IUPHAR_ligand = 4265 |
|||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| DrugBank = DB00179 |
| DrugBank = DB00179 |
||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 64490 |
| ChemSpiderID = 64490 |
||
| UNII_Ref = {{fdacite| |
| UNII_Ref = {{fdacite|correct|FDA}} |
||
| UNII = 7BO8G1BYQU |
| UNII = 7BO8G1BYQU |
||
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|||
| ChEBI = 73468 |
|||
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
||
| ChEMBL = |
| ChEMBL = 313972 |
||
<!--Chemical data--> |
|||
| C=18 | H=22 | O=4 |
| C=18 | H=22 | O=4 |
||
| molecular_weight = 302.365 g/mol |
|||
| smiles = Oc1ccc(cc1O)C[C@H](C)[C@H](C)Cc2ccc(O)c(O)c2 |
| smiles = Oc1ccc(cc1O)C[C@H](C)[C@H](C)Cc2ccc(O)c(O)c2 |
||
| InChI = 1/C18H22O4/c1-11(7-13-3-5-15(19)17(21)9-13)12(2)8-14-4-6-16(20)18(22)10-14/h3-6,9-12,19-22H,7-8H2,1-2H3/t11-,12+ |
|||
| InChIKey = HCZKYJDFEPMADG-TXEJJXNPBW |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C18H22O4/c1-11(7-13-3-5-15(19)17(21)9-13)12(2)8-14-4-6-16(20)18(22)10-14/h3-6,9-12,19-22H,7-8H2,1-2H3/t11-,12+ |
| StdInChI = 1S/C18H22O4/c1-11(7-13-3-5-15(19)17(21)9-13)12(2)8-14-4-6-16(20)18(22)10-14/h3-6,9-12,19-22H,7-8H2,1-2H3/t11-,12+ |
||
Line 51: | Line 48: | ||
| StdInChIKey = HCZKYJDFEPMADG-TXEJJXNPSA-N |
| StdInChIKey = HCZKYJDFEPMADG-TXEJJXNPSA-N |
||
}} |
}} |
||
'''Masoprocol''' is an [[antineoplastic]] drug used to treat skin growths caused by sun exposure. It is the '''[[Meso compound|meso]]''' form of [[nordihydroguaiaretic acid]] that is taken by mouth. The substance is being studied in the treatment of prostate cancer. |
|||
Masoprocol is also called NDGA, and Actinex. |
|||
==Mechanism== |
|||
Nordihydroguaiaretic acid is an antioxidant, and it may block certain enzymes needed for tumor growth. |
|||
It is a [[lipoxygenase inhibitor]].<ref>{{cite journal | vauthors = Gowri MS, Azhar RK, Kraemer FB, Reaven GM, Azhar S | title = Masoprocol decreases rat lipolytic activity by decreasing the phosphorylation of HSL | journal = American Journal of Physiology. Endocrinology and Metabolism | volume = 279 | issue = 3 | pages = E593-600 | date = September 2000 | pmid = 10950827 | doi = 10.1152/ajpendo.2000.279.3.E593 | doi-access = free }}</ref> |
|||
== References == |
|||
{{reflist}} |
|||
== External links == |
|||
* [https://www.nlm.nih.gov/medlineplus/druginfo/medmaster/a601075.html MedlinePlus Drug Information] |
|||
* [http://www.cancer.gov/dictionary?CdrID=523330 Actinex] entry in the public domain NCI Cancer Dictionary |
|||
{{Chemotherapeutic agents}} |
|||
[[Category:Antineoplastic drugs]] |
|||
[[Category:Catechols]] |
|||
{{antineoplastic-drug-stub}} |