Miroprofen: Difference between revisions

(21 intermediate revisions by 15 users not shown)

Line 1:

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = ~~447386370~~

| verifiedrevid = 449584845

| IUPAC_name = (''RS'')-2-(4-imidazo[1,2-''a'']pyridin-2-ylphenyl)propanoic acid

| image = Miroprofen.svg

| width = 250px

| ~~imagename~~ = ~~1 : 1~~ mixture ~~(racemate)~~

| chirality = [[Racemic mixture]]

| drug_name = Miroprofen

| tradename =

Line 28:

Line 27:

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 55843-86-2

| ATC_prefix = none

Line 33:

| PubChem = 68752

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 76249

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 61997

Line 41:

Line 43:

| C=16 | H=14 | N=2 | O=2

| molecular_weight = 266.295 g/mol

| smiles = O=C(O)C(c3ccc(c1nc2ccccn2c1)cc3)C

| InChI = 1/C16H14N2O2/c1-11(16(19)20)12-5-7-13(8-6-12)14-10-18-9-3-2-4-15(18)17-14/h2-11H,1H3,(H,19,20)

| InChIKey = OJGQFYYLKNCIJD-UHFFFAOYAN

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C16H14N2O2/c1-11(16(19)20)12-5-7-13(8-6-12)14-10-18-9-3-2-4-15(18)17-14/h2-11H,1H3,(H,19,20)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = OJGQFYYLKNCIJD-UHFFFAOYSA-N

| synonyms = <small>2-[4-(1,7-diazabicyclo[4.3.0]nona-2,4,6,8-tetraen-8-yl)phenyl]propanoic acid</small>

| synonyms = Antopen; BRN 0888858; NSC 261037; Ro 07-0582; Y 9213; <small>2-[4-(1,7-diazabicyclo[4.3.0]nona-2,4,6,8-tetraen-8-yl)phenyl]propanoic acid</small>

}}

'''Miroprofen''' ([[International Nonproprietary Name|INN]]) is an [[analgesic]] and [[Non-steroidal anti-inflammatory drug|NSAID]], meaning that it has [[anti-inflammatory]], [[antipyretic]] and [[Antiplatelet drug|antiplatelet aggregation]] activity. Chemically it is a [[carboxylic acid]] belonging to the group of [[phenylpropanoic acid]]s.<ref name="Mikashima-1982">{{cite journal | vauthors = Mikashima H, Goto K | title = [Inhibitory effect of 2-(4-(2-imidazo(1,2-a)pyridyl)phenyl) propionic acid (miroprofen) on platelet aggregation and prostaglandin I2 generation (author's transl)] | journal = Yakugaku Zasshi | volume = 102 | issue = 1 | pages = 99–103 | date = January 1982 | pmid = 7045328 | doi = 10.1248/yakushi1947.102.1_99| doi-access = free }}</ref>

'''Miroprofen''' ([[International Nonproprietary Name|INN]]) is an [[analgesic]] and [[NSAID]]. It is a carbocyclic acid, a phenylpropionate.

== References ==

Synonyms are Antopen; BRN 0888858; Miroprofen; Miroprofene; Miroprofeno; Miroprofenum; NSC 261037; Ro 07-0582; Y 9213.

[[Category:~~Non-steroidal~~ anti-inflammatory drugs]]

[[Category:Nonsteroidal anti-inflammatory drugs]]

[[Category:Imidazopyridines]]

[[bs:Miroprofen]]