Nabitan: Difference between revisions
Appearance
Content deleted Content added
حسن علي البط (talk | contribs) removed Category:Carboxylate esters; added Category:Butyrates using HotCat |
Changing short description from "Chemical compound" to "Synthetic cannabinoid" |
||
(37 intermediate revisions by 26 users not shown) | |||
Line 1: | Line 1: | ||
{{Short description|Synthetic cannabinoid}} |
|||
⚫ | |||
{{Drugbox |
|||
| |
|||
⚫ | |||
|IUPAC_name = (-)-8-(1,2-Dimethylheptyl)-1,3,4,5-tetrahydro-5,5-dimethyl-2-(2-propynyl) -2H-(1)benzopyrano(4,3-c)pyridin-10-yl 1-piperidinebutyrate |
|||
| IUPAC_name = 5,5-Dimethyl-8-(3-methyloctan-2-yl)-2-(prop-2-yn-1-yl)-1,3,4,5-tetrahydro-2''H''-[1]benzopyrano[4,3-''c'']pyridin-10-yl 4-(piperidin-1-yl)butanoate |
|||
| image = Nabitan.svg |
| image = Nabitan.svg |
||
| width= 180 |
| width = 180 |
||
<!--Clinical data--> |
|||
| tradename = |
|||
⚫ | |||
⚫ | |||
<!--Pharmacokinetic data--> |
|||
⚫ | |||
⚫ | |||
⚫ | |||
<!--Identifiers--> |
|||
| CAS_number_Ref = {{cascite|correct|??}} |
|||
⚫ | |||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| UNII = JO7BOR6B3O |
|||
⚫ | |||
⚫ | |||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 36117 |
| ChemSpiderID = 36117 |
||
| InChI = 1/C35H52N2O3/c1-7-9-11-15-26(3)27(4)28-23-31(39-33(38)16-14-21-36-19-12-10-13-20-36)34-29-25-37(18-8-2)22-17-30(29)35(5,6)40-32(34)24-28/h2,23-24,26-27H,7,9-22,25H2,1,3-6H3 |
|||
<!--Chemical data--> |
|||
| InChIKey = MCVPMHDADNVRKF-UHFFFAOYAU |
|||
⚫ | |||
| smiles = O=C(Oc2cc(cc1OC(C\3=C(/c12)CN(CC/3)CC#C)(C)C)C(C)C(C)CCCCC)CCCN4CCCCC4 |
| smiles = O=C(Oc2cc(cc1OC(C\3=C(/c12)CN(CC/3)CC#C)(C)C)C(C)C(C)CCCCC)CCCN4CCCCC4 |
||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
Line 13: | Line 33: | ||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChIKey = MCVPMHDADNVRKF-UHFFFAOYSA-N |
| StdInChIKey = MCVPMHDADNVRKF-UHFFFAOYSA-N |
||
⚫ | |||
⚫ | |||
| ATC_suffix= |
|||
⚫ | |||
| DrugBank= |
|||
⚫ | |||
| molecular_weight = 548.799 g/mol |
|||
| bioavailability= |
|||
⚫ | |||
⚫ | |||
⚫ | |||
| pregnancy_category = |
|||
⚫ | |||
⚫ | |||
}} |
}} |
||
⚫ | '''Nabitan''' ('''Nabutam''', '''Benzopyranoperidine''', '''SP-106''', '''Abbott 40656''') is a [[Chemical synthesis|synthetic]] [[cannabinoid]] [[Analog (chemistry)|analog]] of [[dronabinol]] (Marinol) and [[dimethylheptylpyran]].<ref>Razdan RK. The Total Synthesis of Cannabinoids. Wiley-Interscience 1980</ref> It exhibits [[antiemetic]] and [[analgesic]] effects, most likely by binding to and activating the CB<sub>1</sub> and CB<sub>2</sub> [[cannabinoid receptor]]s, and reduced [[intraocular pressure]] in animal tests, making it potentially useful in the treatment of [[glaucoma]].<ref>{{cite journal | vauthors = Razdan RK, Howes JF | title = Drugs related to tetrahydrocannabinol | journal = Medicinal Research Reviews | year = 1983 | volume = 3 | issue = 2 | pages = 119–46 | doi = 10.1002/med.2610030203 | pmid = 6134882 | s2cid = 31313909 }}</ref> |
||
⚫ | Nabitan has the advantage of being water-soluble, unlike most cannabinoid derivatives, and was researched for potential use as an analgesic or [[sedative]],<ref>{{cite journal | vauthors = Archer RA | title = The cannabinoids: therapeutic potentials | journal = Annual Reports in Medicinal Chemistry | year = 1974 | volume = 9 | pages = 253–9 | doi = 10.1016/s0065-7743(08)61448-7 | pmid = 12307093 }}</ref> although it was never developed for clinical use and is not currently used in medicine, as [[dronabinol]] or [[nabilone]] were felt to be more useful. However it is sometimes used in research into the potential therapeutic applications of cannabinoids. |
||
⚫ | '''Nabitan''' ('''Nabutam''', '''Benzopyranoperidine''', '''SP-106''', '''Abbott 40656''') is a [[Chemical synthesis|synthetic]] [[cannabinoid]] [[Analog (chemistry)|analog]] of [[dronabinol]] (Marinol).<ref> |
||
== See also == |
|||
⚫ | Nabitan has the advantage of being water |
||
* [[A-40174]] (SP-1) |
|||
* [[A-41988]] |
|||
⚫ | |||
* [[Dimethylheptylpyran]] |
|||
* [[Menabitan]] |
|||
== References == |
== References == |
||
{{Reflist}} |
|||
<references /> |
|||
[[de:Nabitan]] |
|||
{{Cannabinoids}} |
{{Cannabinoids}} |
||
{{Hallucinogens}} |
|||
{{Cannabinoidergics}} |
|||
[[Category:Propargyl compounds]] |
|||
[[Category:Carboxylate esters]] |
|||
[[Category:Cannabinoids]] |
[[Category:Cannabinoids]] |
||
[[Category: |
[[Category:Benzopyrans]] |
||
[[Category: |
[[Category:Nitrogen heterocycles]] |
||
[[Category: |
[[Category:Oxygen heterocycles]] |
||
[[Category: |
[[Category:Heterocyclic compounds with 3 rings]] |
||
[[Category:1-Piperidinyl compounds]] |
|||
⚫ |