Jump to content

Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Nafenopin: Difference between pages

(Difference between pages)
Page 1
Page 2
Content deleted Content added
VisualWikitext
Saving copy of the {{chembox}} taken from revid 444020926 of page Nafenopin for the Chem/Drugbox validation project (updated: 'KEGG', 'StdInChI', 'CASNo').
 
Wikipedia:WikiProject Unreferenced articles; you can help!
 
Line 1: Line 1:
{{Chembox
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid [{{fullurl:Nafenopin|oldid=444020926}} 444020926] of page [[Nafenopin]] with values updated to verified values.}}
| Verifiedfields = changed
{{chembox
| Watchedfields = changed
⚫
| UNII_Ref = {{fdacite|correct|FDA}}
| verifiedrevid = 462258191
⚫
| UNII = 093W78U96W
| ImageFile = Nafenopin.svg
| ImageFile = Nafenopin.svg
| ImageSize = 200px
| IUPACName = 2-Methyl-2-[4-(1,2,3,4-tetrahydronaphthalen-1-yl)phenoxy]propanoic acid
| IUPACName = 2-Methyl-2-[4-(1,2,3,4-tetrahydronaphthalen-1-yl)phenoxy]propanoic acid
| OtherNames =
| OtherNames = Nafenoic acid
| Section1 = {{Chembox Identifiers
|Section1={{Chembox Identifiers
⚫
| UNII_Ref = {{fdacite|correct|FDA}}
⚫
| InChI = 1S/C20H22O3/c1-20(2,19(21)22)23-16-12-10-15(11-13-16)18-9-5-7-14-6-3-4-8-17(14)18/h3-4,6,8,10-13,18H,5,7,9H2,1-2H3,(H,21,22)
⚫
| UNII = 093W78U96W
⚫
| InChI = 1S/C20H22O3/c1-20(2,19(21)22)23-16-12-10-15(11-13-16)18-9-5-7-14-6-3-4-8-17(14)18/h3-4,6,8,10-13,18H,5,7,9H2,1-2H3,(H,21,22)
| InChIKey1 = XJGBDJOMWKAZJS-UHFFFAOYSA-N
| InChIKey1 = XJGBDJOMWKAZJS-UHFFFAOYSA-N
| InChI1 = 1S/C20H22O3/c1-20(2,19(21)22)23-16-12-10-15(11-13-16)18-9-5-7-14-6-3-4-8-17(14)18/h3-4,6,8,10-13,18H,5,7,9H2,1-2H3,(H,21,22)
| InChI1 = 1S/C20H22O3/c1-20(2,19(21)22)23-16-12-10-15(11-13-16)18-9-5-7-14-6-3-4-8-17(14)18/h3-4,6,8,10-13,18H,5,7,9H2,1-2H3,(H,21,22)
| CASNo = <!-- blanked - oldvalue: 3771-19-5 -->
| CASNo = 3771-19-5
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo_Ref = {{cascite|changed|??}}
| PubChem = 19592
| PubChem = 19592
| ChEBI_Ref = {{ebicite|changed|EBI}}
⚫
| ChemSpiderID = 18456
| ChEBI = 7449
⚫
| KEGG_Ref = {{keggcite|correct|kegg}}
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| KEGG = <!-- blanked - oldvalue: C11371 -->
| ChEMBL = 1909070
⚫
| StdInChIKey = XJGBDJOMWKAZJS-UHFFFAOYSA-N
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫
| ChemSpiderID = 18456
⚫
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = C11371
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
⚫
| StdInChIKey = XJGBDJOMWKAZJS-UHFFFAOYSA-N
| SMILES = O=C(O)C(Oc1ccc(cc1)C3c2ccccc2CCC3)(C)C
| SMILES = O=C(O)C(Oc1ccc(cc1)C3c2ccccc2CCC3)(C)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C20H22O3/c1-20(2,19(21)22)23-16-12-10-15(11-13-16)18-9-5-7-14-6-3-4-8-17(14)18/h3-4,6,8,10-13,18H,5,7,9H2,1-2H3,(H,21,22)
| StdInChI = 1S/C20H22O3/c1-20(2,19(21)22)23-16-12-10-15(11-13-16)18-9-5-7-14-6-3-4-8-17(14)18/h3-4,6,8,10-13,18H,5,7,9H2,1-2H3,(H,21,22)
}}
}}
| Section2 = {{Chembox Properties
|Section2={{Chembox Properties
| C=20|H=22|O=3
| Appearance =
| C=20 | H=22 | O=3
| Density =
| Appearance =
| MeltingPt =
| Density =
| BoilingPt =
| MeltingPt =
| Solubility =
| BoilingPt =
| Solubility =
}}
}}
| Section3 = {{Chembox Hazards
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| MainHazards =
| Autoignition =
| FlashPt =
| AutoignitionPt =
}}
}}
}}
}}'''Nafenopin''' is a [[hypolipidemic agent]].<ref>{{Citation |last=Levine |first=W.G. |title=THE CHOLERETIC EFFECT OF NAFENOPIN |date=1977 |url=http://dx.doi.org/10.1016/b978-0-08-021308-8.50966-2 |work=Abstracts |pages=395 |publisher=Elsevier |access-date=2022-12-21 |last2=Meijer |first2=D.K.F.}}</ref>

==References==
{{reflist}}

{{Lipid modifying agents}}

[[Category:Hypolipidemic agents]]
[[Category:Tetralins]]
[[Category:Phenol ethers]]
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"