Neohesperidose: Difference between revisions
Appearance
Content deleted Content added
Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation ( |
Reference edited with ProveIt #proveit | Add: bibcode, pages, issue, volume, journal, date, title, authors 1-2. | Use this tool. Report bugs. | #UCB_Gadget |
||
(37 intermediate revisions by 22 users not shown) | |||
Line 1: | Line 1: | ||
{{ |
{{Chembox |
||
| Verifiedfields = changed |
|||
⚫ | |||
| Watchedfields = changed |
|||
⚫ | |||
| Name = Neohesperidose |
| Name = Neohesperidose |
||
| ImageFile = Neohesperidose.svg |
| ImageFile = Neohesperidose.svg |
||
| ImageFile2 = Neohesperidose 3D BS.png |
|||
| ImageSize = 200px |
|||
| IUPACName = α-<small>L</small>-Rhamnopyranosyl-(1→2)-<small>D</small>-glucose |
|||
| |
| SystematicName = (2''R'',3''S'',4''R'',5''R'')-3,4,5,6-Tetrahydroxy-2-<nowiki/>{[(2''S'',3''R'',4''R'',5''R'',6''S'')-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy}hexanal |
||
| OtherNames = 2-O-alpha-L-Rhamnopyranosyl-D-glucopyranose<br>2-O-alpha-L-Rhamnosyl-D-glucose<br>2-O-(6-deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranose |
| OtherNames = 2-O-alpha-L-Rhamnopyranosyl-D-glucopyranose<br>2-O-alpha-L-Rhamnosyl-D-glucose<br>2-O-(6-deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranose |
||
| |
|Section1={{Chembox Identifiers |
||
| CASNo_Ref = {{cascite|correct|??}} |
|||
| CASNo = 17074-02-1 |
|||
| |
| CASNo = 17074-02-1 |
||
| |
| PubChem = 441426 |
||
| EINECS = |
|||
| SMILES = CC1C(C(C(C(O1)OC2C(C(C(OC2O)CO)O)O)O)O)O |
|||
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|||
⚫ | |||
| ChemSpiderID = 390159 |
|||
⚫ | |||
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|||
⚫ | |||
| ChEBI = 73992 |
|||
⚫ | |||
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|||
| ExactMass = 326.121297 |
|||
| |
| ChEMBL = 1651520 |
||
| KEGG_Ref = {{keggcite|changed|kegg}} |
|||
⚫ | |||
| |
| KEGG = C08244 |
||
| SMILES = O([C@H]1[C@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O)[C@@H]2O[C@H]([C@H](O)[C@@H](O)[C@H]2O)C |
|||
⚫ | |||
| InChI = 1/C12H22O10/c1-3-5(14)7(16)9(18)12(20-3)22-10-8(17)6(15)4(2-13)21-11(10)19/h3-19H,2H2,1H3/t3-,4+,5-,6+,7+,8-,9+,10+,11+,12-/m0/s1 |
|||
⚫ | |||
| InChIKey = VSRVRBXGIRFARR-OUEGHFHCBJ |
|||
⚫ | |||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|||
⚫ | |||
| StdInChI = 1S/C12H22O10/c1-3-5(14)7(16)9(18)12(20-3)22-10-8(17)6(15)4(2-13)21-11(10)19/h3-19H,2H2,1H3/t3-,4+,5-,6+,7+,8-,9+,10+,11+,12-/m0/s1 |
|||
⚫ | |||
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|||
⚫ | |||
| StdInChIKey = VSRVRBXGIRFARR-OUEGHFHCSA-N |
|||
| Autoignition = |
|||
}} |
|||
⚫ | |||
⚫ | |||
⚫ | |||
| Appearance = |
|||
⚫ | |||
| MeltingPt = |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
| AutoignitionPt = |
|||
⚫ | |||
| Section8 = {{Chembox Related |
|||
| OtherCompounds = [[Rhamnose]]<br />[[Glucose]] |
|||
}} |
|||
}} |
}} |
||
'''Neohesperidose''' is the [[disaccharide]] which is present in some [[flavonoid |
'''Neohesperidose''' is the [[disaccharide]] which is present in some [[flavonoid]]s. It can be found in species of ''[[Typha]]''.<ref>{{cite journal | url=https://www.sciencedirect.com/science/article/abs/pii/S0040402001992117 | doi=10.1016/S0040-4020(01)99211-7 | title=Flavonoids of citrus—VI: The structure of neohesperidose | journal=Tetrahedron | date=January 1963 | volume=19 | issue=5 | pages=773–782 | last1=Horowitz | first1=R. M. | last2=Gentili | first2=Bruno }}</ref><ref name="Andersen">{{Cite journal |doi=10.1016/0031-9422(89)80039-1 |title=Delphinidin-3-neohesperidoside and cyanidin-3- neohesperidoside from receptacles of Podocarpus species |date=1989 |last1=Andersen |first1=Oyvind M. |journal=Phytochemistry |volume=28 |issue=2 |pages=495–497 |bibcode=1989PChem..28..495A }}</ref> |
||
==Neohesperidosides== |
== Neohesperidosides == |
||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | * [http://www.sciencedirect.com/science?_ob=ArticleURL&_udi=B6THR-436X607-4&_user=10&_coverDate=12%2F31%2F1968&_alid=989895831&_rdoc=2&_fmt=high&_orig=search&_cdi=5289&_docanchor=&view=c&_ct=101&_acct=C000050221&_version=1&_urlVersion=0&_userid=10&md5=4c2b6cd1646e71ebf0b420f1abe696a6 Synthesis of neohesperidose, B. H. Koeppen, 1968] |
||
⚫ | |||
⚫ | * [[Myricetin-3-O-neohesperidoside|Myricetin-3-''O''-neohesperidoside]] found in ''[[Physalis angulata]]''<ref>{{Cite journal |doi=10.1016/S0367-326X(01)00281-7 |title=A novel cytotoxic flavonoid glycoside from Physalis angulata |date=2001 |last1=Ismail |first1=N. |last2=Alam |first2=M. |journal=Fitoterapia |volume=72 |issue=6 |pages=676–679 }}</ref> |
||
* [[Neohesperidin]] ([[hesperetin]] 7-''O''-neohesperidoside) |
|||
* [[Neoeriocitrin]] ([[eriodictyol]] 7-''O''-neohesperidoside) |
|||
== See also == |
|||
* [[Pyranose]] |
|||
⚫ | |||
⚫ | * [http://www.sciencedirect.com/science?_ob=ArticleURL&_udi=B6THR-436X607-4&_user=10&_coverDate=12%2F31%2F1968&_alid=989895831&_rdoc=2&_fmt=high&_orig=search&_cdi=5289&_docanchor=&view=c&_ct=101&_acct=C000050221&_version=1&_urlVersion=0&_userid=10&md5=4c2b6cd1646e71ebf0b420f1abe696a6 Synthesis of neohesperidose, B. H. Koeppen, 1968]{{dead link|date=March 2019|bot=medic}}{{cbignore|bot=medic}} |
||
{{Reflist}} |
{{Reflist}} |
||
==External links== |
== External links == |
||
* [http://www.rdchemicals.com/chemicals.php?mode=details&mol_id=8100 Neohesperidose on rdchemicals.com] |
* [http://www.rdchemicals.com/chemicals.php?mode=details&mol_id=8100 Neohesperidose on rdchemicals.com] |
||
[[Category:Disaccharides]] |
[[Category:Disaccharides]] |
||
[[Category:Deoxy sugars]] |
|||
{{organic-compound-stub}} |
{{organic-compound-stub}} |
||
[[fr:Néohespéridose]] |