Orciprenaline: Difference between revisions
Content deleted Content added
Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChEMBL_Ref') per Chem/Drugbox validation (report errors or [[user talk:CheMoB |
Importing Wikidata short description: "Chemical compound" (Shortdesc helper) |
||
(62 intermediate revisions by 42 users not shown) | |||
Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{drugbox | verifiedrevid = 408780797 |
|||
{{Drugbox |
|||
| drug_name = Orciprenaline |
|||
| Verifiedfields = changed |
|||
| IUPAC_name = (''RS'')-5-[1-hydroxy-2-(isopropylamino)ethyl]benzene-1,3-diol |
|||
| verifiedrevid = 408782146 |
|||
| image = Orciprenaline skeletal.svg |
|||
| IUPAC_name = (''RS'')-5-[1-hydroxy-2-(isopropylamino)ethyl]benzene-1,3-diol |
|||
| imagename = 1 : 1 mixture (racemate) |
|||
| image = Orciprenaline.svg |
|||
| width = 200px |
|||
| width = |
|||
| CASNo_Ref = {{cascite|correct|CAS}} |
|||
| chirality = [[Racemic mixture]] |
|||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|||
| USAN = Metaproterenol |
|||
| ChemSpiderID = 3944 |
|||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
<!--Clinical data-->| tradename = |
|||
| UNII = 53QOG569E0 |
|||
| Drugs.com = {{drugs.com|monograph|metaproterenol-sulfate}} |
|||
| InChI = 1/C11H17NO3/c1-7(2)12-6-11(15)8-3-9(13)5-10(14)4-8/h3-5,7,11-15H,6H2,1-2H3 |
|||
| MedlinePlus = a682084 |
|||
| InChIKey = LMOINURANNBYCM-UHFFFAOYAL |
|||
| pregnancy_AU = A |
|||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|||
| legal_AU = S4 |
|||
| ChEMBL = 776 |
|||
| pregnancy_US = C |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|||
| legal_US = Rx-only |
|||
| StdInChI = 1S/C11H17NO3/c1-7(2)12-6-11(15)8-3-9(13)5-10(14)4-8/h3-5,7,11-15H,6H2,1-2H3 |
|||
| routes_of_administration = Inhalation ([[Metered-dose inhaler|MDI]]) and [[Tablet (pharmacy)|tablets]] |
|||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChIKey = LMOINURANNBYCM-UHFFFAOYSA-N |
|||
<!--Pharmacokinetic data-->| bioavailability = 3% if inhaled, 40% if taken orally |
|||
| CAS_number = 586-06-1 |
|||
| protein_bound = |
|||
| ATC_prefix = R03 |
|||
| metabolism = [[Gastrointestinal tract|Gastrointestinal]] and [[liver|hepatic]] |
|||
| ATC_suffix = AB03 |
|||
| ATC_supplemental = {{ATC|R03|CB03}}<br>{{ATC|R03|CB53}} |
|||
| PubChem = 4086 |
|||
| DrugBank = |
|||
| KEGG_Ref = {{keggcite|correct|kegg}} |
|||
| KEGG = D08300 |
|||
| C=11 | H=17 | N=1 | O=3 |
|||
| molecular_weight = 211.258 g/mol |
|||
| bioavailability = 3% if inhaled, 40% if taken orally |
|||
| protein_bound = |
|||
| metabolism = [[Gastrointestinal tract|Gastrointestinal]] and [[liver|hepatic]] |
|||
| solubility = 9.7 |
|||
| melting point = 100 |
|||
| smiles = Oc1cc(cc(O)c1)C(O)CNC(C)C |
|||
| elimination_half-life = 6 hours |
| elimination_half-life = 6 hours |
||
| pregnancy_AU = A |
|||
<!--Identifiers-->| IUPHAR_ligand = 7250 |
|||
| pregnancy_US = C |
|||
| CAS_number_Ref = {{cascite|correct|??}} |
|||
| legal_US = Rx-only |
|||
| CAS_number = 586-06-1 |
|||
| routes_of_administration = Inhalation / tablets |
|||
| ATC_prefix = R03 |
|||
| ATC_suffix = AB03 |
|||
| ATC_supplemental = {{ATC|R03|CB03}}<br>{{ATC|R03|CB53}} |
|||
| PubChem = 4086 |
|||
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|||
| DrugBank = DB00816 |
|||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|||
| ChemSpiderID = 3944 |
|||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| UNII = 53QOG569E0 |
|||
| KEGG_Ref = {{keggcite|correct|kegg}} |
|||
| KEGG = D08300 |
|||
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|||
| ChEBI = 82719 |
|||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|||
| ChEMBL = 776 |
|||
<!--Chemical data-->| C = 11 |
|||
| H = 17 |
|||
| N = 1 |
|||
| O = 3 |
|||
| smiles = Oc1cc(cc(O)c1)C(O)CNC(C)C |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChI = 1S/C11H17NO3/c1-7(2)12-6-11(15)8-3-9(13)5-10(14)4-8/h3-5,7,11-15H,6H2,1-2H3 |
|||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChIKey = LMOINURANNBYCM-UHFFFAOYSA-N |
|||
| solubility = 9.7 |
|||
}} |
}} |
||
'''Orciprenaline''' ([[International Nonproprietary Name|INN]], also known as '''metaproterenol''') is a [[bronchodilator]] used in the treatment of [[asthma]]. Orciprenaline is a moderately selective [[Beta2-adrenergic receptor agonist|beta<sub>2</sub>-adrenergic receptor agonist]] that stimulates receptors of the smooth muscle in the lungs, uterus, and vasculature supplying skeletal muscle, with minimal or no effect on alpha-adrenergic receptors. The pharmacologic effects of beta [[adrenergic]] [[agonist]] drugs, such as orciprenaline, are at least in part attributable to stimulation through beta adrenergic receptors of intracellular adenyl cyclase, the enzyme which catalyzes the conversion of ATP to cAMP. Increased cAMP levels are associated with relaxation of bronchial smooth muscle and inhibition of release of mediators of immediate hypersensitivity from many cells, especially from mast cells. |
|||
'''Orciprenaline''', also known as '''metaproterenol''', is a [[bronchodilator]] used in the treatment of [[asthma]].<ref>{{cite journal |title = DrugBank 3.0: a comprehensive resource for omics research on drugs |vauthors=Knox C, Law V, Jewison T, Liu P, Ly S, Frolkis A, Pon A, Banco K, Mak C, Neveu V, Djoumbou Y, Eisner R, Guo AC, Wishart DS |journal = Nucleic Acids Res. |year = 2011 |volume = 39 |issue = Database issue |pages = D1035-41 | pmid =21059682 |doi=10.1093/nar/gkq1126 |pmc=3013709}}</ref><ref>{{cite journal |title = DrugBank: a knowledgebase for drugs, drug actions and drug targets|author1-link=David S. Wishart |vauthors=Wishart DS, Knox C, Guo AC, Cheng D, Shrivastava S, Tzur D, Gautam B, Hassanali M |journal = Nucleic Acids Res |year = 2008 |volume = 36 |issue = Database issue |pages = D901-6 |pmid = 18048412 |doi=10.1093/nar/gkm958 |pmc=2238889}}</ref> Orciprenaline is a moderately selective [[Beta2-adrenergic agonist|β<sub>2</sub> adrenergic receptor agonist]] that stimulates receptors of the [[smooth muscle]] in the lungs, uterus, and vasculature supplying [[skeletal muscle]], with minimal or no effect on α adrenergic receptors. The pharmacologic effects of β adrenergic [[agonist]] drugs, such as orciprenaline, are at least in part attributable to stimulation through β adrenergic receptors of intracellular [[adenylyl cyclase]], the enzyme which catalyzes the conversion of [[Adenosine triphosphate|ATP]] to [[Cyclic adenosine monophosphate|cAMP]]. Increased cAMP levels are associated with relaxation of bronchial smooth muscle and inhibition of release of mediators of [[immediate hypersensitivity]] from many cells, especially from [[mast cell]]s. |
|||
__TOC__ |
|||
== Possible side effects == |
|||
* tremor |
|||
* nervousness |
|||
* dizziness |
|||
* weakness |
|||
* headache |
|||
* nausea |
|||
* [[tachycardia]] |
|||
;Rare side effects that could be life-threatening |
|||
[[Category:Phenethylamines]] |
|||
* increased difficulty breathing |
|||
* rapid or increased heart rate |
|||
* irregular heartbeat |
|||
* chest pain or discomfort |
|||
== Brand names == |
|||
* Alupent |
|||
* Metaprel |
|||
* Orcibest |
|||
== References == |
|||
{{respiratory-system-drug-stub}} |
|||
{{reflist}} |
|||
{{Asthma_and_copd rx}} |
|||
[[de:Orciprenalin]] |
|||
{{Adrenergics}} |
|||
[[it:Orciprenalina]] |
|||
{{Phenethylamines}} |
|||
[[Category:Chemical substances for emergency medicine]] |
|||
[[Category:Phenylethanolamines]] |
|||
[[Category:Bronchodilators]] |
|||
{{respiratory-system-drug-stub}} |