Oxibendazole: Difference between revisions
Appearance
Content deleted Content added
populated new fields in {{drugbox}} and reordered per bot approval. Report errors and suggestions to User_talk:BogBot |
Entranced98 (talk | contribs) Importing Wikidata short description: "Chemical compound" |
||
(34 intermediate revisions by 19 users not shown) | |||
Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
|||
⚫ | |||
| Watchedfields = changed |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
| width = 215 |
|||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = |
| tradename = |
||
| Drugs.com = {{drugs.com|international|oxibendazole}} |
| Drugs.com = {{drugs.com|international|oxibendazole}} |
||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
||
| pregnancy_US = <!-- A / B |
| pregnancy_US = <!-- A / B / C / D / X --> |
||
| pregnancy_category = |
| pregnancy_category = |
||
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
||
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
||
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
||
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
||
| legal_status = |
| legal_status = Veterinary use only |
||
| routes_of_administration = |
| routes_of_administration = |
||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
| bioavailability = |
| bioavailability = |
||
| protein_bound = |
| protein_bound = |
||
| metabolism = |
| metabolism = |
||
| elimination_half-life = |
| elimination_half-life = |
||
| excretion = |
| excretion = |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CAS_number_Ref = {{cascite|correct|??}} |
|||
| CAS_number = 20559-55-1 |
| CAS_number = 20559-55-1 |
||
| ATCvet = yes |
| ATCvet = yes |
||
| ATC_prefix = P52 |
| ATC_prefix = P52 |
||
| ATC_suffix = AC07 |
| ATC_suffix = AC07 |
||
| ATC_supplemental = |
| ATC_supplemental = |
||
| PubChem = 4622 |
| PubChem = 4622 |
||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| DrugBank = |
| DrugBank = |
||
| UNII_Ref = {{fdacite|correct|FDA}} |
| UNII_Ref = {{fdacite|correct|FDA}} |
||
| UNII = 022N12KJ0X |
| UNII = 022N12KJ0X |
||
| KEGG_Ref = {{keggcite|correct|kegg}} |
| KEGG_Ref = {{keggcite|correct|kegg}} |
||
| KEGG = D05293 |
| KEGG = D05293 |
||
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|||
| ChemSpiderID = 4461 |
|||
<!--Chemical data--> |
<!--Chemical data--> |
||
| chemical_formula = |
| chemical_formula = |
||
| C=12 | H=15 | N=3 | O=3 |
| C=12 | H=15 | N=3 | O=3 |
||
| molecular_weight = 249.26 g/mol |
|||
| smiles = CCCOC1=CC2=C(C=C1)N=C(N2)NC(=O)OC |
| smiles = CCCOC1=CC2=C(C=C1)N=C(N2)NC(=O)OC |
||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChI = 1S/C12H15N3O3/c1-3-6-18-8-4-5-9-10(7-8)14-11(13-9)15-12(16)17-2/h4-5,7H,3,6H2,1-2H3,(H2,13,14,15,16) |
|||
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChIKey = RAOCRURYZCVHMG-UHFFFAOYSA-N |
|||
}} |
}} |
||
'''Oxibendazole''' is a [[benzimidazole]] drug that is used to protect against [[roundworm]]s, [[strongyle (worm)|strongyles]], [[threadworm]]s, [[pinworm]]s and [[lungworm]] infestations in horses and some domestic pets. It is usually white to yellowish in appearance, and may take the form of a powder or a tablet. |
|||
'''Oxibendazole''' is a [[benzimidazole]] drug that is used to protect against [[roundworm]]s, [[strongyle (worm)|strongyles]], [[Strongyloides stercoralis|threadworms]], [[pinworm]]s and [[lungworm]] infestations in horses and some domestic pets.<ref name="Theodorides_1973">{{cite journal | vauthors = Theodorides VJ, Chang J, DiCuollo CJ, Grass GM, Parish RC, Scott GC | title = Oxibendazole, a new broad spectrum anthelmintic effective against gastrointestinal nematodes of domestic animals | journal = The British Veterinary Journal | volume = 129 | issue = 6 | pages = xcontdvii–scvi | date = December 1973 | pmid = 4779247 | doi = 10.1016/s0007-1935(17)36351-0 }}</ref><ref>{{cite book | vauthors = Bowman DD |page = 280 | chapter = Chapter 6: Anti-parasitic Drugs | chapter-url = https://books.google.com/books?id=g_tBWVBevM0C&pg=PA280 |title=Georgis' parasitology for veterinarians. |date=2009 |publisher=Saunders/Elsevier |location=St. Louis, Mo. |isbn=978-1-4160-4412-3 |edition=9th}}</ref> It is usually white to yellowish in appearance, and may take the form of a powder, tablet or paste. |
|||
Oxibendazole can be synthesized from [[acetominophen]] by the following route:<ref>Actor, P. P.; Pagano, J. F.; 1971, {{US Patent|3574845}}</ref> |
|||
:[[File:Oxibendazole scheme.png|500px]] |
|||
==Synthesis== |
|||
[[File:Oxibendazole synthesis.svg|thumb|upright=3|center|Oxibendazole synthesis:<ref>{{Cite patent|country=GB|number=1123317|title=Anthelmintic compositions containing benzimidazole derivatives|pubdate=1968-08-14|assign1 = Smith Kline French Labs}}; {{cite patent | country = US | number = 3574845 | inventor = Actor PP, Pagano JF | assign1 = Smith Kline and French Laboratories Ltd | title = Anthelmintic compositions and methods employing esters of benzimidazolyl carbamic acids and their thio analogs | gdate = 13 April 1971 }}</ref>]]{{clear left}} |
|||
4‑Hydroxyacetamide ('''1''') is alkylated with [[1-bromopropane|''n''-propyl bromide]] in the presence of [[potassium hydroxide]] to give the [[ether]] ('''2'''). Nitration of this product with [[nitric acid|nitric]] and [[sulfuric acid]]s proceeds at the position [[Arene substitution pattern|''ortho'']] to the [[amide]] group ('''3'''), which is then reduced with [[tin(II) chloride|SnCl<sub>2</sub>]] to yield the [[phenylenediamine]] derivative ('''4'''). Reaction of that intermediate with [[thiourea|''S''-methyl isothiourea]] proceeds first by [[aromatization|aromatic cyclisation]] to the [[guanidine]] derivative followed by [[elimination reaction|elimination]] of [[methyl mercaptan]] to yield the 2-aminobenzimidazole system ('''5'''). Acylation with [[methyl chloroformate]] results in the formation of a [[carbamate|urethane]] on the amino group to produce oxibendazole ('''6'''). |
|||
==References== |
==References== |
||
{{reflist}} |
{{reflist}} |
||
{{Anthelmintics}} |
|||
⚫ | |||
[[Category:Benzimidazoles]] |
[[Category:Benzimidazoles]] |
||
[[Category:Carbamates]] |
[[Category:Carbamates]] |
||
[[Category:Phenol ethers]] |
[[Category:Phenol ethers]] |
||
⚫ | |||
{{ |
{{antiinfective-drug-stub}} |
||
{{veterinary-med-stub}} |